| HWiNFO32 v6.00-3620 |
| Creation Time | 10.02.2019 19:12 |
| DESKTOP-LVDO0V0 |
| [Current Computer] | ||
| Computer Name: | DESKTOP-LVDO0V0 | |
| Computer Brand Name: | LENOVO 81C4 | |
| [Operating System] | ||
| Operating System: | Microsoft Windows 10 Home (x64) Build 17134.556 (1803/RS4) | |
| UEFI Boot: | Present | |
| Secure Boot: | Present | |
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 4 | |
| Number Of Logical Processors: | 8 | |
| Intel Core i5-8250U |
| [General Information] | ||
| Processor Name: | Intel Core i5-8250U | |
| Original Processor Frequency: | 1800.0 MHz | |
| Original Processor Frequency [MHz]: | 1800 | |
| CPU ID: | 000806EA | |
| CPU Brand Name: | Intel(R) Core(TM) i5-8250U CPU @ 1.60GHz | |
| CPU Vendor: | GenuineIntel | |
| CPU Stepping: | Y0 | |
| CPU Code Name: | Kaby Lake-R U4+2 | |
| CPU Technology: | 14 nm | |
| CPU S-Spec: | SR3LA, SR3LB | |
| CPU Thermal Design Power (TDP): | 15.0 W | |
| CPU Power Limit 4 (PL4): | 71.0 W | |
| CPU Power Limits (Max): | Power = Unlimited, Time = Unlimited | |
| CPU Power Limit 1 - Long Duration: | (22.00 W) (28.00 sec) [Unlocked] | |
| CPU Power Limit 2 - Short Duration: | (36.00 W) (2.44 ms) [Unlocked] | |
| Configurable TDP Level 1 (Down): | 10.00 W (Unlimited range), 800 MHz | |
| Configurable TDP Level 2 (Up): | 25.00 W (Unlimited range), 1800 MHz | |
| Current Configurable TDP Level: | Nominal [Unlocked] | |
| CPU Max. Junction Temperature (Tj,max): | 100 °C | |
| CPU Type: | Production Unit | |
| CPU Platform: | BGA1356 | |
| Microcode Update Revision: | 96 | |
| Number of CPU Cores: | 4 | |
| Number of Logical CPUs: | 8 | |
| [Operating Points] | ||
| CPU MFM (LowPower): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU LFM (Minimum): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU HFM (Base): | 1800.0 MHz = 18 x 100.0 MHz | |
| CPU Turbo Max: | 3400.0 MHz = 34 x 100.0 MHz [Unlocked] | |
| Turbo Ratio Limits: | 34x (1-4c) | |
| CPU Current: | 3392.5 MHz = 34 x 99.8 MHz @ 1.0618 V | |
| LLC/Ring Maximum: | 3100.0 MHz = 31.00 x 100.0 MHz | |
| LLC/Ring Current: | 3093.2 MHz = 31.00 x 99.8 MHz | |
| System Agent Current: | 399.1 MHz = 4.00 x 99.8 MHz | |
| CPU Bus Type: | Intel Direct Media Interface (DMI) v2.0 | |
| Ring to Core Offset: | Enabled | |
| [IA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 34x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | Unlimited | |
| [GT Overclocking (Slice-EUs)] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 22x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 31.00 A | |
| [CLR (CBo/LLC/Ring) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 31x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | Unlimited | |
| [GT Overclocking (Unslice-Fixed Functions)] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 22x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 31.00 A | |
| [Uncore/SA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Not Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 6.00 A | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 4 x 32 KBytes, Data: 4 x 32 KBytes | |
| L2 Cache: | Integrated: 4 x 256 KBytes | |
| L3 Cache: | 6 MBytes | |
| Instruction TLB: | 2MB/4MB Pages, Fully associative, 8 entries | |
| Data TLB: | 4 KB Pages, 4-way set associative, 64 entries | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Present | |
| Internal ACPI Support | Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Present | |
| Virtual Machine Extensions (VMX) | Present | |
| Safer Mode Extensions (Intel TXT) | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| AVX Support | Present | |
| Fused Multiply Add (FMA) | Present | |
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Present | |
| CMPXCHG16B Support | Present | |
| MOVBE Instruction | Present | |
| POPCNT Instruction | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present | |
| XGETBV/XSETBV OS Enabled | Present | |
| Float16 Instructions | Present | |
| AES Cryptography Support | Present | |
| Random Number Read Instruction (RDRAND) | Present | |
| Extended xAPIC | Present | |
| MONITOR/MWAIT Support | Present | |
| Thermal Monitor 2 | Present | |
| Enhanced SpeedStep Technology | Present | |
| L1 Context ID | Not Present | |
| Send Task Priority Messages Disabling | Present | |
| Processor Context ID | Present | |
| Direct Cache Access | Not Present | |
| TSC-deadline Timer | Present | |
| Performance/Debug Capability MSR | Present | |
| IA32 Debug Interface Support | Present | |
| 64-Bit Debug Store | Present | |
| CPL Qualified Debug Store | Present | |
| [Extended Feature Flags] | ||
| 64-bit Extensions | Present | |
| RDTSCP and TSC_AUX Support | Present | |
| 1 GB large page support | Present | |
| No Execute | Present | |
| SYSCALL/SYSRET Support | Not Present | |
| Bit Manipulation Instructions Set 1 | Present | |
| Bit Manipulation Instructions Set 2 | Present | |
| Advanced Vector Extensions 2 (AVX2) | Present | |
| Advanced Vector Extensions 512 (AVX-512) | Not Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Not Present | |
| AVX-512 Doubleword and Quadword Instructions | Not Present | |
| AVX-512 Byte and Word Instructions | Not Present | |
| AVX-512 Vector Length Extensions | Not Present | |
| AVX-512 52-bit Integer FMA Instructions | Not Present | |
| Secure Hash Algorithm (SHA) Extensions | Not Present | |
| Software Guard Extensions (SGX) Support | Present | |
| Supervisor Mode Execution Protection (SMEP) | Present | |
| Supervisor Mode Access Prevention (SMAP) | Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Present | |
| Read/Write FS/GS Base Instructions | Present | |
| Enhanced Performance String Instruction | Present | |
| INVPCID Instruction | Present | |
| RDSEED Instruction | Present | |
| Multi-precision Add Carry Instructions (ADX) | Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Present | |
| CLWB Instructions | Not Present | |
| TSC_THREAD_OFFSET | Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Not Present | |
| FPU Data Pointer updated only on x87 Exceptions | Not Present | |
| Deprecated FPU CS and FPU DS | Present | |
| Intel Processor Trace | Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Not Present | |
| AVX-512 Galois Fields New Instructions | Not Present | |
| AVX-512 Vector AES | Not Present | |
| AVX-512 Vector Neural Network Instructions | Not Present | |
| AVX-512 Bit Algorithms | Not Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Not Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Not Present | |
| User-Mode Instruction Prevention | Not Present | |
| Protection Keys for User-mode Pages | Not Present | |
| OS Enabled Protection Keys | Not Present | |
| Wait and Pause Enhancements (WAITPKG) | Not Present | |
| Total Memory Encryption | Not Present | |
| Read Processor ID | Not Present | |
| Cache Line Demote | Not Present | |
| MOVDIRI: Direct Stores | Not Present | |
| MOVDIR64B: Direct Stores | Not Present | |
| SGX Launch Configuration | Not Present | |
| AVX-512 4 x Vector Neural Network Instructions Word Variable Precision | Not Present | |
| AVX-512 4 x Fused Multiply Accumulation Packed Single Precision | Not Present | |
| Fast Short REP MOV | Not Present | |
| Platform Configuration (PCONFIG) | Not Present | |
| [Enhanced Features] | ||
| Thermal Monitor 1: | Supported, Enabled | |
| Thermal Monitor 2: | Supported, Enabled | |
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled | |
| Bi-directional PROCHOT#: | Enabled | |
| Extended Auto-HALT State C1E: | Enabled | |
| MLC Streamer Prefetcher | Supported, Enabled | |
| MLC Spatial Prefetcher | Supported, Enabled | |
| DCU Streamer Prefetcher | Supported, Enabled | |
| DCU IP Prefetcher | Supported, Enabled | |
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported | |
| Intel Dynamic FSB Switching: | Not Supported | |
| Intel Turbo Boost Technology: | Supported, Enabled | |
| Programmable Ratio Limits: | Supported, Disabled | |
| Programmable TDC/TDP Limits: | Supported, Disabled | |
| Hardware Duty Cycling: | Supported, Enabled | |
| [CPU SKU Features] | ||
| Display HD Audio: | Supported | |
| DMI x4: | Supported | |
| DRAM ECC: | Not Supported | |
| DMI in Gen2 Mode: | Not Supported | |
| PEG in Gen2 Mode: | Not Supported | |
| 1N Mode DDR Timings: | Supported | |
| Camarillo Device: | Supported | |
| 2 DIMMs per Channel: | Not Supported | |
| X2APIC: | Supported | |
| Dual Memory Channel: | Supported | |
| Integrated GPU: | Enabled | |
| DDR Overclocking: | Disabled | |
| Overclocking by DSKU: | Disabled | |
| DDR3L: | Supported | |
| Maximum Memory Size per Channel: | 32 GB (unlimited) | |
| Overclocking: | Disabled | |
| SMT: | Supported | |
| Additive Graphics: | Supported | |
| Additive Graphics: | Enabled | |
| PCIe Gen 3: | Not Supported | |
| DMI Gen 3: | Not Supported | |
| HDCP: | Supported | |
| DDR4: | Supported | |
| LPDDR3: | Supported | |
| BCLK OC Limit: | 100 MHz | |
| Maximum Supported LPDDR3 Frequency: | 1067 MHz | |
| Maximum Supported DDR4 Frequency: | 1200 MHz | |
| SVID Status: | Enabled | |
| [Voltage Regulator (SVID)] | ||
| VCC VR: | Monolithic Pwr Sys (0x49), IMVP8 | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 39-bit (512 GBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 80000000-100000000 (2048MB-4096MB) Type: | Uncacheable (UC) | |
| Range 40000000-80000000 (1024MB-2048MB) Type: | Uncacheable (UC) | |
| Range 3C000000-40000000 (960MB-1024MB) Type: | Uncacheable (UC) | |
| Range 3A000000-3C000000 (928MB-960MB) Type: | Uncacheable (UC) | |
| Range 39000000-3A000000 (912MB-928MB) Type: | Uncacheable (UC) | |
| Range 38800000-39000000 (904MB-912MB) Type: | Uncacheable (UC) | |
| Range 2000000000-3000000000 (131072MB-196608MB) Type: | Uncacheable (UC) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | LENOVO 81C4 | |
| [Motherboard] | ||
| Motherboard Model: | LENOVO LNVNB161216 | |
| Motherboard Chipset: | Intel Kaby Lake-U + iHDCP 2.2 Premium PCH | |
| Motherboard Slots: | 4xPCI Express x1, 2xPCI Express x4 | |
| PCI Express Version Supported: | v3.0 | |
| USB Version Supported: | v3.0 | |
| [BIOS] | ||
| BIOS Manufacturer: | LENOVO | |
| BIOS Date: | 10/09/2018 | |
| BIOS Version: | 8GCN32WW | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | Unknown | |
| ACPI Devices |
| Standard PS/2 Keyboard |
| Device Name: | Standard PS/2 Keyboard | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0000 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| Legacy device |
| Device Name: | Legacy device | |
| [Assigned Resources] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| [Alternative 1] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| Intel(R) Software Guard Extensions Device |
| Device Name: | Intel(R) Software Guard Extensions Device | |
| [Assigned Resources] | ||
| Memory Location: | 30200000 - 35F7FFFF | |
| [Alternative 1] | ||
| Memory Location: | 30200000 - 35F7FFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 1854 - 1857 | |
| [Alternative 1] | ||
| I/O Port: | 1854 - 1857 | |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 87 | |
| Trusted Platform Module 2.0 |
| Device Name: | Trusted Platform Module 2.0 | |
| [Assigned Resources] | ||
| Memory Location: | FED40000 - FED40FFF | |
| [Alternative 1] | ||
| Memory Location: | FED40000 - FED40FFF | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00B0 - 00B1 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| DMA: | 0 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| Memory Location: | FED00000 - FED003FF | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| PCI Express Root Complex |
| Device Name: | PCI Express Root Complex | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - FFFFFFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000C4000 - 000C3FFF | |
| Memory Location: | 000CC000 - 000CFFFF | |
| Memory Location: | 000D4000 - 000D3FFF | |
| Memory Location: | 000DC000 - 000DFFFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000C0000 - 000C3FFF | |
| Memory Location: | 000C4000 - 000C7FFF | |
| Memory Location: | 000C8000 - 000CBFFF | |
| Memory Location: | 000CC000 - 000CFFFF | |
| Memory Location: | 000D0000 - 000D3FFF | |
| Memory Location: | 000D4000 - 000D7FFF | |
| Memory Location: | 000D8000 - 000DBFFF | |
| Memory Location: | 000DC000 - 000DFFFF | |
| Memory Location: | 3D000000 - DFFFFFFF | |
| Memory Location: | FD000000 - FE7FFFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0077 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| [Alternative 1] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED18000 - FED18FFF | |
| Memory Location: | FED19000 - FED19FFF | |
| Memory Location: | E0000000 - EFFFFFFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| Memory Location: | FED90000 - FED93FFF | |
| Memory Location: | FED45000 - FED8FFFF | |
| Memory Location: | FF000000 - FFFFFFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Memory Location: | 3D000000 - 3D01FFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 0065 | |
| I/O Port: | 0000 - 006F | |
| I/O Port: | 0092 | |
| I/O Port: | FFFF | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | FFFF | |
| I/O Port: | FFFF | |
| I/O Port: | FFFF | |
| I/O Port: | 1800 - 18FE | |
| I/O Port: | 164E - 164F | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 06A4 | |
| [Alternative 1] | ||
| I/O Port: | 06A4 | |
| I/O Port: | 06A0 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FDAF0000 - FDAFFFFF | |
| [Alternative 1] | ||
| Memory Location: | FDAF0000 - FDAFFFFF | |
| Memory Location: | FDAE0000 - FDAEFFFF | |
| Memory Location: | FDAC0000 - FDACFFFF | |
| IRQ: | 14 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 2000 - 20FE | |
| [Alternative 1] | ||
| I/O Port: | 2000 - 20FE | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FD000000 - FDABFFFF | |
| Memory Location: | FE036000 - FE03BFFF | |
| [Alternative 1] | ||
| Memory Location: | FD000000 - FDABFFFF | |
| Memory Location: | FDAD0000 - FDADFFFF | |
| Memory Location: | FDB00000 - FDFFFFFF | |
| Memory Location: | FE000000 - FE01FFFF | |
| Memory Location: | FE036000 - FE03BFFF | |
| Memory Location: | FE03D000 - FE3FFFFF | |
| Memory Location: | FE410000 - FE7FFFFF | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0000 - 026F | |
| [Alternative 1] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| I/O Port: | 0270 - 027F | |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 51 | |
| UCSI USB Connector Manager |
| Device Name: | UCSI USB Connector Manager | |
| [Assigned Resources] | ||
| Memory Location: | 2FF69000 - 2FF69FFF | |
| [Alternative 1] | ||
| Memory Location: | 2FF69000 - 2FF69FFF | |
| Wacom Device |
| Device Name: | Wacom Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 31 | |
| SMBIOS DMI |
| BIOS |
| BIOS Vendor: | LENOVO | |
| BIOS Version: | 8GCN32WW | |
| BIOS Release Date: | 10/09/2018 | |
| BIOS Start Segment: | E000 | |
| BIOS Size: | 6144 KBytes | |
| System BIOS Version: | 1.32 | |
| Embedded Controller Firmware Version: | 1.32 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Not Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Not Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Not Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Not Present | |
| BIOS Boot Specification Support: | Present | |
| Function key-initiated Network Service Boot Support: | Not Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | LENOVO | |
| Product Name: | 81C4 | |
| Product Version: | Lenovo YOGA C930-13IKB | |
| Product Serial Number: | PF158NP5 | |
| UUID: | {25FAC950-9AD0-11E8-B5F5-8C1645E6638B} | |
| SKU Number: | LENOVO_MT_81C4_BU_idea_FM_YOGA C930-13IKB | |
| Family: | YOGA C930-13IKB |
| Mainboard |
| Mainboard Manufacturer: | LENOVO | |
| Mainboard Name: | LNVNB161216 | |
| Mainboard Version: | SDK0J40709 WIN | |
| Mainboard Serial Number: | PF158NP5 | |
| Asset Tag: | NO Asset Tag | |
| Location in chassis: | Type2 - Board Chassis Location |
| System Enclosure |
| Manufacturer: | LENOVO | |
| Case Type: | Convertible | |
| Version: | Lenovo YOGA C930-13IKB | |
| Serial Number: | PF158NP5 | |
| Asset Tag Number: | NO Asset Tag |
| Processor |
| Processor Manufacturer: | Intel(R) Corporation | |
| Processor Version: | Intel(R) Core(TM) i5-8250U CPU @ 1.60GHz | |
| External Clock: | 100 MHz | |
| Maximum Clock Supported: | 8300 MHz | |
| Current Clock: | 3400 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Voltage: | 1.0 V | |
| Processor Upgrade: | Socket BGA1356 | |
| Socket Designation: | U3E1 |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 256 KBytes | |
| Installed Cache Size: | 256 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 Cache |
| Socket Designation: | L2 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L2 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 1024 KBytes | |
| Installed Cache Size: | 1024 KBytes | |
| Cache Associativity: | 4-way Set-Associative |
| L3 Cache |
| Socket Designation: | L3 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L3 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 6144 KBytes | |
| Installed Cache Size: | 6144 KBytes | |
| Cache Associativity: | 12-way Set-Associative |
| OEM Strings |
| OemString1 | ||
| OemString2 | ||
| OemString3 |
| System Configuration Options |
| ConfigOptions1 | ||
| ConfigOptions2 | ||
| ConfigOptions3 |
| BIOS Language |
| en|US|iso8859-1,0 <Active> | ||
| fr|FR|iso8859-1,0 | ||
| zh|TW|unicode,0 | ||
| ja|JP|unicode,0 | ||
| it|IT|iso8859-1,0 | ||
| es|ES|iso8859-1,0 | ||
| de|DE|iso8859-1,0 | ||
| pt|PT|iso8859-1,0 |
| Group Associations |
| Group Associations |
| Group Associations |
| System Event Log |
| Built-in Pointing Device |
| Device Type: | Touch Pad | |
| Interface Type: | PS/2 | |
| Number of Buttons: | 4 |
| Portable Battery |
| Battery Location: | Fake | |
| Battery Manufacturer: | -Virtual Battery 0- | |
| Manufacture Date: | 08/08/2010 | |
| Serial Number: | Battery 0 | |
| Device Name: | CRB Battery 0 | |
| Device Chemistry: | Zinc Air | |
| Design Capacity: | Unknown | |
| Design Voltage: | Unknown | |
| SBDS Verison Number: | Unknown | |
| Max. Error in Battery Data: | Unknown | |
| SBDS Serial Number: | Unknown | |
| SBDS Manufacture Date: | Unknown | |
| SBDS Device Chemistry: | LithiumPolymer |
| Hardware Security |
| Power-on Password: | Disabled | |
| Keyboard Password: | Disabled | |
| Administrator Password: | Disabled | |
| Front Panel Reset: | Disabled |
| Voltage Probe |
| Description: | Voltage Probe Description | |
| Location: | Unknown | |
| Status: | Unknown | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Cooling Device |
| Type: | Fan | |
| Description: | Cooling Device Description | |
| Status: | OK | |
| Nominal Speed: | 8192 RPM |
| Temperature Probe |
| Description: | Temperature Probe Description | |
| Location: | Unknown | |
| Status: | Unknown | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| System Boot Information |
| Boot Status: | No error occured |
| System Power Supply |
| Location: | OEM Define 0 | |
| Device Name: | OEM Define 1 | |
| Manufacturer: | OEM Define 2 | |
| Serial Number: | OEM Define 3 | |
| Asset Tag Number: | OEM Define 4 | |
| Model Part Number: | OEM Define 5 | |
| Revision Level: | OEM Define 6 | |
| Max Power Capacity: | 75 mW | |
| Power Supply Status: | Not Present | |
| Power Supply Type: | Regulator | |
| Power Status: | OK | |
| Hot replaceable: | No | |
| Unplugged from wall: | Yes |
| Additional Information |
| On Board Device |
| Device Description: | IGD | |
| Device Type: | Video Adapter | |
| Device Status: | Disabled | |
| Intel ASF |
| Intel ASF Status: | Enabled |
| Intel AMT |
| Intel AMT Support: | Supported | |
| Intel AMT Status: | Enabled | |
| IDE-R Status: | Enabled | |
| SOL Status: | Enabled | |
| Network Interface: | Enabled |
| Intel vPro |
| CPU VT-x Support: | Supported | |
| CPU VT-x Status: | Enabled | |
| CPU VT-x2 Support: | Not Supported | |
| CPU VT-x2 Status: | Disabled | |
| CPU TXT Support: | Not Supported | |
| CPU TXT Status: | Disabled | |
| CPU VMX Status: | Enabled | |
| CPU SMX Status: | Disabled | |
| Intel ME Status: | Enabled | |
| Intel OST Firmware Support: | Not Supported | |
| Intel ASF Firmware Support: | Not Supported | |
| Intel AMT Pro Firmware Support: | Not Supported | |
| Intel AMT Basic Firmware Support: | Not Supported | |
| Intel TPM Firmware Support: | Not Supported | |
| Intel Castle Peak Support: | Not Supported | |
| Intel WoX Support: | Not Supported | |
| Intel Virtualization Engine Support: | Not Supported | |
| Intel Anti-Theft Technology Support: | Not Supported | |
| TPM On-board: | Not Supported | |
| Intel Anti-Theft Technology Enrolled: | Not Supported | |
| Intel ME Version: | v11.8, Build 3460, Hotfix 50 | |
| BIOS VT-x Support: | Not Supported | |
| BIOS VT-d Support: | Supported | |
| BIOS TXT Support: | Supported | |
| BIOS TPM Support: | Not Supported | |
| BIOS ME Support: | Not Supported | |
| BIOS VA Extensions Support: | Supported | |
| Intel AT PBA For Recovery Support: | Not Supported | |
| Intel AT WWAN Support: | Not Supported |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 32 GBytes | |
| Memory Devices: | 2 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | ChannelA-DIMM0 | |
| Bank Locator: | BANK 0 | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2400 MHz | |
| Manufacturer: | Samsung | |
| Serial Number: | 00000000 | |
| Part Number: | M471A5244CB0-CTD | |
| Asset Tag: | 9876543210 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | ChannelB-DIMM0 | |
| Bank Locator: | BANK 2 | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2400 MHz | |
| Manufacturer: | Samsung | |
| Serial Number: | 00000000 | |
| Part Number: | M471A5244CB0-CTD | |
| Asset Tag: | 9876543210 |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Width: | 2 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 003FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | 1 | |
| Interleave Data Depth: | 1 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 003FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | 2 | |
| Interleave Data Depth: | 1 |
| Port Connectors |
| Keyboard Port |
| Port Type: | Keyboard Port | |
| Internal Reference: | J1A1 | |
| Internal Connector Type: | None | |
| External Reference: | Keyboard | |
| External Connector Type: | PS/2 |
| Mouse Port |
| Port Type: | Mouse Port | |
| Internal Reference: | J1A1 | |
| Internal Connector Type: | None | |
| External Reference: | Mouse | |
| External Connector Type: | PS/2 |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J2A1 | |
| Internal Connector Type: | None | |
| External Reference: | TV OUT | |
| External Connector Type: | Mini-DIN |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J2A2 | |
| Internal Connector Type: | None | |
| External Reference: | CRT | |
| External Connector Type: | DB-15 pin female |
| Serial Port 16550A Compatible |
| Port Type: | Serial Port 16550A Compatible | |
| Internal Reference: | J2A2 | |
| Internal Connector Type: | None | |
| External Reference: | COM 1 | |
| External Connector Type: | DB-9 pin male |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J5A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J5A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J5A2 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| Network Port |
| Port Type: | Network Port | |
| Internal Reference: | J5A1 | |
| Internal Connector Type: | None | |
| External Reference: | Network | |
| External Connector Type: | RJ-45 |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9G2 | |
| Internal Connector Type: | On Board Floppy | |
| External Reference: | OnBoard Floppy Type | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J7J1 | |
| Internal Connector Type: | On Board IDE | |
| External Reference: | OnBoard Primary IDE | |
| External Connector Type: | None |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J30 | |
| Internal Connector Type: | None | |
| External Reference: | Microphone In | |
| External Connector Type: | Mini-jack (headphones) |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J30 | |
| Internal Connector Type: | None | |
| External Reference: | Line In | |
| External Connector Type: | Mini-jack (headphones) |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J30 | |
| Internal Connector Type: | None | |
| External Reference: | Speaker Out | |
| External Connector Type: | Mini-jack (headphones) |
| System Slots |
| J6C1 |
| Slot Designation: | J6C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J6D2 |
| Slot Designation: | J6D2 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J7C1 |
| Slot Designation: | J7C1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J7D1 |
| Slot Designation: | J7D1 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Unknown |
| J8C1 |
| Slot Designation: | J8C1 | |
| Slot Type: | PCI Express x4 | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 4x / x4 | |
| Slot Length: | Unknown |
| Intel ME |
| [ME Host Status] | ||
| ME Current Working State: | Normal | |
| Manufacturing Mode: | Not Active | |
| ME Current Operation Mode: | Normal | |
| Boot Guard Status: | Enabled | |
| Boot Guard Verified Boot Policy: | Enabled | |
| Boot Guard Measured Boot Policy: | Disabled | |
| [Intel Manageability Engine Features] | ||
| Intel ME Version: | 11.8, Build 3460, Hot Fix 50 | |
| Intel ME Recovery Image Version: | 11.8, Build 3460, Hot Fix 50 | |
| Intel ME FITC Version: | 11.8, Build 3434, Hot Fix 50 | |
| [ME Firmware Capabilities] | ||
| Full Network Manageability: | Not Capable | |
| Standard Network Manageability: | Not Capable | |
| Manageability (AMT): | Not Capable | |
| Small Business Advantage: | Not Capable | |
| Intel Integrated Touch: | Not Capable | |
| Intel Anti-Theft: | Not Capable | |
| Capability Licensing Service: | Capable | |
| Virtualization Engine: | Not Capable | |
| Intel Sensor Hub (ISH): | Not Capable | |
| ICC Over Clocking: | Not Capable | |
| Protected Audio Video Path (PAVP): | Capable | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Not Capable | |
| IPV6: | Not Capable | |
| KVM Remote Control: | Not Capable | |
| Outbreak Containment Heuristic (OCH): | Not Capable | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Not Capable | |
| Wireless LAN (WLAN): | Not Capable | |
| Platform Trust Technology (PTT): | Capable | |
| Near Field Communication (NFC): | Not Capable | |
| [ME Firmware Feature State] | ||
| Full Network Manageability: | Disabled | |
| Standard Network Manageability: | Disabled | |
| Manageability (AMT): | Disabled | |
| Small Business Advantage: | Not Capable | |
| MEI3: | Not Capable | |
| Intel Anti-Theft: | Disabled | |
| Capability Licensing Service: | Enabled | |
| Virtualization Engine: | Disabled | |
| Intel Sensor Hub (ISH): | Disabled | |
| ICC Over Clocking: | Disabled | |
| Protected Audio Video Path (PAVP): | Enabled | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Disabled | |
| IPV6: | Disabled | |
| KVM Remote Control: | Disabled | |
| Outbreak Containment Heuristic (OCH): | Disabled | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Disabled | |
| Wireless LAN (WLAN): | Disabled | |
| Platform Trust Technology (PTT): | Disabled | |
| Near Field Communication (NFC): | Disabled | |
| [ME Firmware Platform Type] | ||
| Platform Target Usage Type: | Mobile | |
| SKU: | Regular SKU | |
| ME Firmware Image Type: | Consumer SKU Firmware | |
| Platform Brand: | None | |
| Host ME Region Flash Protection Override (HMRFPO) Status: | Disabled | |
| Memory |
| [General information] | ||
| Total Memory Size: | 8 GBytes | |
| Total Memory Size [MB]: | 8192 | |
| [Current Performance Settings] | ||
| Maximum Supported Memory Clock: | 1200.0 MHz | |
| Current Memory Clock: | 665.2 MHz | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 10-10-10-28 | |
| Memory Runs At: | Dual-Channel | |
| Command Rate: | 1T | |
| Read to Read Delay (tRD_RD) Same Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different DIMM: | 7T | |
| Write to Write Delay (tWR_WR) Same Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different DIMM: | 7T | |
| Read to Write Delay (tRD_WR) Same Rank: | 8T | |
| Read to Write Delay (tRD_WR) Different Rank: | 8T | |
| Read to Write Delay (tRD_WR) Different DIMM: | 10T | |
| Write to Read Delay (tWR_RD) Same Rank (tWTR): | 19T | |
| Write to Read Delay (tWR_RD) Different Rank: | 16T | |
| Write to Read Delay (tWR_RD) Different DIMM: | 6T | |
| RAS# to RAS# Delay (tRRD): | 5T | |
| Refresh Cycle Time (tRFC): | 234T | |
| Four Activate Window (tFAW): | 20T | |
| Bus |
| PCI Bus #0 |
| Intel Kaby Lake R U - Host Bridge/DRAM Controller [Y0] |
| [General Information] | ||
| Device Name: | Intel Kaby Lake R U - Host Bridge/DRAM Controller [Y0] | |
| Original Device Name: | Intel Kaby Lake R U - Host Bridge/DRAM Controller [Y0] | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 8 [Y0] | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_5914&SUBSYS_382117AA&REV_08 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) Xeon(R) E3 - 1200 v6/7th Gen Intel(R) Core(TM) Host Bridge/DRAM Registers - 5914 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_5914&SUBSYS_382117AA&REV_08\3&11583659&0&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| Intel UHD Graphics 620 (Kaby Lake R U GT2) - Integrated Graphics Controller [Y0] |
| [General Information] | ||
| Device Name: | Intel UHD Graphics 620 (Kaby Lake R U GT2) - Integrated Graphics Controller [Y0] | |
| Original Device Name: | Intel UHD Graphics 620 (Kaby Lake R U GT2) - Integrated Graphics Controller [Y0] | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | 7 [Y0] | |
| PCI Address (Bus:Device:Function) Number: | 0:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_5917&SUBSYS_380317AA&REV_07 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Current Link Width: | Not negotiated | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFA000000 | |
| Memory Base Address 2 | 2FA0000000 | |
| I/O Base Address 4 | 3000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) UHD Graphics 620 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 23.20.16.5037 | |
| Driver Date: | 18-Apr-2018 | |
| DCH/UWD Driver: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_5917&SUBSYS_380317AA&REV_07\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Intel Skylake/Kaby Lake/Coffee Lake/Whiskey Lake - Dynamic Platform & Thermal Framework Processor Participant |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake/Coffee Lake/Whiskey Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| Original Device Name: | Intel Skylake/Kaby Lake/Coffee Lake/Whiskey Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 8 | |
| PCI Address (Bus:Device:Function) Number: | 0:4:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_1903&SUBSYS_381C17AA&REV_08 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFB010000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Dynamic Platform and Thermal Framework Processor Participant | |
| Driver Provider: | Intel | |
| Driver Version: | 8.3.10208.5644 | |
| Driver Date: | 27-Nov-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_1903&SUBSYS_381C17AA&REV_08\3&11583659&0&20 | |
| Location Paths | PCIROOT(0)#PCI(0400) | |
| Intel Skylake-U/Y PCH - USB 3.0 xHCI Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - USB 3.0 xHCI Controller [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - USB 3.0 xHCI Controller [C1] | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D2F&SUBSYS_386A17AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 6E300000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 3.0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI | |
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 10-Apr-2018 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D2F&SUBSYS_386A17AA&REV_21\3&11583659&0&A0 | |
| Location Paths | PCIROOT(0)#PCI(1400) | |
| USB Root Hub |
| [Port1] : Složené zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | TwinHan Technology | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Složené zařízení USB | |
| Hardware ID: | USB\VID_13D3&PID_56B2 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní hostitelský řadič USB) | |
| Driver Description: | Složené zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_13D3&PID_56B2\5&2AC1405B&0&1 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(1) | |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : Synaptics WBDI - SGX |
| [Device Information] | ||
| Device Manufacturer: | Synaptics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Synaptics WBDI - SGX | |
| Hardware ID: | USB\VID_06CB&PID_0081 | |
| [Driver Information] | ||
| Driver Manufacturer: | Synaptics Incorporated | |
| Driver Description: | Synaptics WBDI - SGX | |
| Driver Provider: | Synaptics Incorporated | |
| Driver Version: | 5.5.2804.1050 | |
| Driver Date: | 29-Jun-2018 | |
| DeviceInstanceId | USB\VID_06CB&PID_0081\9EB9988636C1 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(5) | |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0025 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 20.60.0.4 | |
| Driver Date: | 04-May-2018 | |
| DeviceInstanceId | USB\VID_8087&PID_0025\5&2AC1405B&0&8 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(8) | |
| [Port9] : No Device Connected |
| [Port10] : No Device Connected |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| Intel Skylake/Kaby Lake-U/Y PCH - Thermal Subsystem [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - Thermal Subsystem [C1] | |
| Original Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - Thermal Subsystem [C1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D31&SUBSYS_385A17AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTC# | |
| Memory Base Address 0 | 2FFB022000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile Intel(R) Processor Family I/O Thermal subsystem - 9D31 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D31&SUBSYS_385A17AA&REV_21\3&11583659&0&A2 | |
| Location Paths | PCIROOT(0)#PCI(1402) | |
| Intel Skylake-U/Y PCH - LPSS: I2C Controller #0 [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - LPSS: I2C Controller #0 [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - LPSS: I2C Controller #0 [C1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:21:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D60&SUBSYS_385F17AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFFFFB000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - 9D60 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.1725.1 | |
| Driver Date: | 23-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D60&SUBSYS_385F17AA&REV_21\3&11583659&0&A8 | |
| Location Paths | PCIROOT(0)#PCI(1500) | |
| Intel Skylake-U/Y PCH - LPSS: I2C Controller #1 [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - LPSS: I2C Controller #1 [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - LPSS: I2C Controller #1 [C1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:21:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D61&SUBSYS_385717AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ17 | |
| Interrupt Pin: | INTB# | |
| Memory Base Address 0 | 2FFFFFC000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - 9D61 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.1725.1 | |
| Driver Date: | 23-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D61&SUBSYS_385717AA&REV_21\3&11583659&0&A9 | |
| Location Paths | PCIROOT(0)#PCI(1501) | |
| Intel Skylake-U/Y PCH - LPSS: I2C Controller #3 [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - LPSS: I2C Controller #3 [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - LPSS: I2C Controller #3 [C1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:21:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D63&SUBSYS_380917AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ19 | |
| Interrupt Pin: | INTD# | |
| Memory Base Address 0 | 2FFFFFD000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - 9D63 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.1725.1 | |
| Driver Date: | 23-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D63&SUBSYS_380917AA&REV_21\3&11583659&0&AB | |
| Location Paths | PCIROOT(0)#PCI(1503) | |
| Intel Skylake-U/Y PCH - CSME: HECI #1 [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - CSME: HECI #1 [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - CSME: HECI #1 [C1] | |
| Device Class: | Unknown Communication Device | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:22:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D3A&SUBSYS_386817AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFFFFE000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Management Engine Interface | |
| Driver Provider: | Intel | |
| Driver Version: | 11.7.0.1057 | |
| Driver Date: | 19-Nov-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D3A&SUBSYS_386817AA&REV_21\3&11583659&0&B0 | |
| Location Paths | PCIROOT(0)#PCI(1600) | |
| Intel Skylake-U/Y PCH - LPSS: UART Controller #2 [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - LPSS: UART Controller #2 [C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - LPSS: UART Controller #2 [C1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:25:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D66&SUBSYS_381017AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | IRQ32 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFFFFF000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO UART Host Controller - 9D66 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.1725.1 | |
| Driver Date: | 23-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D66&SUBSYS_381017AA&REV_21\3&11583659&0&C8 | |
| Location Paths | PCIROOT(0)#PCI(1900) | |
| Intel Skylake-U/Y PCH - PCI Express Root Port #1 [A1/C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #1 [A1/C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #1 [A1/C1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [A1/C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D10&SUBSYS_0000002F&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 4x | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Capable | |
| Hot-Plug Surprise: | Capable | |
| Slot Power Limit: | 25.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | >4 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile Intel(R) Processor Family I/O PCI Express Root Port #1 - 9D10 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D10&SUBSYS_384F17AA&REV_F1\3&11583659&0&E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00) | |
| PCI Express x4 Bus #1 |
| Intel Skylake-U/Y PCH - PCI Express Root Port #5 [A1/C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #5 [A1/C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #5 [A1/C1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [A1/C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D14&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 5.0 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile Intel(R) Processor Family I/O PCI Express Root Port #5 - 9D14 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D14&SUBSYS_385B17AA&REV_F1\3&11583659&0&E4 | |
| Location Paths | PCIROOT(0)#PCI(1C04) | |
| PCI Express x1 Bus #107 |
| Intel 9260NGW Wireless-AC Wireless Network Adapter |
| [General Information] | ||
| Device Name: | Intel 9260NGW Wireless-AC Wireless Network Adapter | |
| Original Device Name: | Intel 9260NGW Wireless-AC Wireless Network Adapter | |
| Device Class: | Unknown Network Adapter | |
| Revision ID: | 29 | |
| PCI Address (Bus:Device:Function) Number: | 107:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_2526&SUBSYS_00148086&REV_29 | |
| [PCI Express] | ||
| Version: | 2.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 5.0 GT/s | |
| Current Link Speed: | 5.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 2 - 4 us | |
| L1 Exit Latency: | 4 - 8 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 6E200000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless-AC 9260 160MHz | |
| Driver Provider: | Intel | |
| Driver Version: | 20.100.0.100 | |
| Driver Date: | 11-Nov-2018 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2526&SUBSYS_00148086&REV_29\4&28CDB90&0&00E4 | |
| Location Paths | PCIROOT(0)#PCI(1C04)#PCI(0000) | |
| Intel Skylake-U/Y PCH - PCI Express Root Port #9 [A1/C1] |
| [General Information] | ||
| Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #9 [A1/C1] | |
| Original Device Name: | Intel Skylake-U/Y PCH - PCI Express Root Port #9 [A1/C1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [A1/C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:29:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D18&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 4x | |
| Current Link Width: | 4x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 25.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile Intel(R) Processor Family I/O PCI Express Root Port #9 - 9D18 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D18&SUBSYS_384B17AA&REV_F1\3&11583659&0&E8 | |
| Location Paths | PCIROOT(0)#PCI(1D00) | |
| PCI Express x4 Bus #108 |
| Hynix Semiconductor, Device ID: 1527 |
| [General Information] | ||
| Device Name: | Hynix Semiconductor, Device ID: 1527 | |
| Original Device Name: | Hynix Semiconductor, Device ID: 1527 | |
| Device Class: | NVMe Controller | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 108:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1C5C&DEV_1527&SUBSYS_15271C5C&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 4x | |
| Current Link Width: | 4x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 256 - 512 ns | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 6E100000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Řadič Standard NVM Express | |
| Driver Description: | Řadič Standard NVM Express | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.81 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1C5C&DEV_1527&SUBSYS_15271C5C&REV_00\4&158C6533&0&00E8 | |
| Location Paths | PCIROOT(0)#PCI(1D00)#PCI(0000) | |
| Intel Kaby Lake-U + iHDCP 2.2 Premium PCH - LPC/eSPI Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Kaby Lake-U + iHDCP 2.2 Premium PCH - LPC/eSPI Controller [C1] | |
| Original Device Name: | Intel Kaby Lake-U + iHDCP 2.2 Premium PCH - LPC/eSPI Controller [C1] | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D4E&SUBSYS_381617AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile 7th/8th Generation Intel(R) Processor Family I/O LPC Controller (U with iHDCP2.2 Premium) - 9D4E | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D4E&SUBSYS_381617AA&REV_21\3&11583659&0&F8 | |
| Location Paths | PCIROOT(0)#PCI(1F00) | |
| Intel Skylake/Kaby Lake-U/Y/ PCH - Power Management Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake-U/Y/ PCH - Power Management Controller [C1] | |
| Original Device Name: | Intel Skylake/Kaby Lake-U/Y/ PCH - Power Management Controller [C1] | |
| Device Class: | Unknown Memory | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D21&SUBSYS_386C17AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | 6E310000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile Intel(R) Processor Family I/O PMC - 9D21 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D21&SUBSYS_386C17AA&REV_21\3&11583659&0&FA | |
| Location Paths | PCIROOT(0)#PCI(1F02) | |
| Intel Kaby Lake-U/Y PCH - High Definition Audio Controller |
| [General Information] | ||
| Device Name: | Intel Kaby Lake-U/Y PCH - High Definition Audio Controller | |
| Original Device Name: | Intel Kaby Lake-U/Y PCH - High Definition Audio Controller | |
| Device Class: | Multimedia Audio Adapter | |
| Revision ID: | 21 | |
| PCI Address (Bus:Device:Function) Number: | 0:31:3 | |
| PCI Latency Timer: | 32 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D71&SUBSYS_383117AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFB018000 | |
| Memory Base Address 4 | 2FFB000000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel(R) Corporation | |
| Driver Description: | Zvukový řadič technologie Intel(R) Smart Sound | |
| Driver Provider: | Intel(R) Corporation | |
| Driver Version: | 9.21.0.3669 | |
| Driver Date: | 22-Jun-2018 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D71&SUBSYS_383117AA&REV_21\3&11583659&0&FB | |
| Location Paths | PCIROOT(0)#PCI(1F03) | |
| Intel Skylake/Kaby Lake-U/Y PCH - SMBus Host Controller [C1] |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - SMBus Host Controller [C1] | |
| Original Device Name: | Intel Skylake/Kaby Lake-U/Y PCH - SMBus Host Controller [C1] | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 21 [C1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9D23&SUBSYS_386717AA&REV_21 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 2FFB01C000 | |
| I/O Base Address 4 | 3040 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Mobile Intel(R) Processor Family I/O SMBUS - 9D23 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.45 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9D23&SUBSYS_386717AA&REV_21\3&11583659&0&FC | |
| Location Paths | PCIROOT(0)#PCI(1F04) | |
| Video Adapter |
| Intel UHD Graphics 620 |
| [Video chipset] | ||
| Video Chipset: | Intel UHD Graphics 620 | |
| Video Chipset Codename: | Kaby Lake R U GT2 | |
| Video Memory: | 1024 MBytes | |
| [Video Card] | ||
| Video Card: | Intel UHD Graphics 620 (Kaby Lake R U GT2) - Integrated Graphics Controller [Y0] [Lenovo] | |
| Video Bus: | Integrated | |
| Video RAMDAC: | Internal | |
| Video BIOS Version: | Unknown | |
| [Performance] | ||
| Video Unit Clock: | 400.0 MHz | |
| Memory Clock: | 665.0 MHz | |
| Hardware ID: | PCI\VEN_8086&DEV_5917&SUBSYS_380317AA&REV_07 | |
| PCI Location (Bus:Dev:Fnc): | 0:02:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) UHD Graphics 620 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 23.20.16.5037 | |
| Driver Date: | 18-Apr-2018 | |
| DCH/UWD Driver: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_5917&SUBSYS_380317AA&REV_07\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Monitor |
| Lenovo [Unknown Model: LEN8890] |
| [General information] | ||
| Monitor Name: | Lenovo [Unknown Model: LEN8890] | |
| Monitor Name (Manuf): | AUO B139HAN03.0 | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 0, Year: 2016 | |
| Monitor Hardware ID: | Monitor\LEN8890 | |
| Max. Vertical Size: | 17 cm | |
| Max. Horizontal Size: | 31 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 8 Bits per Primary Color | |
| Digital Video Interface Standard Supported: | DisplayPort | |
| Display Type: | Monochrome/grey scale | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF Supported: | Not Supported | |
| DFP 1.x Compatible: | Yes | |
| [Supported Video Modes] | ||
| 1920 x 1080 | 309 x 174 mm, Pixel Clock 141.00 MHz | |
| Drives |
| (S)ATA/ATAPI Drives |
| HFS256GD9TNG-62A0A |
| Drive Model: | HFS256GD9TNG-62A0A | |
| Drive Serial Number: | MS87N616710407O3I | |
| Drive Firmware Revision: | 80001E00 | |
| NVMe Version Supported: | v1.2 | |
| Drive Capacity: | 244,198 MBytes (256 GB) | |
| Drive Capacity [MB]: | 244198 | |
| [Capabilities] | ||
| Volatile Write Cache: | Present | |
| Compare Command: | Supported | |
| Write Uncorrectable Command: | Supported | |
| Dataset Management: | Supported | |
| Write Zeroes: | Supported | |
| Save field set to a non-zero value: | Supported | |
| Reservations: | Not Supported | |
| Timestamp: | Not Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| Available Space Below Threshold: | OK | |
| Temperature Exceeded Critical Threshold: | OK | |
| Device Reliablity Degraded: | OK | |
| Media In Read Only Mode: | OK | |
| Volatile Memory Backup Device Failed: | OK | |
| Drive Temperature: | 44 °C | |
| Warning Temperature Threshold: | 79 °C | |
| Critical Temperature Threshold: | 81 °C | |
| Time Above Warning Temperature Threshold: | 0 minutes | |
| Time Above Critical Temperature Threshold: | 0 minutes | |
| Spare Capacity Available: | 100% | |
| Device Health: | 100% | |
| Power Cycles: | 52 | |
| Power On Hours: | 55 hours | |
| Unsafe Shutdowns: | 19 | |
| Media Errors: | 0 | |
| Total Host Reads: | 786 GBytes | |
| Total Host Writes: | 830 GBytes | |
| Audio |
| Intel Kaby Lake-U/Y PCH - High Definition Audio Controller |
| Audio Adapter: | Intel Kaby Lake-U/Y PCH - High Definition Audio Controller | |
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_9D71&SUBSYS_383117AA&REV_21 | |
| High Definition Audio Codec: | RealTek ALC298 | |
| Audio Codec Hardware ID: | HDAUDIO\FUNC_01&VEN_10EC&DEV_0298&SUBSYS_00000000 |
| Network |
| Intel 9260NGW Wireless-AC Wireless Network Adapter |
| [General information] | ||
| Network Card: | Intel 9260NGW Wireless-AC Wireless Network Adapter | |
| Vendor Description: | Microsoft | |
| MAC Address: | 3C-6A-A7-52-B6-79 | |
| [Capabilities] | ||
| Maximum Link Speed: | 866 Mbps | |
| Transmit Buffer Size: | 9 Bytes | |
| Receive Buffer Size: | 9 Bytes | |
| Hardware ID: | PCI\VEN_8086&DEV_2526&SUBSYS_00148086&REV_29 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless-AC 9260 160MHz | |
| Driver Provider: | Intel | |
| Driver Version: | 20.100.0.100 | |
| Driver Date: | 11-Nov-2018 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_2526&SUBSYS_00148086&REV_29\4&28CDB90&0&00E4 | |
| Location Paths | PCIROOT(0)#PCI(1C04)#PCI(0000) | |
| Ports |
| Serial Ports |
| Parallel Ports |
| USB |
| Hostitelský řadič USB kompatibilní s rozhraním xHCI |
| Root Hub |
| [Port1] : Složené zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | TwinHan Technology | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Složené zařízení USB | |
| Hardware ID: | USB\VID_13D3&PID_56B2 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní hostitelský řadič USB) | |
| Driver Description: | Složené zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_13D3&PID_56B2\5&2AC1405B&0&1 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(1) | |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : Synaptics WBDI - SGX |
| [Device Information] | ||
| Device Manufacturer: | Synaptics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Synaptics WBDI - SGX | |
| Hardware ID: | USB\VID_06CB&PID_0081 | |
| [Driver Information] | ||
| Driver Manufacturer: | Synaptics Incorporated | |
| Driver Description: | Synaptics WBDI - SGX | |
| Driver Provider: | Synaptics Incorporated | |
| Driver Version: | 5.5.2804.1050 | |
| Driver Date: | 29-Jun-2018 | |
| DeviceInstanceId | USB\VID_06CB&PID_0081\9EB9988636C1 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(5) | |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0025 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 20.60.0.4 | |
| Driver Date: | 04-May-2018 | |
| DeviceInstanceId | USB\VID_8087&PID_0025\5&2AC1405B&0&8 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(8) | |
| [Port9] : No Device Connected |
| [Port10] : No Device Connected |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | BASE-BAT | |
| Manufacturer Name: | Simplo | |
| Serial Number: | 123456789 | |
| Unique ID: | 123456789SimploBASE-BAT | |
| Chemistry: | ||
| Designed Capacity: | 60000 mWh | |
| Full Charged Capacity: | 59150 mWh | |
| Wear Level: | 1.4 % | |
| [Current Power Status] | ||
| Power Status: | On AC Power | |
| Current Capacity: | 58980 mWh (99.7 %) | |
| Current Voltage: | 8.714 V | |