| | | | |
|
| Creation Time | | 25.04.2020 10:55 | |
|
| |
|
| [Current Computer]
|
| Computer Name: | LAPTOP-BS4Q2V94
|
| Computer Brand Name: | Acer Swift SF313-52G
|
| | |
|
| [Operating System]
|
| Operating System: | Microsoft Windows 10 Home (x64) Build 18363.778 (1909/November 2019 Update)
|
| UEFI Boot: | Present
|
| Secure Boot: | Present
|
| | |
|
| Current User Name: | acer
|
| |
|
| [CPU Unit Count]
|
| Number Of Processor Packages (Physical): | 1
|
| Number Of Processor Cores: | 4
|
| Number Of Logical Processors: | 8
|
| |
|
| [General Information]
|
| Processor Name: | Intel Core i5-1035G1
|
| Original Processor Frequency: | 1200.0 MHz
|
| Original Processor Frequency [MHz]: | 1200
|
| | |
|
| CPU ID: | 000706E5
|
| CPU Brand Name: | Intel(R) Core(TM) i5-1035G1 CPU @ 1.00GHz
|
| CPU Vendor: | GenuineIntel
|
| CPU Stepping: | D1
|
| CPU Code Name: | Ice Lake-U
|
| CPU Technology: | 10 nm
|
| CPU S-Spec: | SRG0R, SRGKG, SRGKL
|
| CPU Thermal Design Power (TDP): | 15.0 W
|
| CPU Power Limit 4 (PL4): | 129.0 W
|
| CPU Power Limits (Max): | Power = Unlimited, Time = Unlimited
|
| CPU Power Limit 1 - Long Duration: | (15.00 W) (28.00 sec) [Unlocked]
|
| CPU Power Limit 2 - Short Duration: | (36.00 W) (2.44 ms) [Unlocked]
|
| Configurable TDP Level 1 (Down): | 13.00 W (Unlimited range), 700 MHz
|
| Configurable TDP Level 2 (Up): | 25.00 W (Unlimited range), 1200 MHz
|
| Current Configurable TDP Level: | Nominal [Unlocked]
|
| CPU Max. Junction Temperature (Tj,max): | 100 °C
|
| CPU Type: | Production Unit
|
| CPU Platform: | BGA1526
|
| Microcode Update Revision: | 32
|
| Favored Cores List: | 1
|
| | |
|
| Number of CPU Cores: | 4
|
| Number of Logical CPUs: | 8
|
| | |
|
| [Operating Points]
|
| CPU LFM (Minimum): | 400.0 MHz = 4 x 100.0 MHz
|
| CPU HFM (Base): | 1200.0 MHz = 12 x 100.0 MHz
|
| CPU Turbo Max: | 3600.0 MHz = 36 x 100.0 MHz [Unlocked]
|
| Turbo Ratio Limits - IA/SSE: | 36x (1-2c), 33x (3-4c)
|
| Turbo Ratio Limits - AVX2, Resolved: | 36x (1-2c), 33x (3-4c)
|
| CPU Current: | 3291.9 MHz = 33 x 99.8 MHz @ 1.0275 V
|
| LLC/Ring Maximum: | 3400.0 MHz = 34.00 x 100.0 MHz
|
| LLC/Ring Current: | 3092.4 MHz = 31.00 x 99.8 MHz @ 1.0160 V
|
| | |
|
| CPU Bus Type: | OPI
|
| PCI-Express Current Clock: | 99.8 MHz = 1.00 x 99.8 MHz
|
| | |
|
| [IA Overclocking]
|
| Voltage Offset: | Supported
|
| Voltage Override: | Supported
|
| Ratio Overclocking: | Not Supported
|
| Fused Ratio Limit: | 36x
|
| OC Ratio Limit: | N/A
|
| Voltage Mode: | Interpolative
|
| Voltage Offset: | 0 mV
|
| IccMax: | 70.00 A
|
| [GT (Slice) Overclocking]
|
| Voltage Offset: | Supported
|
| Voltage Override: | Supported
|
| Ratio Overclocking: | Not Supported
|
| Fused Ratio Limit: | 21x
|
| OC Ratio Limit: | N/A
|
| Voltage Mode: | Interpolative
|
| Voltage Offset: | 0 mV
|
| IccMax: | 70.00 A
|
| [CLR (CBo/LLC/Ring) Overclocking]
|
| Voltage Offset: | Supported
|
| Voltage Override: | Supported
|
| Ratio Overclocking: | Not Supported
|
| Fused Ratio Limit: | 34x
|
| OC Ratio Limit: | N/A
|
| Voltage Mode: | Interpolative
|
| Voltage Offset: | 0 mV
|
| IccMax: | 70.00 A
|
| [Uncore/SA Overclocking]
|
| Voltage Offset: | Supported
|
| Voltage Override: | Supported
|
| Ratio Overclocking: | Not Supported
|
| Fused Ratio Limit: | N/A
|
| OC Ratio Limit: | N/A
|
| Voltage Mode: | Interpolative
|
| Voltage Offset: | 0 mV
|
| IccMax: | 70.00 A
|
| | |
|
| [Cache and TLB]
|
| L1 Cache: | Instruction: 4 x 32 KBytes, Data: 4 x 48 KBytes
|
| L2 Cache: | Integrated: 4 x 512 KBytes
|
| L3 Cache: | 6 MBytes
|
| Instruction TLB: | Unknown
|
| Data TLB: | Unknown
|
| | |
|
| [Standard Feature Flags]
|
| FPU on Chip | Present
|
| Enhanced Virtual-86 Mode | Present
|
| I/O Breakpoints | Present
|
| Page Size Extensions | Present
|
| Time Stamp Counter | Present
|
| Pentium-style Model Specific Registers | Present
|
| Physical Address Extension | Present
|
| Machine Check Exception | Present
|
| CMPXCHG8B Instruction | Present
|
| APIC On Chip / PGE (AMD) | Present
|
| Fast System Call | Present
|
| Memory Type Range Registers | Present
|
| Page Global Feature | Present
|
| Machine Check Architecture | Present
|
| CMOV Instruction | Present
|
| Page Attribute Table | Present
|
| 36-bit Page Size Extensions | Present
|
| Processor Number | Not Present
|
| CLFLUSH Instruction | Present
|
| Debug Trace and EMON Store | Present
|
| Internal ACPI Support | Present
|
| MMX Technology | Present
|
| Fast FP Save/Restore (IA MMX-2) | Present
|
| Streaming SIMD Extensions | Present
|
| Streaming SIMD Extensions 2 | Present
|
| Self-Snoop | Present
|
| Multi-Threading Capable | Present
|
| Automatic Clock Control | Present
|
| IA-64 Processor | Not Present
|
| Signal Break on FERR | Present
|
| Virtual Machine Extensions (VMX) | Present
|
| Safer Mode Extensions (Intel TXT) | Not Present
|
| Streaming SIMD Extensions 3 | Present
|
| Supplemental Streaming SIMD Extensions 3 | Present
|
| Streaming SIMD Extensions 4.1 | Present
|
| Streaming SIMD Extensions 4.2 | Present
|
| AVX Support | Present
|
| Fused Multiply Add (FMA) | Present
|
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Present
|
| CMPXCHG16B Support | Present
|
| MOVBE Instruction | Present
|
| POPCNT Instruction | Present
|
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present
|
| XGETBV/XSETBV OS Enabled | Present
|
| Float16 Instructions | Present
|
| AES Cryptography Support | Present
|
| Random Number Read Instruction (RDRAND) | Present
|
| Extended xAPIC | Present
|
| MONITOR/MWAIT Support | Present
|
| Thermal Monitor 2 | Present
|
| Enhanced SpeedStep Technology | Present
|
| L1 Context ID | Not Present
|
| Send Task Priority Messages Disabling | Present
|
| Processor Context ID | Present
|
| Direct Cache Access | Not Present
|
| TSC-deadline Timer | Present
|
| Performance/Debug Capability MSR | Present
|
| IA32 Debug Interface Support | Present
|
| 64-Bit Debug Store | Present
|
| CPL Qualified Debug Store | Present
|
| [Extended Feature Flags]
|
| 64-bit Extensions | Present
|
| RDTSCP and TSC_AUX Support | Present
|
| 1 GB large page support | Present
|
| No Execute | Present
|
| SYSCALL/SYSRET Support | Not Present
|
| Bit Manipulation Instructions Set 1 | Present
|
| Bit Manipulation Instructions Set 2 | Present
|
| Advanced Vector Extensions 2 (AVX2) | Present
|
| Advanced Vector Extensions 512 (AVX-512) | Present
|
| AVX-512 Prefetch Instructions | Not Present
|
| AVX-512 Exponential and Reciprocal Instructions | Not Present
|
| AVX-512 Conflict Detection Instructions | Present
|
| AVX-512 Doubleword and Quadword Instructions | Present
|
| AVX-512 Byte and Word Instructions | Present
|
| AVX-512 Vector Length Extensions | Present
|
| AVX-512 52-bit Integer FMA Instructions | Present
|
| Secure Hash Algorithm (SHA) Extensions | Present
|
| Software Guard Extensions (SGX) Support | Present
|
| Supervisor Mode Execution Protection (SMEP) | Present
|
| Supervisor Mode Access Prevention (SMAP) | Present
|
| Hardware Lock Elision (HLE) | Not Present
|
| Restricted Transactional Memory (RTM) | Not Present
|
| Memory Protection Extensions (MPX) | Not Present
|
| Read/Write FS/GS Base Instructions | Present
|
| Enhanced Performance String Instruction | Present
|
| INVPCID Instruction | Present
|
| RDSEED Instruction | Present
|
| Multi-precision Add Carry Instructions (ADX) | Present
|
| PCOMMIT Instructions | Not Present
|
| CLFLUSHOPT Instructions | Present
|
| CLWB Instructions | Not Present
|
| TSC_THREAD_OFFSET | Present
|
| Platform Quality of Service Monitoring (PQM) | Not Present
|
| Platform Quality of Service Enforcement (PQE) | Not Present
|
| FPU Data Pointer updated only on x87 Exceptions | Present
|
| Deprecated FPU CS and FPU DS | Present
|
| Intel Processor Trace | Present
|
| PREFETCHWT1 Instruction | Not Present
|
| AVX-512 Vector Bit Manipulation Instructions | Present
|
| AVX-512 Vector Bit Manipulation Instructions 2 | Present
|
| AVX-512 Galois Fields New Instructions | Present
|
| AVX-512 Vector AES | Present
|
| AVX-512 Vector Neural Network Instructions | Present
|
| AVX-512 Bit Algorithms | Present
|
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Present
|
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Present
|
| User-Mode Instruction Prevention | Present
|
| Protection Keys for User-mode Pages | Present
|
| OS Enabled Protection Keys | Not Present
|
| Wait and Pause Enhancements (WAITPKG) | Not Present
|
| Total Memory Encryption | Not Present
|
| Read Processor ID | Present
|
| Cache Line Demote | Not Present
|
| MOVDIRI: Direct Stores | Not Present
|
| MOVDIR64B: Direct Stores | Not Present
|
| ENQCMD: Enqueue Stores | Not Present
|
| SGX Launch Configuration | Present
|
| Control-Flow Enforcement Technology (CET) Shadow Stack | Not Present
|
| AVX-512 BFLOAT16 Instructions | Not Present
|
| | |
|
| [Vulnerability Mitigation Mechanisms]
|
| Rogue Data Cache Load (RDCL) | Not Susceptible
|
| Speculative Store Bypass (SSB) | Susceptible
|
| Microarchitectural Data Sampling (MDS) | Not Susceptible
|
| Indirect Branch Restriction Speculation (IBRS) | Supported
|
| RSB Alternate | Not Supported
|
| L1D Flush on VM Entry Not Needed | Supported
|
| | |
|
| [Enhanced Features]
|
| Thermal Monitor 1: | Supported, Enabled
|
| Thermal Monitor 2: | Supported, Enabled
|
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled
|
| Bi-directional PROCHOT#: | Enabled
|
| Extended Auto-HALT State C1E: | Enabled
|
| MLC Streamer Prefetcher | Supported, Enabled
|
| MLC Spatial Prefetcher | Supported, Enabled
|
| DCU Streamer Prefetcher | Supported, Enabled
|
| DCU IP Prefetcher | Supported, Enabled
|
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported
|
| Intel Dynamic FSB Switching: | Not Supported
|
| Intel Turbo Boost Technology: | Supported, Enabled
|
| Programmable Ratio Limits: | Supported, Disabled
|
| Programmable TDC/TDP Limits: | Supported, Disabled
|
| Hardware Duty Cycling: | Supported, Enabled
|
| | |
|
| [CPU SKU Features]
|
| NVME: | Not Supported
|
| DMI x4: | Supported
|
| DRAM ECC: | Not Supported
|
| VT-d: | Supported
|
| DMI in Gen2 Mode: | Supported
|
| PEG in Gen2 Mode: | Supported
|
| 1N Mode DDR Timings: | Supported
|
| Camarillo Device: | Supported
|
| 2 DIMMs per Channel: | Not Supported
|
| X2APIC: | Supported
|
| Dual Memory Channel: | Supported
|
| Integrated GPU: | Enabled
|
| DDR Overclocking: | Disabled
|
| Maximum Memory Size per Channel: | 64 GB (unlimited)
|
| IMGU Device: | Not Supported
|
| Northpeak Device: | Supported
|
| Overclocking: | Disabled
|
| SMT: | Supported
|
| Additive Graphics: | Supported
|
| Additive Graphics: | Enabled
|
| PCIe Gen 3: | Supported
|
| DMI Gen 3: | Supported
|
| HDCP: | Supported
|
| L Technology: | 1LM
|
| VMD: | Not Supported
|
| PCIe Gen 4: | Supported
|
| BCLK OC Limit: | 100 MHz
|
| DDR4: | Supported
|
| LPDDR4: | Supported
|
| Maximum Supported DDR4 Frequency: | 1600 MHz
|
| Maximum Supported LPDDR4 Frequency: | 1867 MHz
|
| Secure Enclave (SGX): | Supported
|
| | |
|
| SVID Status: | Enabled
|
| | |
|
| [Voltage Regulator (SVID)]
|
| VCC VR: | Richtek (0x0), Unknown (0x0)
|
| VR Thermal Sensor: | Not Supported
|
| | |
|
| [Memory Ranges]
|
| Maximum Physical Address Size: | 39-bit (512 GBytes)
|
| Maximum Virtual Address Size: | 48-bit (256 TBytes)
|
| [MTRRs]
|
| Range 80000000-100000000 (2048MB-4096MB) Type: | Uncacheable (UC)
|
| Range 78000000-80000000 (1920MB-2048MB) Type: | Uncacheable (UC)
|
| Range 2000000000-4000000000 (131072MB-262144MB) Type: | Uncacheable (UC)
|
| Range 1000000000-2000000000 (65536MB-131072MB) Type: | Uncacheable (UC)
|
| Range 800000000-1000000000 (32768MB-65536MB) Type: | Uncacheable (UC)
|
| Range 400000000-800000000 (16384MB-32768MB) Type: | Uncacheable (UC)
|
| Range 4000000000-8000000000 (262144MB-524288MB) Type: | Uncacheable (UC)
|
| |
|
| [Computer]
|
| Computer Brand Name: | Acer Swift SF313-52G
|
| | |
|
| [Motherboard]
|
| Motherboard Model: | IL Skol_IL
|
| Motherboard Chipset: | Intel 495 (Ice Lake-U PCH-LP Premium)
|
| Motherboard Slots: | 1xPCI Express x4
|
| PCI Express Version Supported: | v1.1
|
| USB Version Supported: | v3.1
|
| | |
|
| [BIOS]
|
| BIOS Manufacturer: | Insyde Corp.
|
| BIOS Date: | 02/12/2020
|
| BIOS Version: | V1.03
|
| UEFI BIOS: | Capable
|
| | |
|
| Super-IO/LPC Chip: | Unknown
|
| Intel(R) Software Guard Extensions Device | |
| |
|
| Device Name: | Intel(R) Software Guard Extensions Device
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | 700C0000 - 75D7FFFF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | 700C0000 - 75D7FFFF
|
| Intel(R) Serial IO GPIO Host Controller - INT3455 | |
| |
|
| Device Name: | Intel(R) Serial IO GPIO Host Controller - INT3455
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | FD6E0000 - FD6EFFFF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | FD6E0000 - FD6EFFFF
|
| Memory Location: | FD6D0000 - FD6DFFFF
|
| Memory Location: | FD6A0000
|
| Memory Location: | FD690000
|
| IRQ: | 14
|
| |
|
| Device Name: | Motherboard resources
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 1854 - 1857
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 1854 - 1857
|
| Trusted Platform Module 2.0 | |
| |
|
| Device Name: | Trusted Platform Module 2.0
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | FED40000 - FED44FFF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | FED40000 - FED44FFF
|
| |
|
| Device Name: | Standard PS/2 Keyboard
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 0060
|
| I/O Port: | 0000
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 0060
|
| I/O Port: | 0064
|
| IRQ: | 1
|
| Programmable interrupt controller | |
| |
|
| Device Name: | Programmable interrupt controller
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 0020 - 0021
|
| I/O Port: | 0030 - 0031
|
| I/O Port: | 00A0 - 00A1
|
| I/O Port: | 00B0 - 00B1
|
| IRQ: | 1114369
|
| IRQ: | 1114369
|
| IRQ: | 1114369
|
| IRQ: | 1114369
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 0020 - 0021
|
| I/O Port: | 0024 - 0025
|
| I/O Port: | 0028 - 0029
|
| I/O Port: | 002C - 002D
|
| I/O Port: | 0030 - 0031
|
| I/O Port: | 0034 - 0035
|
| I/O Port: | 0038 - 0039
|
| I/O Port: | 003C - 003D
|
| I/O Port: | 00A0 - 00A1
|
| I/O Port: | 00A4 - 00A5
|
| I/O Port: | 00A8 - 00A9
|
| I/O Port: | 00AC - 00AD
|
| I/O Port: | 00B0 - 00B1
|
| I/O Port: | 00B4 - 00B5
|
| I/O Port: | 00B8 - 00B9
|
| I/O Port: | 00BC - 00BD
|
| I/O Port: | 04D0 - 04D1
|
| |
|
| Device Name: | System timer
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 0040 - 0043
|
| DMA: | 0
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 0040 - 0043
|
| I/O Port: | 0050 - 0053
|
| IRQ: | 0
|
| High precision event timer | |
| |
|
| Device Name: | High precision event timer
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | FED00000 - FED003FF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | FED00000 - FED003FF
|
| |
|
| Device Name: | PCI Express Root Complex
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 0000 - FFFFFFFF
|
| Memory Location: | 000A0000 - 000BFFFF
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 0000 - 0CF7
|
| I/O Port: | 0D00 - FFFF
|
| Memory Location: | 000A0000 - 000BFFFF
|
| Memory Location: | 7D800000 - BFFFFFFF
|
| |
|
| Device Name: | Motherboard resources
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | FED10000 - FED17FFF
|
| Memory Location: | FED20000 - FED7FFFF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | FED10000 - FED17FFF
|
| Memory Location: | FEDA0000 - FEDA0FFF
|
| Memory Location: | FEDA1000 - FEDA1FFF
|
| Memory Location: | C0000000 - CFFFFFFF
|
| Memory Location: | FED20000 - FED7FFFF
|
| Memory Location: | FED90000 - FED93FFF
|
| Memory Location: | FEE00000 - FEEFFFFF
|
| |
|
| Device Name: | Motherboard resources
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 002E - 002F
|
| I/O Port: | 0065
|
| I/O Port: | 0000 - 006F
|
| I/O Port: | 0092
|
| IRQ: | 1114369
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 002E - 002F
|
| I/O Port: | 004E - 004F
|
| I/O Port: | 0061
|
| I/O Port: | 0063
|
| I/O Port: | 0065
|
| I/O Port: | 0067
|
| I/O Port: | 0070
|
| I/O Port: | 0080
|
| I/O Port: | 0092
|
| I/O Port: | 00B2 - 00B3
|
| I/O Port: | 0680 - 069F
|
| I/O Port: | 164E - 164F
|
| |
|
| Device Name: | Motherboard resources
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | FE038000 - FE038FFF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | FE038000 - FE038FFF
|
| |
|
| Device Name: | Motherboard resources
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 2000 - 20FE
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 2000 - 20FE
|
| |
|
| Device Name: | Motherboard resources
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | FD000000 - FD68FFFF
|
| Memory Location: | FE200000 - FE7FFFFF
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 1800 - 18FE
|
| Memory Location: | FD000000 - FD68FFFF
|
| Memory Location: | FD6B0000 - FD6CFFFF
|
| Memory Location: | FD6F0000
|
| Memory Location: | FE000000
|
| Memory Location: | FE200000
|
| Memory Location: | FF000000
|
| Microsoft ACPI-Compliant Embedded Controller | |
| |
|
| Device Name: | Microsoft ACPI-Compliant Embedded Controller
|
| | |
|
| [Assigned Resources]
|
| I/O Port: | 0062
|
| | |
|
| [Alternative 1]
|
| I/O Port: | 0062
|
| I/O Port: | 0066
|
| |
|
| Device Name: | I2C HID Device
|
| | |
|
| [Assigned Resources]
|
| | |
|
| [Alternative 1]
|
| IRQ: | 1024
|
| |
|
| Device Name: | UCM-UCSI ACPI Device
|
| | |
|
| [Assigned Resources]
|
| Memory Location: | 6BB73000 - 6BB73FFF
|
| | |
|
| [Alternative 1]
|
| Memory Location: | 6BB73000 - 6BB73FFF
|
| |
|
| BIOS Vendor: | Insyde Corp.
|
| BIOS Version: | V1.03
|
| BIOS Release Date: | 02/12/2020
|
| BIOS Start Segment: | E000
|
| BIOS Size: | 0 MBytes
|
| | |
|
| System BIOS Version: | 1.3
|
| Embedded Controller Firmware Version: | 1.3
|
| | |
|
| ISA Support: | Not Present
|
| MCA Support: | Not Present
|
| EISA Support: | Not Present
|
| PCI Support: | Present
|
| PC Card (PCMCIA) Support: | Not Present
|
| Plug-and-Play Support: | Not Present
|
| APM Support: | Not Present
|
| Flash BIOS: | Present
|
| BIOS Shadow: | Present
|
| VL-VESA Support: | Not Present
|
| ESCD Support: | Not Present
|
| Boot from CD: | Present
|
| Selectable Boot: | Present
|
| BIOS ROM Socketed: | Not Present
|
| Boot from PC Card: | Not Present
|
| EDD Support: | Present
|
| NEC PC-98 Support: | Not Present
|
| ACPI Support: | Present
|
| USB Legacy Support: | Present
|
| AGP Support: | Not Present
|
| I2O Boot Support: | Not Present
|
| LS-120 Boot Support: | Not Present
|
| ATAPI ZIP Drive Boot Support: | Not Present
|
| IEE1394 Boot Support: | Not Present
|
| Smart Battery Support: | Present
|
| BIOS Boot Specification Support: | Present
|
| Function key-initiated Network Service Boot Support: | Not Present
|
| Targeted Content Distribution Support: | Present
|
| UEFI Specification Support: | Present
|
| Virtual Machine: | Not Present
|
| |
|
| System Manufacturer: | Acer
|
| Product Name: | Swift SF313-52G
|
| Product Version: | V1.03
|
| Product Serial Number: | NXHR0EC001007039BF2N00
|
| UUID: | {C991695F-1A62-4C01-A724-78A2BC58C13B}
|
| SKU Number: | 0000000000000000
|
| Family: | Swift 3
|
| |
|
| Mainboard Manufacturer: | IL
|
| Mainboard Name: | Skol_IL
|
| Mainboard Version: | V1.03
|
| Mainboard Serial Number: | NBHR011006006001232NIL
|
| Asset Tag: | Type2 - Board Asset Tag
|
| Location in chassis: | Type2 - Board Chassis Location
|
| |
|
| Manufacturer: | Acer
|
| Case Type: | Notebook
|
| Version: | Chassis Version
|
| Serial Number: | Chassis Serial Number
|
| Asset Tag Number: |
|
| |
|
| Processor Manufacturer: | Intel(R) Corporation
|
| Processor Version: | Intel(R) Core(TM) i5-1035G1 CPU @ 1.00GHz
|
| External Clock: | 100 MHz
|
| Maximum Clock Supported: | 8300 MHz
|
| Current Clock: | 1000 MHz
|
| CPU Socket: | Populated
|
| CPU Status: | Enabled
|
| Processor Type: | Central Processor
|
| Processor Voltage: | 0.7 V
|
| Processor Upgrade: | Unknown (1)
|
| Socket Designation: | U3E1
|
| |
|
| Socket Designation: | L1 Cache
|
| Cache State: | Enabled
|
| Cache Location: | Internal
|
| Cache Type: | L1 Data
|
| Cache Scheme: | Write-Back
|
| Supported SRAM Type: | Synchronous
|
| Current SRAM Type: | Synchronous
|
| Cache Speed: | Unknown
|
| Error Correction Type: | Parity
|
| Maximum Cache Size: | 192 KBytes
|
| Installed Cache Size: | 192 KBytes
|
| Cache Associativity: | 12-way Set-Associative
|
| |
|
| Socket Designation: | L1 Cache
|
| Cache State: | Enabled
|
| Cache Location: | Internal
|
| Cache Type: | L1 Instruction
|
| Cache Scheme: | Write-Back
|
| Supported SRAM Type: | Synchronous
|
| Current SRAM Type: | Synchronous
|
| Cache Speed: | Unknown
|
| Error Correction Type: | Parity
|
| Maximum Cache Size: | 128 KBytes
|
| Installed Cache Size: | 128 KBytes
|
| Cache Associativity: | 8-way Set-Associative
|
| |
|
| Socket Designation: | L2 Cache
|
| Cache State: | Enabled
|
| Cache Location: | Internal
|
| Cache Type: | L2 Unified
|
| Cache Scheme: | Write-Back
|
| Supported SRAM Type: | Synchronous
|
| Current SRAM Type: | Synchronous
|
| Cache Speed: | Unknown
|
| Error Correction Type: | Single-bit ECC
|
| Maximum Cache Size: | 2048 KBytes
|
| Installed Cache Size: | 2048 KBytes
|
| Cache Associativity: | 8-way Set-Associative
|
| |
|
| Socket Designation: | L3 Cache
|
| Cache State: | Enabled
|
| Cache Location: | Internal
|
| Cache Type: | L3 Unified
|
| Cache Scheme: | Write-Back
|
| Supported SRAM Type: | Synchronous
|
| Current SRAM Type: | Synchronous
|
| Cache Speed: | Unknown
|
| Error Correction Type: | Multi-bit ECC
|
| Maximum Cache Size: | 6144 KBytes
|
| Installed Cache Size: | 6144 KBytes
|
| Cache Associativity: | 12-way Set-Associative
|
| |
|
| Device Description: | Video Graphics Controller
|
| Device Type: | Video Adapter
|
| Device Status: | Enabled
|
| | |
|
| |
|
| | Acer System
|
| | OemString2
|
| | OemString3
|
| | OemString4
|
| | OemString5
|
| | OemString6
|
| System Configuration Options | |
| |
|
| | ConfigOptions1
|
| | ConfigOptions2
|
| | ConfigOptions3
|
| | ConfigOptions4
|
| | ConfigOptions5
|
| | ConfigOptions6
|
| |
|
| CPU VT-x Support: | Supported
|
| CPU VT-x Status: | Enabled
|
| CPU VT-x2 Support: | Not Supported
|
| CPU VT-x2 Status: | Disabled
|
| CPU TXT Support: | Not Supported
|
| CPU TXT Status: | Disabled
|
| CPU VMX Status: | Enabled
|
| CPU SMX Status: | Disabled
|
| Intel ME Status: | Enabled
|
| Intel OST Firmware Support: | Not Supported
|
| Intel ASF Firmware Support: | Not Supported
|
| Intel AMT Pro Firmware Support: | Not Supported
|
| Intel AMT Basic Firmware Support: | Not Supported
|
| Intel TPM Firmware Support: | Not Supported
|
| Intel Castle Peak Support: | Not Supported
|
| Intel WoX Support: | Not Supported
|
| Intel Virtualization Engine Support: | Not Supported
|
| Intel Anti-Theft Technology Support: | Not Supported
|
| TPM On-board: | Not Supported
|
| Intel Anti-Theft Technology Enrolled: | Not Supported
|
| Intel ME Version: | v13.0, Build 1086, Hotfix 0
|
| BIOS VT-x Support: | Not Supported
|
| BIOS VT-d Support: | Supported
|
| BIOS TXT Support: | Supported
|
| BIOS TPM Support: | Not Supported
|
| BIOS ME Support: | Not Supported
|
| BIOS VA Extensions Support: | Supported
|
| Intel AT PBA For Recovery Support: | Not Supported
|
| Intel AT WWAN Support: | Not Supported
|
| |
|
| Array Location: | System board
|
| Array Use: | System memory
|
| Error Detecting Method: | None
|
| Memory Capacity: | 8 GBytes
|
| Memory Devices: | 2
|
| |
|
| Total Width: | 32 bits
|
| Data Width: | 32 bits
|
| Device Size: | 4096 MBytes
|
| Device Form Factor: | Row of chips
|
| Device Locator: | ChannelA-DIMM0
|
| Bank Locator: | BANK 0
|
| Device Type: | LPDDR4
|
| Device Type Detail: | Synchronous
|
| Memory Speed: | 4267 MHz
|
| Manufacturer: | Micron
|
| Serial Number: | 00000000
|
| Part Number: |
|
| Asset Tag: | 9876543210
|
| |
|
| Total Width: | 32 bits
|
| Data Width: | 32 bits
|
| Device Size: | 4096 MBytes
|
| Device Form Factor: | Row of chips
|
| Device Locator: | ChannelB-DIMM0
|
| Bank Locator: | BANK 2
|
| Device Type: | LPDDR4
|
| Device Type Detail: | Synchronous
|
| Memory Speed: | 4267 MHz
|
| Manufacturer: | Micron
|
| Serial Number: | 00000000
|
| Part Number: |
|
| Asset Tag: | 9876543210
|
| Memory Array Mapped Address | |
| |
|
| Starting Address: | 00000000
|
| Ending Address: | 007FFFFF
|
| Partition Width: | 2
|
| Memory Device Mapped Address | |
| |
|
| Starting Address: | 00000000
|
| Ending Address: | 003FFFFF
|
| Partition Row Position: | Unknown
|
| Interleave Position: | 1
|
| Interleave Data Depth: | 1
|
| Memory Device Mapped Address | |
| |
|
| Starting Address: | 00000000
|
| Ending Address: | 003FFFFF
|
| Partition Row Position: | Unknown
|
| Interleave Position: | 2
|
| Interleave Data Depth: | 1
|
| |
|
| [ME Host Status]
|
| ME Current Working State: | Normal
|
| Manufacturing Mode: | Not Active
|
| ME Current Operation Mode: | Normal
|
| | |
|
| Boot Guard Status: | Enabled
|
| Boot Guard Verified Boot Policy: | Enabled
|
| Boot Guard Measured Boot Policy: | Enabled
|
| | |
|
| [Intel Manageability Engine Features]
|
| Intel ME Version: | 13.0, Build 1086
|
| Intel ME Recovery Image Version: | 13.0, Build 1086
|
| Intel ME FITC Version: | 13.0, Build 1087
|
| | |
|
| [ME Firmware Capabilities]
|
| Full Network Manageability: | Not Capable
|
| Standard Network Manageability: | Not Capable
|
| Manageability (AMT): | Not Capable
|
| Small Business Advantage: | Not Capable
|
| Intel Integrated Touch: | Not Capable
|
| Intel Anti-Theft: | Not Capable
|
| Capability Licensing Service: | Capable
|
| Virtualization Engine: | Not Capable
|
| Intel Sensor Hub (ISH): | Not Capable
|
| ICC Over Clocking: | Not Capable
|
| Protected Audio Video Path (PAVP): | Capable
|
| Network Frame Forwarder (NFF): | Not Capable
|
| Remote PC Assist (RPAT): | Capable
|
| IPV6: | Not Capable
|
| KVM Remote Control: | Not Capable
|
| Outbreak Containment Heuristic (OCH): | Not Capable
|
| Dynamic Application Loader (DAL): | Capable
|
| Cipher Transport Layer (TLS): | Capable
|
| Wireless LAN (WLAN): | Not Capable
|
| Platform Trust Technology (PTT): | Capable
|
| Near Field Communication (NFC): | Not Capable
|
| | |
|
| [ME Firmware Feature State]
|
| Full Network Manageability: | Disabled
|
| Standard Network Manageability: | Disabled
|
| Manageability (AMT): | Disabled
|
| Small Business Advantage: | Not Capable
|
| MEI3: | Not Capable
|
| Intel Anti-Theft: | Disabled
|
| Capability Licensing Service: | Enabled
|
| Virtualization Engine: | Disabled
|
| Intel Sensor Hub (ISH): | Disabled
|
| ICC Over Clocking: | Disabled
|
| Protected Audio Video Path (PAVP): | Enabled
|
| Network Frame Forwarder (NFF): | Not Capable
|
| Remote PC Assist (RPAT): | Enabled
|
| IPV6: | Disabled
|
| KVM Remote Control: | Disabled
|
| Outbreak Containment Heuristic (OCH): | Disabled
|
| Dynamic Application Loader (DAL): | Capable
|
| Cipher Transport Layer (TLS): | Enabled
|
| Wireless LAN (WLAN): | Disabled
|
| Platform Trust Technology (PTT): | Enabled
|
| Near Field Communication (NFC): | Disabled
|
| | |
|
| [ME Firmware Platform Type]
|
| Platform Target Usage Type: | Mobile
|
| SKU: | Regular SKU
|
| ME Firmware Image Type: | Consumer SKU Firmware
|
| Platform Brand: | None
|
| | |
|
| Host ME Region Flash Protection Override (HMRFPO) Status: | Locked
|
| |
|
| [General information]
|
| Total Memory Size: | 8 GBytes
|
| Total Memory Size [MB]: | 8192
|
| | |
|
| [Current Performance Settings]
|
| Maximum Supported Memory Clock: | 1866.7 MHz
|
| Current Memory Clock: | 1064.1 MHz
|
| Current Timing (tCAS-tRCD-tRP-tRAS): | 20-20-20-45
|
| Memory Channels Supported: | 2
|
| Memory Channels Active: | 2
|
| | |
|
| Command Rate: | 1T
|
| Read to Read Delay (tRD_RD) Same Rank: | 8T
|
| Read to Read Delay (tRD_RD) Different Rank: | 8T
|
| Read to Read Delay (tRD_RD) Different DIMM: | 18T
|
| Write to Write Delay (tWR_WR) Same Rank: | 8T
|
| Write to Write Delay (tWR_WR) Different Rank: | 8T
|
| Write to Write Delay (tWR_WR) Different DIMM: | 20T
|
| Read to Write Delay (tRD_WR) Same Rank: | 22T
|
| Read to Write Delay (tRD_WR) Different Rank: | 22T
|
| Read to Write Delay (tRD_WR) Different DIMM: | 22T
|
| Write to Read Delay (tWR_RD) Same Rank (tWTR): | 40T
|
| Write to Read Delay (tWR_RD) Different Rank: | 40T
|
| Write to Read Delay (tWR_RD) Different DIMM: | 12T
|
| RAS# to RAS# Delay (tRRD): | 11T
|
| Refresh Cycle Time (tRFC): | 299T
|
| Four Activate Window (tFAW): | 43T
|
| Intel Ice Lake-U - Host Bridge/DRAM Controller [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U - Host Bridge/DRAM Controller [D0]
|
| Original Device Name: | Intel Ice Lake-U - Host Bridge/DRAM Controller [D0]
|
| Device Class: | Host-to-PCI Bridge
|
| Revision ID: | 3 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:0:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A12&SUBSYS_141B1025&REV_03
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | N/A
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní systémová zařízení)
|
| Driver Description: | Most hostitelského procesoru ve standardu PCI
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.267
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A12&SUBSYS_141B1025&REV_03\3&11583659&0&00
|
| Location Paths | PCIROOT(0)#PCI(0000)
|
| Intel Ice Lake-U GT2 32EU LM - Integrated Graphics | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U GT2 32EU LM - Integrated Graphics
|
| Original Device Name: | Intel Ice Lake-U GT2 32EU LM - Integrated Graphics
|
| Device Class: | VGA Compatible Adapter
|
| Revision ID: | 7
|
| PCI Address (Bus:Device:Function) Number: | 0:2:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A56&SUBSYS_141B1025&REV_07
|
| | |
|
| [PCI Express]
|
| Version: | 1.1
|
| Current Link Width: | Not negotiated
|
| Device/Port Type: | Root Complex Integrated Endpoint
|
| Slot Implemented: | No
|
| Emergency Power Reduction: | Not Supported
|
| Active State Power Management (ASPM) Support: | None
|
| Active State Power Management (ASPM) Status: | Disabled
|
| L0s Exit Latency: | < 64 ns
|
| L1 Exit Latency: | < 1 us
|
| Maximum Payload Size Supported: | 128 bytes
|
| Maximum Payload Size: | 128 bytes
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 601C000000
|
| Memory Base Address 2 | 4000000000
|
| I/O Base Address 4 | 4000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) UHD Graphics
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 26.20.100.7463
|
| Driver Date: | 06-Nov-2019
|
| DCH/UWD Driver: | Not Capable
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A56&SUBSYS_141B1025&REV_07\3&11583659&0&10
|
| Location Paths | PCIROOT(0)#PCI(0200)
|
| Intel Ice Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake - Dynamic Platform & Thermal Framework Processor Participant
|
| Original Device Name: | Intel Ice Lake - Dynamic Platform & Thermal Framework Processor Participant
|
| Device Class: | Other Data Acquisition/Signal Processing Controller
|
| Revision ID: | 3
|
| PCI Address (Bus:Device:Function) Number: | 0:4:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A03&SUBSYS_141B1025&REV_03
|
| | |
|
| [System Resources]
|
| Interrupt Line: | IRQ16
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 601D150000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel
|
| Driver Description: | Intel(R) Dynamic Tuning Processor Participant
|
| Driver Provider: | Intel
|
| Driver Version: | 8.6.10401.9906
|
| Driver Date: | 14-Jun-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A03&SUBSYS_141B1025&REV_03\3&11583659&0&20
|
| Location Paths | PCIROOT(0)#PCI(0400)
|
| Intel Ice Lake - Integrated Thunderbolt PCI Express 0 | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake - Integrated Thunderbolt PCI Express 0
|
| Original Device Name: | Intel Ice Lake - Integrated Thunderbolt PCI Express 0
|
| Device Class: | PCI-to-PCI Bridge
|
| Revision ID: | 3
|
| PCI Address (Bus:Device:Function) Number: | 0:7:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A1D&SUBSYS_00000060&REV_03
|
| | |
|
| [PCI Express]
|
| Version: | 1.1
|
| Maximum Link Width: | 4x
|
| Current Link Width: | Not negotiated
|
| Maximum Link Speed: | 2.5 GT/s
|
| Current Link Speed: | 2.5 GT/s
|
| Device/Port Type: | Root Port of PCI Express Root Complex
|
| Slot Implemented: | Yes
|
| Hot-Plug: | Capable
|
| Hot-Plug Surprise: | Capable
|
| Emergency Power Reduction: | Not Supported
|
| Active State Power Management (ASPM) Support: | L1
|
| Active State Power Management (ASPM) Status: | L1 Entry
|
| L0s Exit Latency: | 512 ns - 1 us
|
| L1 Exit Latency: | 8 - 16 us
|
| Maximum Payload Size Supported: | 128 bytes
|
| Maximum Payload Size: | 128 bytes
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní systémová zařízení)
|
| Driver Description: | Kořenový port sběrnice PCI Express
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.752
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A1D&SUBSYS_141B1025&REV_03\3&11583659&0&38
|
| Location Paths | PCIROOT(0)#PCI(0700)
|
| Intel Ice Lake - Gaussian Mixture Model (GNA) | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake - Gaussian Mixture Model (GNA)
|
| Original Device Name: | Intel Ice Lake - Gaussian Mixture Model (GNA)
|
| Device Class: | Unknown Peripheral Device
|
| Revision ID: | 3
|
| PCI Address (Bus:Device:Function) Number: | 0:8:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A11&SUBSYS_141B1025&REV_03
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 601D172000
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) GNA Scoring Accelerator module
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 1.0.0.1381
|
| Driver Date: | 12-Mar-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A11&SUBSYS_141B1025&REV_03\3&11583659&0&40
|
| Location Paths | PCIROOT(0)#PCI(0800)
|
| Intel Ice Lake - USB 3.0 xHCI Host Controller | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake - USB 3.0 xHCI Host Controller
|
| Original Device Name: | Intel Ice Lake - USB 3.0 xHCI Host Controller
|
| Device Class: | USB xHCI Controller
|
| Revision ID: | 3
|
| PCI Address (Bus:Device:Function) Number: | 0:13:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A13&SUBSYS_141B1025&REV_03
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | N/A
|
| Memory Base Address 0 | 601D140000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Capable
|
| | |
|
| USB Version Supported: | 3.1
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI
|
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 20-Feb-2020
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A13&SUBSYS_141B1025&REV_03\3&11583659&0&68
|
| Location Paths | PCIROOT(0)#PCI(0D00)
|
| [Port1] : No Device Connected | |
| [Port2] : VIA Labs, PID=8820 | |
| |
|
| [Device Information]
|
| Device Manufacturer: | VIA Labs, Inc.
|
| Product Name: | USB3.1 Hub
|
| Serial Number: | N/A
|
| USB Version Supported: | 3.10
|
| USB Device Speed: | USB 3.1 SuperSpeedPlus
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Hardware ID: | USB\VID_2109&PID_0820
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_2109&PID_0820\5&10E3226A&0&2
|
| Location Paths | PCIROOT(0)#PCI(0D00)#USBROOT(0)#USB(2)
|
| [Port1] : No Device Connected | |
| [Port2] : Realtek Semiconductor Realtek USB GBE Family Controller | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Realtek
|
| Product Name: | USB 10/100/1000 LAN
|
| Serial Number: | 001000001
|
| USB Version Supported: | 3.00
|
| USB Device Speed: | USB 3.0 SuperSpeed
|
| Driver Description: | Realtek USB GbE Family Controller
|
| Hardware ID: | USB\VID_0BDA&PID_8153
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Realtek
|
| Driver Description: | Realtek USB GbE Family Controller
|
| Driver Provider: | Realtek
|
| Driver Version: | 10.38.117.2020
|
| Driver Date: | 25-Sep-2015
|
| DeviceInstanceId | USB\VID_0BDA&PID_8153\001000001
|
| Location Paths | PCIROOT(0)#PCI(0D00)#USBROOT(0)#USB(2)#USB(2)
|
| [Port3] : Standard Microsystems Super-Speed 5-Port USB 3.1 Hub | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Standard Microsystems
|
| Product Name: | Standard Microsystems Super-Speed 5-Port USB 3.1 Hub
|
| Serial Number: | -
|
| USB Version Supported: | 3.10
|
| USB Device Speed: | USB 3.0 SuperSpeed
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Hardware ID: | USB\VID_0424&PID_5734
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_0424&PID_5734\6&33522036&0&3
|
| Location Paths | PCIROOT(0)#PCI(0D00)#USBROOT(0)#USB(2)#USB(3)
|
| [Port1] : No Device Connected | |
| [Port2] : No Device Connected | |
| [Port3] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port3] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port5] : No Device Connected | |
| Intel Ice Lake - Integrated Thunderbolt DMA 1 | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake - Integrated Thunderbolt DMA 1
|
| Original Device Name: | Intel Ice Lake - Integrated Thunderbolt DMA 1
|
| Device Class: | Unknown Peripheral Device
|
| Revision ID: | 3
|
| PCI Address (Bus:Device:Function) Number: | 0:13:2
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_8A17&SUBSYS_00000000&REV_03
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 601D100000
|
| Memory Base Address 2 | 601D171000
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel(R) Corporation
|
| Driver Description: | Thunderbolt(TM) Controller - 8A17
|
| Driver Provider: | Intel(R) Corporation
|
| Driver Version: | 1.41.729.0
|
| Driver Date: | 30-Jul-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A17&SUBSYS_00000000&REV_03\3&11583659&0&6A
|
| Location Paths | PCIROOT(0)#PCI(0D02)
|
| Intel Ice Lake-U/Y PCH-LP - USB 3.2 Gen 2x1 (10 Gb/s) xHCI Host Controller [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - USB 3.2 Gen 2x1 (10 Gb/s) xHCI Host Controller [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - USB 3.2 Gen 2x1 (10 Gb/s) xHCI Host Controller [D0]
|
| Device Class: | USB xHCI Controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:20:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34ED&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 8A280000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Capable
|
| | |
|
| USB Version Supported: | 3.1
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI
|
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 20-Feb-2020
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34ED&SUBSYS_141B1025&REV_30\3&11583659&0&A0
|
| Location Paths | PCIROOT(0)#PCI(1400)
|
| [Port1] : No Device Connected | |
| [Port2] : No Device Connected | |
| [Port3] : VIA Labs USB 2.0 4-Port Hub | |
| |
|
| [Device Information]
|
| Device Manufacturer: | VIA Labs, Inc.
|
| Product Name: | USB2.0 Hub
|
| Serial Number: | N/A
|
| USB Version Supported: | 3.00 (Connected to a USB 2.00 Port)
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Obecný rozbočovač USB
|
| Hardware ID: | USB\VID_2109&PID_2820
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_2109&PID_2820\5&303B8078&0&3
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)
|
| [Port1] : Bizlink International, PID=073C | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Bizlink International
|
| Product Name: | Bizlink International, PID=073C
|
| Serial Number: | -
|
| USB Version Supported: | 2.00
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Vstupní zařízení USB
|
| Hardware ID: | USB\VID_06C4&PID_C412
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní systémová zařízení)
|
| Driver Description: | Vstupní zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.175
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_06C4&PID_C412\MCU_VER0001
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(1)
|
| [Port2] : No Device Connected | |
| [Port3] : Standard Microsystems Super-Speed 5-Port USB 3.0 Hub | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Microchip Tech
|
| Product Name: | USB2734
|
| Serial Number: | N/A
|
| USB Version Supported: | 3.00 (Connected to a USB 2.00 Port)
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Obecný rozbočovač USB
|
| Hardware ID: | USB\VID_0424&PID_2734
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_0424&PID_2734\6&1EE10A7F&0&3
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)
|
| [Port1] : Texas Instruments Japan PCM2902 Audio Codec | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Burr-Brown from TI
|
| Product Name: | USB Audio CODEC
|
| Serial Number: | N/A
|
| USB Version Supported: | 1.10
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_08BB&PID_2902
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_08BB&PID_2902\7&338F808C&0&1
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(1)
|
| [Port2] : No Device Connected | |
| [Port3] : Areson USB Mouse | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Areson
|
| Product Name: | USB Device
|
| Serial Number: | N/A
|
| USB Version Supported: | 1.10
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_E0FF&PID_0005
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_E0FF&PID_0005\7&338F808C&0&3
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(3)
|
| [Port4] : Složené zařízení USB | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Hoksi Technology
|
| Product Name: | DURGOD Taurus K320
|
| Serial Number: | N/A
|
| USB Version Supported: | 2.00
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_2F68&PID_0082
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_2F68&PID_0082\7&338F808C&0&4
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(4)
|
| [Port5] : Standard Microsystems, PID=EC00 | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Microchip Tech
|
| Product Name: | Hub Controller
|
| Serial Number: | N/A
|
| USB Version Supported: | 2.01
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_0424&PID_274C
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_0424&PID_274C\7&338F808C&0&5
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(5)
|
| [Port4] : No Device Connected | |
| [Port5] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port5] : LighTuning Technology EgisTec Touch Fingerprint Sensor | |
| |
|
| [Device Information]
|
| Device Manufacturer: | LighTuning Technology
|
| Product Name: | LighTuning Technology EgisTec Touch Fingerprint Sensor
|
| Serial Number: | -
|
| USB Version Supported: | 1.10
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | EgisTec Touch Fingerprint Sensor
|
| Hardware ID: | USB\VID_1C7A&PID_0570
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Egis Technology Inc.
|
| Driver Description: | EgisTec Touch Fingerprint Sensor
|
| Driver Provider: | Egis Technology Inc.
|
| Driver Version: | 3.5.3.19
|
| Driver Date: | 25-Mar-2019
|
| DeviceInstanceId | USB\VID_1C7A&PID_0570\5&303B8078&0&5
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(5)
|
| [Port6] : Chicony Electronics, PID=B694 | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Chicony Electronics
|
| Product Name: | Chicony Electronics, PID=B694
|
| Serial Number: | -
|
| USB Version Supported: | 2.00
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_04F2&PID_B5C5
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_04F2&PID_B5C5\200901010001
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(6)
|
| [Port7] : No Device Connected | |
| [Port8] : No Device Connected | |
| [Port9] : No Device Connected | |
| [Port10] : Intel(R) Wireless Bluetooth(R) | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Intel
|
| Product Name: | Intel(R) Wireless Bluetooth(R)
|
| Serial Number: | -
|
| USB Version Supported: | 2.01
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Intel(R) Wireless Bluetooth(R)
|
| Hardware ID: | USB\VID_8087&PID_0026
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Wireless Bluetooth(R)
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 21.60.1.1
|
| Driver Date: | 16-Dec-2019
|
| DeviceInstanceId | USB\VID_8087&PID_0026\5&303B8078&0&10
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10)
|
| [Port11] : No Device Connected | |
| [Port12] : No Device Connected | |
| [Port13] : No Device Connected | |
| [Port14] : No Device Connected | |
| [Port15] : No Device Connected | |
| [Port16] : No Device Connected | |
| [Port17] : No Device Connected | |
| [Port18] : No Device Connected | |
| Intel Ice Lake-U/Y PCH-LP - Shared SRAM [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - Shared SRAM [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - Shared SRAM [D0]
|
| Device Class: | RAM/Memory Controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:20:2
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34EF&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | N/A
|
| Memory Base Address 0 | 601D168000
|
| Memory Base Address 2 | 601D170000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní systémová zařízení)
|
| Driver Description: | Řadič paměti RAM ve standardu PCI
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.267
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34EF&SUBSYS_141B1025&REV_30\3&11583659&0&A2
|
| Location Paths | PCIROOT(0)#PCI(1402)
|
| Intel Wi-Fi 6 AX201 160MHz | |
| |
|
| [General Information]
|
| Device Name: | Intel Wi-Fi 6 AX201 160MHz
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - Wi-Fi [D0]
|
| Device Class: | Other Network Adapter
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:20:3
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34F0&SUBSYS_00748086&REV_30
|
| | |
|
| [PCI Express]
|
| Version: | 1.1
|
| Current Link Width: | Not negotiated
|
| Device/Port Type: | Root Complex Integrated Endpoint
|
| Slot Implemented: | No
|
| Emergency Power Reduction: | Not Supported
|
| Active State Power Management (ASPM) Support: | None
|
| Active State Power Management (ASPM) Status: | Disabled
|
| L0s Exit Latency: | < 64 ns
|
| L1 Exit Latency: | < 1 us
|
| Maximum Payload Size Supported: | 128 bytes
|
| Maximum Payload Size: | 128 bytes
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 601D164000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Wi-Fi 6 AX201 160MHz
|
| Driver Provider: | Intel
|
| Driver Version: | 21.60.2.1
|
| Driver Date: | 15-Dec-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34F0&SUBSYS_00748086&REV_30\3&11583659&0&A3
|
| Location Paths | PCIROOT(0)#PCI(1403)
|
| Intel Ice Lake-U/Y PCH-LP - I2C Controller #0 [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - I2C Controller #0 [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - I2C Controller #0 [D0]
|
| Device Class: | Other Serial Bus Controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:21:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34E8&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | IRQ16
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 0
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Serial IO I2C Host Controller - 34E8
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 30.100.1932.6
|
| Driver Date: | 08-Aug-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34E8&SUBSYS_141B1025&REV_30\3&11583659&0&A8
|
| Location Paths | PCIROOT(0)#PCI(1500)
|
| Intel Ice Lake-U/Y PCH-LP - I2C Controller #1 [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - I2C Controller #1 [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - I2C Controller #1 [D0]
|
| Device Class: | Other Serial Bus Controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:21:1
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34E9&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | IRQ17
|
| Interrupt Pin: | INTB#
|
| Memory Base Address 0 | 0
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Serial IO I2C Host Controller - 34E9
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 30.100.1932.6
|
| Driver Date: | 08-Aug-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34E9&SUBSYS_141B1025&REV_30\3&11583659&0&A9
|
| Location Paths | PCIROOT(0)#PCI(1501)
|
| Intel Ice Lake-U/Y PCH-LP - Intel ME: HECI #1 [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - Intel ME: HECI #1 [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - Intel ME: HECI #1 [D0]
|
| Device Class: | Other Communication Device
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:22:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34E0&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 7FFFEF9000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel
|
| Driver Description: | Intel(R) Management Engine Interface
|
| Driver Provider: | Intel
|
| Driver Version: | 1910.13.0.1060
|
| Driver Date: | 04-Mar-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34E0&SUBSYS_141B1025&REV_30\3&11583659&0&B0
|
| Location Paths | PCIROOT(0)#PCI(1600)
|
| Intel HM170/QM170 PCH - SATA RAID (RST) Controller [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel HM170/QM170 PCH - SATA RAID (RST) Controller [D0]
|
| Original Device Name: | Intel HM170/QM170 PCH - SATA RAID (RST) Controller [D0]
|
| Device Class: | RAID controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:23:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_282A&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 8A290000
|
| Memory Base Address 1 | 8A299000
|
| I/O Base Address 2 | 4080
|
| I/O Base Address 3 | 4088
|
| I/O Base Address 4 | 4060
|
| Memory Base Address 5 | 8A200000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Capable
|
| Fast Back-to-Back Transactions: | Capable
|
| | |
|
| [SATA Host Controller]
|
| Interface Speed Supported: | Gen2 3.0 Gbps
|
| Number Of Ports: | 16
|
| External SATA Support: | Not Capable
|
| Aggressive Link Power Management: | Capable
|
| Staggered Spin-up: | Not Capable
|
| Mechanical Presence Switch: | Not Capable
|
| Command Queue Acceleration: | Capable
|
| 64-bit Addressing: | Capable
|
| AHCI Status: | Enabled
|
| AHCI Version: | 1.31
|
| Ports Implemented: |
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Chipset SATA/PCIe RST Premium Controller
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 17.5.2.1024
|
| Driver Date: | 08-Jul-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_282A&SUBSYS_141B1025&REV_30\3&11583659&0&B8
|
| Location Paths | PCIROOT(0)#PCI(1700)
|
| Intel Ice Lake-U/Y PCH-LP - PCI Express Root Port #5 | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - PCI Express Root Port #5
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - PCI Express Root Port #5
|
| Device Class: | PCI-to-PCI Bridge
|
| Revision ID: | 30
|
| PCI Address (Bus:Device:Function) Number: | 0:28:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34BC&SUBSYS_00000060&REV_30
|
| | |
|
| [PCI Express]
|
| Version: | 3.0
|
| Maximum Link Width: | 4x
|
| Current Link Width: | 4x
|
| Maximum Link Speed: | 8.0 GT/s
|
| Current Link Speed: | 8.0 GT/s
|
| Device/Port Type: | Root Port of PCI Express Root Complex
|
| Slot Implemented: | No
|
| Emergency Power Reduction: | Not Supported
|
| Active State Power Management (ASPM) Support: | L1
|
| Active State Power Management (ASPM) Status: | L1 Entry
|
| L0s Exit Latency: | 512 ns - 1 us
|
| L1 Exit Latency: | 8 - 16 us
|
| Maximum Payload Size Supported: | 256 bytes
|
| Maximum Payload Size: | 256 bytes
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | INTEL
|
| Driver Description: | Intel(R) PCI Express Root Port #5 - 34BC
|
| Driver Provider: | INTEL
|
| Driver Version: | 10.1.12.2
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34BC&SUBSYS_141B1025&REV_30\3&11583659&0&E0
|
| Location Paths | PCIROOT(0)#PCI(1C00)
|
| NVIDIA GeForce MX350 (GP107M) | |
| |
|
| [General Information]
|
| Device Name: | NVIDIA GeForce MX350 (GP107M)
|
| Original Device Name: | NVIDIA GeForce MX350 (GP107M)
|
| Device Class: | 3D Adapter
|
| Revision ID: | A1
|
| PCI Address (Bus:Device:Function) Number: | 43:0:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_10DE&DEV_1C96&SUBSYS_141B1025&REV_A1
|
| | |
|
| [PCI Express]
|
| Version: | 3.0
|
| Maximum Link Width: | 16x
|
| Current Link Width: | 4x
|
| Maximum Link Speed: | 8.0 GT/s
|
| Current Link Speed: | 2.5 GT/s
|
| Device/Port Type: | PCI Express Endpoint
|
| Slot Implemented: | No
|
| Emergency Power Reduction: | Not Supported
|
| Active State Power Management (ASPM) Support: | L0s and L1
|
| Active State Power Management (ASPM) Status: | L1 Entry
|
| L0s Exit Latency: | 256 - 512 ns
|
| L1 Exit Latency: | 2 - 4 us
|
| Maximum Payload Size Supported: | 256 bytes
|
| Maximum Payload Size: | 256 bytes
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 8B000000
|
| Memory Base Address 1 | 6020000000
|
| Memory Base Address 3 | 6030000000
|
| I/O Base Address 5 | 0
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | NVIDIA
|
| Driver Description: | NVIDIA GeForce MX350
|
| Driver Provider: | NVIDIA
|
| Driver Version: | 26.21.14.4137 (GeForce 441.37)
|
| Driver Date: | 18-Nov-2019
|
| DCH/UWD Driver: | Capable
|
| DeviceInstanceId | PCI\VEN_10DE&DEV_1C96&SUBSYS_141B1025&REV_A1\4&20A528E8&0&00E0
|
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000)
|
| Intel Ice Lake-U/Y PCH-LP - UART #0 [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - UART #0 [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - UART #0 [D0]
|
| Device Class: | Other Communication Device
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:30:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34A8&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | IRQ20
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 0
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Serial IO UART Host Controller - 34A8
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 30.100.1932.6
|
| Driver Date: | 08-Aug-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34A8&SUBSYS_141B1025&REV_30\3&11583659&0&F0
|
| Location Paths | PCIROOT(0)#PCI(1E00)
|
| Intel Ice Lake-U/Y PCH-LP - GSPI #0 [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - GSPI #0 [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - GSPI #0 [D0]
|
| Device Class: | Other Serial Bus Controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:30:2
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34AA&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | IRQ22
|
| Interrupt Pin: | INTC#
|
| Memory Base Address 0 | 0
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Serial IO SPI Host Controller - 34AA
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 30.100.1932.6
|
| Driver Date: | 08-Aug-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34AA&SUBSYS_141B1025&REV_30\3&11583659&0&F2
|
| Location Paths | PCIROOT(0)#PCI(1E02)
|
| Intel Ice Lake-U PCH-LP Premium - eSPI Controller [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U PCH-LP Premium - eSPI Controller [D0]
|
| Original Device Name: | Intel Ice Lake-U PCH-LP Premium - eSPI Controller [D0]
|
| Device Class: | PCI-to-ISA Bridge
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:31:0
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_3482&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | N/A
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | INTEL
|
| Driver Description: | I/O LPC Controller (U Premium) - 3482 for Intel(R) 495 Series Chipset Family On-Package Platform Controller Hub
|
| Driver Provider: | INTEL
|
| Driver Version: | 10.1.12.2
|
| DeviceInstanceId | PCI\VEN_8086&DEV_3482&SUBSYS_141B1025&REV_30\3&11583659&0&F8
|
| Location Paths | PCIROOT(0)#PCI(1F00)
|
| Intel Ice Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) [D0]
|
| Device Class: | Multimedia Audio Adapter
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:31:3
|
| PCI Latency Timer: | 32
|
| Hardware ID: | PCI\VEN_8086&DEV_34C8&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 7FFFEFC000
|
| Memory Base Address 4 | 7FFFF00000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel(R) Corporation
|
| Driver Description: | Zvukový řadič technologie Intel(R) Smart Sound
|
| Driver Provider: | Intel(R) Corporation
|
| Driver Version: | 10.24.0.3157
|
| Driver Date: | 02-Nov-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34C8&SUBSYS_141B1025&REV_30\3&11583659&0&FB
|
| Location Paths | PCIROOT(0)#PCI(1F03)
|
| Intel Ice Lake-U/Y PCH-LP - SMBus Host Controller [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - SMBus Host Controller [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - SMBus Host Controller [D0]
|
| Device Class: | SMBus (System Management Bus)
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:31:4
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34A3&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | INTA#
|
| Memory Base Address 0 | 601D16A000
|
| I/O Base Address 4 | 4040
|
| | |
|
| [Features]
|
| Bus Mastering: | Disabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | INTEL
|
| Driver Description: | Intel(R) SMBus - 34A3
|
| Driver Provider: | INTEL
|
| Driver Version: | 10.1.12.2
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34A3&SUBSYS_141B1025&REV_30\3&11583659&0&FC
|
| Location Paths | PCIROOT(0)#PCI(1F04)
|
| Intel Ice Lake-U/Y PCH-LP - SPI (flash) Controller [D0] | |
| |
|
| [General Information]
|
| Device Name: | Intel Ice Lake-U/Y PCH-LP - SPI (flash) Controller [D0]
|
| Original Device Name: | Intel Ice Lake-U/Y PCH-LP - SPI (flash) Controller [D0]
|
| Device Class: | Other Serial Bus Controller
|
| Revision ID: | 30 [D0]
|
| PCI Address (Bus:Device:Function) Number: | 0:31:5
|
| PCI Latency Timer: | 0
|
| Hardware ID: | PCI\VEN_8086&DEV_34A4&SUBSYS_141B1025&REV_30
|
| | |
|
| [System Resources]
|
| Interrupt Line: | N/A
|
| Interrupt Pin: | N/A
|
| Memory Base Address 0 | FE010000
|
| | |
|
| [Features]
|
| Bus Mastering: | Enabled
|
| Running At 66 MHz: | Not Capable
|
| Fast Back-to-Back Transactions: | Not Capable
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | INTEL
|
| Driver Description: | Intel(R) SPI (flash) Controller - 34A4
|
| Driver Provider: | INTEL
|
| Driver Version: | 10.1.12.2
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34A4&SUBSYS_141B1025&REV_30\3&11583659&0&FD
|
| Location Paths | PCIROOT(0)#PCI(1F05)
|
| |
|
| [Video chipset]
|
| Video Chipset: | Intel UHD Graphics 920
|
| Video Chipset Codename: | Ice Lake-U GT2 32EU
|
| Video Memory: | 1024 MBytes
|
| | |
|
| [Video Card]
|
| Video Card: | Intel Ice Lake-U GT2 32EU LM - Integrated Graphics [ACER]
|
| Video Bus: | Integrated
|
| Video RAMDAC: | Internal
|
| | |
|
| [Performance]
|
| Graphics Memory Clock: | 1064.0 MHz
|
| | |
|
| Hardware ID: | PCI\VEN_8086&DEV_8A56&SUBSYS_141B1025&REV_07
|
| PCI Location (Bus:Dev:Fnc): | 0:02:0
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) UHD Graphics
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 26.20.100.7463
|
| Driver Date: | 06-Nov-2019
|
| DCH/UWD Driver: | Not Capable
|
| DeviceInstanceId | PCI\VEN_8086&DEV_8A56&SUBSYS_141B1025&REV_07\3&11583659&0&10
|
| Location Paths | PCIROOT(0)#PCI(0200)
|
| |
|
| [Video chipset]
|
| Video Chipset: | NVIDIA GeForce MX350
|
| Video Chipset Codename: | GP107M
|
| Video Memory: | 2048 MBytes of GDDR5 SDRAM [Micron]
|
| | |
|
| [Video Card]
|
| Video Card: | NVIDIA GeForce MX350 (GP107M) [ACER]
|
| Video Bus: | PCIe v3.0 x16 (8.0 GT/s) @ x4 (2.5 GT/s)
|
| Video BIOS Version: | 86.07.90.00.73
|
| Video Chipset Revision: | A1
|
| | |
|
| [Performance]
|
| Graphics Processor Clock: | 607.5 MHz
|
| Video Unit Clock: | 556.5 MHz
|
| Graphics Memory Clock: | 202.5 MHz (Effective 810.0 MHz)
|
| Graphics Memory Bus Width: | 64-bit
|
| Number Of ROPs: | 16
|
| Number Of Unified Shaders: | 640
|
| Number Of TMUs (Texture Mapping Units): | 40
|
| NVIDIA SLI Status: | Not Present
|
| | |
|
| Hardware ID: | PCI\VEN_10DE&DEV_1C96&SUBSYS_141B1025&REV_A1
|
| PCI Location (Bus:Dev:Fnc): | 43:00:0
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | NVIDIA
|
| Driver Description: | NVIDIA GeForce MX350
|
| Driver Provider: | NVIDIA
|
| Driver Version: | 26.21.14.4137 (GeForce 441.37)
|
| Driver Date: | 18-Nov-2019
|
| DCH/UWD Driver: | Capable
|
| DeviceInstanceId | PCI\VEN_10DE&DEV_1C96&SUBSYS_141B1025&REV_A1\4&20A528E8&0&00E0
|
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000)
|
| DELL [Unknown Model: DEL413C] | |
| |
|
| [General information]
|
| Monitor Name: | DELL [Unknown Model: DEL413C]
|
| Monitor Name (Manuf): | DELL U2518D
|
| Serial Number: | 3C4YP81BA3DL
|
| Date Of Manufacture: | Week: 2, Year: 2018
|
| Monitor Hardware ID: | Monitor\DEL413C
|
| | |
|
| Max. Vertical Size: | 31 cm
|
| Max. Horizontal Size: | 55 cm
|
| Horizontal Frequency: | 30 - 90 kHz
|
| Vertical Frequency: | 56 - 76 Hz
|
| Maximum Pixel Clock: | 250 MHz
|
| | |
|
| [Advanced parameters]
|
| Input Signal: | Digital
|
| Gamma Factor: | 2.20
|
| | |
|
| [DPMS Modes]
|
| Standby: | Supported
|
| Suspend: | Supported
|
| Active Off: | Supported
|
| Standard Colour Space (sRGB) Default: | Supported
|
| Preferred Timing Mode: | Supported
|
| Default GTF (Continuous Frequency): | Not Supported
|
| DFP 1.x Compatible: | No
|
| | |
|
| [Supported Video Modes]
|
| 1152 x 864 | 75 Hz
|
| 1600 x 1200 | 60 Hz
|
| 1280 x 1024 | 60 Hz
|
| 1920 x 1080 | 60 Hz
|
| 2560 x 1440 | 553 x 311 mm, Pixel Clock 241.50 MHz
|
| BOE [Unknown Model: BOE08BC] | |
| |
|
| [General information]
|
| Monitor Name: | BOE [Unknown Model: BOE08BC]
|
| Monitor Name (Manuf): | BOE CQ NE135FBM-N41
|
| Serial Number: | Unknown
|
| Date Of Manufacture: | Week: 23, Year: 2019
|
| Monitor Hardware ID: | Monitor\BOE08BC
|
| | |
|
| Max. Vertical Size: | 19 cm
|
| Max. Horizontal Size: | 28 cm
|
| | |
|
| [Advanced parameters]
|
| Input Signal: | Digital
|
| Color Bit Depth: | 8 Bits per Primary Color
|
| Digital Video Interface Standard Supported: | DisplayPort
|
| Gamma Factor: | 2.20
|
| | |
|
| [DPMS Modes]
|
| Standby: | Not Supported
|
| Suspend: | Not Supported
|
| Active Off: | Not Supported
|
| Standard Colour Space (sRGB) Default: | Not Supported
|
| Preferred Timing Mode: | Supported
|
| Default GTF (Continuous Frequency): | Supported
|
| DFP 1.x Compatible: | Yes
|
| | |
|
| [Supported Video Modes]
|
| 2256 x 1504 | 285 x 190 mm, Pixel Clock 235.69 MHz
|
| 2256 x 1504 | 285 x 190 mm, Pixel Clock 188.55 MHz
|
| |
|
| [General Information]
|
| Drive Controller: | NVMe
|
| Host Controller: | Intel HM170/QM170 PCH - SATA RAID (RST) Controller [D0]
|
| Drive Model: | HFM512GDJTNI-82A0A
|
| Drive Serial Number: | NJ9CN57531040CF1R
|
| Drive Firmware Revision: | 11000C00
|
| NVMe Version Supported: | v1.3
|
| Drive Capacity: | 488,386 MBytes (512 GB)
|
| Drive Capacity [MB]: | 488386
|
| | |
|
| [Capabilities]
|
| Volatile Write Cache: | Present
|
| Compare Command: | Not Supported
|
| Write Uncorrectable Command: | Supported
|
| Dataset Management: | Supported
|
| Write Zeroes: | Not Supported
|
| Save field set to a non-zero value: | Supported
|
| Reservations: | Not Supported
|
| Timestamp: | Supported
|
| Autonomous Power State Transitions: | Supported
|
| | |
|
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)]
|
| Available Space Below Threshold: | OK
|
| Temperature Exceeded Critical Threshold: | OK
|
| Device Reliablity Degraded: | OK
|
| Media In Read Only Mode: | OK
|
| Volatile Memory Backup Device Failed: | OK
|
| | |
|
| Drive Temperature: | 42 °C
|
| Warning Temperature Threshold: | 88 °C
|
| Critical Temperature Threshold: | 89 °C
|
| Time Above Warning Temperature Threshold: | 0 minutes
|
| Time Above Critical Temperature Threshold: | 0 minutes
|
| | |
|
| Spare Capacity Available: | 100%
|
| Device Health: | 100%
|
| Power Cycles: | 55
|
| Power On Hours: | 25 hours
|
| Unsafe Shutdowns: | 5
|
| Media Errors: | 0
|
| Total Host Reads: | 1284 GBytes
|
| Total Host Writes: | 1104 GBytes
|
| Intel Ice Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) [D0] | |
| |
|
| Audio Adapter: | Intel Ice Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) [D0]
|
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_34C8&SUBSYS_141B1025&REV_30
|
| | |
|
| High Definition Audio Codec: | Intel
|
| Audio Codec Hardware ID: | HDAUDIO\FUNC_03&VEN_8086&DEV_280F&SUBSYS_00000000
|
| Intel Wi-Fi 6 AX201 160MHz | |
| |
|
| [General information]
|
| Network Card: | Intel Wi-Fi 6 AX201 160MHz
|
| Vendor Description: | Microsoft
|
| MAC Address: | C8-09-A8-EE-AF-70
|
| | |
|
| [Capabilities]
|
| Maximum Link Speed: | 866 Mbps
|
| Transmit Buffer Size: | 9 Bytes
|
| Receive Buffer Size: | 9 Bytes
|
| Hardware ID: | PCI\VEN_8086&DEV_34F0&SUBSYS_00748086&REV_30
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Wi-Fi 6 AX201 160MHz
|
| Driver Provider: | Intel
|
| Driver Version: | 21.60.2.1
|
| Driver Date: | 15-Dec-2019
|
| DeviceInstanceId | PCI\VEN_8086&DEV_34F0&SUBSYS_00748086&REV_30\3&11583659&0&A3
|
| Location Paths | PCIROOT(0)#PCI(1403)
|
| Realtek USB GbE Family Controller | |
| |
|
| [General information]
|
| Network Card: | Realtek USB GbE Family Controller
|
| Vendor Description: | Realtek USB NIC
|
| MAC Address: | 9C-EB-E8-71-40-8F
|
| | |
|
| [Capabilities]
|
| Maximum Link Speed: | 1000 Mbps
|
| Transmit Buffer Size: | 6056 Bytes
|
| Receive Buffer Size: | 12112 Bytes
|
| Intel(R) USB 3.10 eXtensible Host Controller - 1.10 (Microsoft) | |
| [Port1] : No Device Connected | |
| [Port2] : No Device Connected | |
| [Port3] : VIA Labs USB 2.0 4-Port Hub | |
| |
|
| [Device Information]
|
| Device Manufacturer: | VIA Labs, Inc.
|
| Product Name: | USB2.0 Hub
|
| Serial Number: | N/A
|
| USB Version Supported: | 3.00 (Connected to a USB 2.00 Port)
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Obecný rozbočovač USB
|
| Hardware ID: | USB\VID_2109&PID_2820
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_2109&PID_2820\5&303B8078&0&3
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)
|
| [Port1] : Bizlink International, PID=073C | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Bizlink International
|
| Product Name: | Bizlink International, PID=073C
|
| Serial Number: | -
|
| USB Version Supported: | 2.00
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Vstupní zařízení USB
|
| Hardware ID: | USB\VID_06C4&PID_C412
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní systémová zařízení)
|
| Driver Description: | Vstupní zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.175
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_06C4&PID_C412\MCU_VER0001
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(1)
|
| [Port2] : No Device Connected | |
| [Port3] : Standard Microsystems Super-Speed 5-Port USB 3.0 Hub | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Microchip Tech
|
| Product Name: | USB2734
|
| Serial Number: | N/A
|
| USB Version Supported: | 3.00 (Connected to a USB 2.00 Port)
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Obecný rozbočovač USB
|
| Hardware ID: | USB\VID_0424&PID_2734
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_0424&PID_2734\6&1EE10A7F&0&3
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)
|
| [Port1] : Texas Instruments Japan PCM2902 Audio Codec | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Burr-Brown from TI
|
| Product Name: | USB Audio CODEC
|
| Serial Number: | N/A
|
| USB Version Supported: | 1.10
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_08BB&PID_2902
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_08BB&PID_2902\7&338F808C&0&1
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(1)
|
| [Port2] : No Device Connected | |
| [Port3] : Areson USB Mouse | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Areson
|
| Product Name: | USB Device
|
| Serial Number: | N/A
|
| USB Version Supported: | 1.10
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_E0FF&PID_0005
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_E0FF&PID_0005\7&338F808C&0&3
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(3)
|
| [Port4] : Složené zařízení USB | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Hoksi Technology
|
| Product Name: | DURGOD Taurus K320
|
| Serial Number: | N/A
|
| USB Version Supported: | 2.00
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_2F68&PID_0082
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_2F68&PID_0082\7&338F808C&0&4
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(4)
|
| [Port5] : Standard Microsystems, PID=EC00 | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Microchip Tech
|
| Product Name: | Hub Controller
|
| Serial Number: | N/A
|
| USB Version Supported: | 2.01
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_0424&PID_274C
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_0424&PID_274C\7&338F808C&0&5
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3)#USB(3)#USB(5)
|
| [Port4] : No Device Connected | |
| [Port5] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port5] : LighTuning Technology EgisTec Touch Fingerprint Sensor | |
| |
|
| [Device Information]
|
| Device Manufacturer: | LighTuning Technology
|
| Product Name: | LighTuning Technology EgisTec Touch Fingerprint Sensor
|
| Serial Number: | -
|
| USB Version Supported: | 1.10
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | EgisTec Touch Fingerprint Sensor
|
| Hardware ID: | USB\VID_1C7A&PID_0570
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Egis Technology Inc.
|
| Driver Description: | EgisTec Touch Fingerprint Sensor
|
| Driver Provider: | Egis Technology Inc.
|
| Driver Version: | 3.5.3.19
|
| Driver Date: | 25-Mar-2019
|
| DeviceInstanceId | USB\VID_1C7A&PID_0570\5&303B8078&0&5
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(5)
|
| [Port6] : Chicony Electronics, PID=B694 | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Chicony Electronics
|
| Product Name: | Chicony Electronics, PID=B694
|
| Serial Number: | -
|
| USB Version Supported: | 2.00
|
| USB Device Speed: | USB 2.0 High-speed
|
| Driver Description: | Složené zařízení USB
|
| Hardware ID: | USB\VID_04F2&PID_B5C5
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní hostitelský řadič USB)
|
| Driver Description: | Složené zařízení USB
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.693
|
| Driver Date: | 21-Jun-2006
|
| DeviceInstanceId | USB\VID_04F2&PID_B5C5\200901010001
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(6)
|
| [Port7] : No Device Connected | |
| [Port8] : No Device Connected | |
| [Port9] : No Device Connected | |
| [Port10] : Intel(R) Wireless Bluetooth(R) | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Intel
|
| Product Name: | Intel(R) Wireless Bluetooth(R)
|
| Serial Number: | -
|
| USB Version Supported: | 2.01
|
| USB Device Speed: | USB 1.1 Full-speed
|
| Driver Description: | Intel(R) Wireless Bluetooth(R)
|
| Hardware ID: | USB\VID_8087&PID_0026
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Intel Corporation
|
| Driver Description: | Intel(R) Wireless Bluetooth(R)
|
| Driver Provider: | Intel Corporation
|
| Driver Version: | 21.60.1.1
|
| Driver Date: | 16-Dec-2019
|
| DeviceInstanceId | USB\VID_8087&PID_0026\5&303B8078&0&10
|
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10)
|
| [Port11] : No Device Connected | |
| [Port12] : No Device Connected | |
| [Port13] : No Device Connected | |
| [Port14] : No Device Connected | |
| [Port15] : No Device Connected | |
| [Port16] : No Device Connected | |
| [Port17] : No Device Connected | |
| [Port18] : No Device Connected | |
| Intel(R) USB 3.10 eXtensible Host Controller - 1.10 (Microsoft) | |
| [Port1] : No Device Connected | |
| [Port2] : VIA Labs, PID=8820 | |
| |
|
| [Device Information]
|
| Device Manufacturer: | VIA Labs, Inc.
|
| Product Name: | USB3.1 Hub
|
| Serial Number: | N/A
|
| USB Version Supported: | 3.10
|
| USB Device Speed: | USB 3.1 SuperSpeedPlus
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Hardware ID: | USB\VID_2109&PID_0820
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_2109&PID_0820\5&10E3226A&0&2
|
| Location Paths | PCIROOT(0)#PCI(0D00)#USBROOT(0)#USB(2)
|
| [Port1] : No Device Connected | |
| [Port2] : Realtek Semiconductor Realtek USB GBE Family Controller | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Realtek
|
| Product Name: | USB 10/100/1000 LAN
|
| Serial Number: | 001000001
|
| USB Version Supported: | 3.00
|
| USB Device Speed: | USB 3.0 SuperSpeed
|
| Driver Description: | Realtek USB GbE Family Controller
|
| Hardware ID: | USB\VID_0BDA&PID_8153
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | Realtek
|
| Driver Description: | Realtek USB GbE Family Controller
|
| Driver Provider: | Realtek
|
| Driver Version: | 10.38.117.2020
|
| Driver Date: | 25-Sep-2015
|
| DeviceInstanceId | USB\VID_0BDA&PID_8153\001000001
|
| Location Paths | PCIROOT(0)#PCI(0D00)#USBROOT(0)#USB(2)#USB(2)
|
| [Port3] : Standard Microsystems Super-Speed 5-Port USB 3.1 Hub | |
| |
|
| [Device Information]
|
| Device Manufacturer: | Standard Microsystems
|
| Product Name: | Standard Microsystems Super-Speed 5-Port USB 3.1 Hub
|
| Serial Number: | -
|
| USB Version Supported: | 3.10
|
| USB Device Speed: | USB 3.0 SuperSpeed
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Hardware ID: | USB\VID_0424&PID_5734
|
| | |
|
| [Driver Information]
|
| Driver Manufacturer: | (Standardní rozbočovače USB)
|
| Driver Description: | Obecný rozbočovač USB SuperSpeed
|
| Driver Provider: | Microsoft
|
| Driver Version: | 10.0.18362.1
|
| Driver Date: | 18-Mar-2019
|
| DeviceInstanceId | USB\VID_0424&PID_5734\6&33522036&0&3
|
| Location Paths | PCIROOT(0)#PCI(0D00)#USBROOT(0)#USB(2)#USB(3)
|
| [Port1] : No Device Connected | |
| [Port2] : No Device Connected | |
| [Port3] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port3] : No Device Connected | |
| [Port4] : No Device Connected | |
| [Port5] : No Device Connected | |
| |
|
| [General Properties]
|
| Device Name: | AP18C7M
|
| Manufacturer Name: | SMP KT00407008
|
| Serial Number: | 7859
|
| Unique ID: | 7859SMP KT00407008AP18C7M
|
| Chemistry: | Lithium Ion
|
| Designed Capacity: | 55963 mWh
|
| Full Charged Capacity: | 57503 mWh
|
| Wear Level: | 0.0 %
|
| Cycle Count: | 11
|
| | |
|
| [Current Power Status]
|
| Power Status: | Charging On AC Power
|
| Current Capacity: | 40286 mWh (70.1 %)
|
| Current Voltage: | 17.096 V
|
| Charge Rate: | 37371 mW
|