| HWiNFO32 v6.12-3930 |
| Creation Time | 26.02.2020 10:52 |
|
Content: |
| MSI |
| [Current Computer] | ||
| Computer Name: | MSI | |
| Computer Brand Name: | MSI Modern 14 A10M | |
| [Operating System] | ||
| Operating System: | Microsoft Windows 10 Home (x64) Build 18363.657 | |
| UEFI Boot: | Present | |
| Secure Boot: | Present | |
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 4 | |
| Number Of Logical Processors: | 8 | |
| Intel Core i5-10210U |
| [General Information] | ||
| Processor Name: | Intel Core i5-10210U | |
| Original Processor Frequency: | 2100.0 MHz | |
| Original Processor Frequency [MHz]: | 2100 | |
| CPU ID: | 000806EC | |
| CPU Brand Name: | Intel(R) Core(TM) i5-10210U CPU @ 1.60GHz | |
| CPU Vendor: | GenuineIntel | |
| CPU Stepping: | V0 | |
| CPU Code Name: | Comet Lake-U v1 LP3 | |
| CPU Technology: | 14 nm | |
| CPU S-Spec: | SRGKY | |
| CPU Thermal Design Power (TDP): | 15.0 W | |
| CPU Power Limit 4 (PL4): | 90.0 W | |
| CPU Power Limits (Max): | Power = Unlimited, Time = Unlimited | |
| CPU Power Limit 1 - Long Duration: | (15.00 W) (28.00 sec) [Unlocked] | |
| CPU Power Limit 2 - Short Duration: | (64.00 W) (2.44 ms) [Unlocked] | |
| Configurable TDP Level 1 (Down): | 10.00 W (Unlimited range), 800 MHz | |
| Configurable TDP Level 2 (Up): | 25.00 W (Unlimited range), 2100 MHz | |
| Current Configurable TDP Level: | Nominal [Unlocked] | |
| CPU Max. Junction Temperature (Tj,max): | 100 °C | |
| CPU Type: | Production Unit | |
| CPU Platform: | BGA1528 | |
| Microcode Update Revision: | BE | |
| Number of CPU Cores: | 4 | |
| Number of Logical CPUs: | 8 | |
| [Operating Points] | ||
| CPU MFM (LowPower): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU LFM (Minimum): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU HFM (Base): | 2100.0 MHz = 21 x 100.0 MHz | |
| CPU Turbo Max: | 4200.0 MHz = 42 x 100.0 MHz [Unlocked] | |
| Turbo Ratio Limits: | 42x (1c), 41x (2c), 39x (3-4c) | |
| CPU Current: | 3193.0 MHz = 32 x 99.8 MHz @ 0.9229 V | |
| LLC/Ring Maximum: | 3900.0 MHz = 39.00 x 100.0 MHz | |
| LLC/Ring Current: | 2893.6 MHz = 29.00 x 99.8 MHz | |
| System Agent Current: | 798.2 MHz = 8.00 x 99.8 MHz | |
| CPU Bus Type: | Intel Direct Media Interface (DMI) v2.0 | |
| Ring to Core Offset: | Enabled | |
| [IA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 42x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 85.00 A | |
| [GT (Slice) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 22x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 31.00 A | |
| [CLR (CBo/LLC/Ring) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 39x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 85.00 A | |
| [GT (Unslice) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 22x | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 31.00 A | |
| [Uncore/SA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Not Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | N/A | |
| OC Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 6.00 A | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 4 x 32 KBytes, Data: 4 x 32 KBytes | |
| L2 Cache: | Integrated: 4 x 256 KBytes | |
| L3 Cache: | 6 MBytes | |
| Instruction TLB: | 2MB/4MB Pages, Fully associative, 8 entries | |
| Data TLB: | 4 KB Pages, 4-way set associative, 64 entries | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Present | |
| Internal ACPI Support | Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Present | |
| Virtual Machine Extensions (VMX) | Present | |
| Safer Mode Extensions (Intel TXT) | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| AVX Support | Present | |
| Fused Multiply Add (FMA) | Present | |
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Present | |
| CMPXCHG16B Support | Present | |
| MOVBE Instruction | Present | |
| POPCNT Instruction | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present | |
| XGETBV/XSETBV OS Enabled | Present | |
| Float16 Instructions | Present | |
| AES Cryptography Support | Present | |
| Random Number Read Instruction (RDRAND) | Present | |
| Extended xAPIC | Present | |
| MONITOR/MWAIT Support | Present | |
| Thermal Monitor 2 | Present | |
| Enhanced SpeedStep Technology | Present | |
| L1 Context ID | Not Present | |
| Send Task Priority Messages Disabling | Present | |
| Processor Context ID | Present | |
| Direct Cache Access | Not Present | |
| TSC-deadline Timer | Present | |
| Performance/Debug Capability MSR | Present | |
| IA32 Debug Interface Support | Present | |
| 64-Bit Debug Store | Present | |
| CPL Qualified Debug Store | Present | |
| [Extended Feature Flags] | ||
| 64-bit Extensions | Present | |
| RDTSCP and TSC_AUX Support | Present | |
| 1 GB large page support | Present | |
| No Execute | Present | |
| SYSCALL/SYSRET Support | Not Present | |
| Bit Manipulation Instructions Set 1 | Present | |
| Bit Manipulation Instructions Set 2 | Present | |
| Advanced Vector Extensions 2 (AVX2) | Present | |
| Advanced Vector Extensions 512 (AVX-512) | Not Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Not Present | |
| AVX-512 Doubleword and Quadword Instructions | Not Present | |
| AVX-512 Byte and Word Instructions | Not Present | |
| AVX-512 Vector Length Extensions | Not Present | |
| AVX-512 52-bit Integer FMA Instructions | Not Present | |
| Secure Hash Algorithm (SHA) Extensions | Not Present | |
| Software Guard Extensions (SGX) Support | Present | |
| Supervisor Mode Execution Protection (SMEP) | Present | |
| Supervisor Mode Access Prevention (SMAP) | Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Present | |
| Read/Write FS/GS Base Instructions | Present | |
| Enhanced Performance String Instruction | Present | |
| INVPCID Instruction | Present | |
| RDSEED Instruction | Present | |
| Multi-precision Add Carry Instructions (ADX) | Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Present | |
| CLWB Instructions | Not Present | |
| TSC_THREAD_OFFSET | Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Not Present | |
| FPU Data Pointer updated only on x87 Exceptions | Not Present | |
| Deprecated FPU CS and FPU DS | Present | |
| Intel Processor Trace | Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Not Present | |
| AVX-512 Galois Fields New Instructions | Not Present | |
| AVX-512 Vector AES | Not Present | |
| AVX-512 Vector Neural Network Instructions | Not Present | |
| AVX-512 Bit Algorithms | Not Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Not Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Not Present | |
| User-Mode Instruction Prevention | Not Present | |
| Protection Keys for User-mode Pages | Not Present | |
| OS Enabled Protection Keys | Not Present | |
| Wait and Pause Enhancements (WAITPKG) | Not Present | |
| Total Memory Encryption | Not Present | |
| Read Processor ID | Not Present | |
| Cache Line Demote | Not Present | |
| MOVDIRI: Direct Stores | Not Present | |
| MOVDIR64B: Direct Stores | Not Present | |
| ENQCMD: Enqueue Stores | Not Present | |
| SGX Launch Configuration | Not Present | |
| AVX-512 BFLOAT16 Instructions | Not Present | |
| [Enhanced Features] | ||
| Thermal Monitor 1: | Supported, Enabled | |
| Thermal Monitor 2: | Supported, Enabled | |
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled | |
| Bi-directional PROCHOT#: | Enabled | |
| Extended Auto-HALT State C1E: | Enabled | |
| MLC Streamer Prefetcher | Supported, Enabled | |
| MLC Spatial Prefetcher | Supported, Enabled | |
| DCU Streamer Prefetcher | Supported, Enabled | |
| DCU IP Prefetcher | Supported, Enabled | |
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported | |
| Intel Dynamic FSB Switching: | Not Supported | |
| Intel Turbo Boost Technology: | Supported, Enabled | |
| Programmable Ratio Limits: | Supported, Disabled | |
| Programmable TDC/TDP Limits: | Supported, Disabled | |
| Hardware Duty Cycling: | Supported, Enabled | |
| [CPU SKU Features] | ||
| Display HD Audio: | Supported | |
| DMI x4: | Supported | |
| DRAM ECC: | Not Supported | |
| VT-d: | Supported | |
| DMI in Gen2 Mode: | Not Supported | |
| PEG in Gen2 Mode: | Not Supported | |
| 1N Mode DDR Timings: | Supported | |
| Camarillo Device: | Supported | |
| 2 DIMMs per Channel: | Not Supported | |
| X2APIC: | Supported | |
| Dual Memory Channel: | Supported | |
| Integrated GPU: | Enabled | |
| DDR Overclocking: | Disabled | |
| Overclocking by DSKU: | Disabled | |
| DDR3L: | Supported | |
| Maximum Memory Size per Channel: | 64 GB (unlimited) | |
| Overclocking: | Disabled | |
| SMT: | Supported | |
| Additive Graphics: | Supported | |
| Additive Graphics: | Disabled | |
| PCIe Gen 3: | Not Supported | |
| DMI Gen 3: | Not Supported | |
| HDCP: | Supported | |
| DDR4: | Supported | |
| LPDDR3: | Supported | |
| BCLK OC Limit: | 100 MHz | |
| Maximum Supported LPDDR3 Frequency: | 1067 MHz | |
| Maximum Supported DDR4 Frequency: | 1333 MHz | |
| SVID Status: | Enabled | |
| [Voltage Regulator (SVID)] | ||
| VCC VR: | Intersil (0x57), IMVP8 | |
| VR Thermal Sensor: | Not Supported | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 39-bit (512 GBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 80000000-100000000 (2048MB-4096MB) Type: | Uncacheable (UC) | |
| Range 40000000-80000000 (1024MB-2048MB) Type: | Uncacheable (UC) | |
| Range 3C000000-40000000 (960MB-1024MB) Type: | Uncacheable (UC) | |
| Range 3B800000-3C000000 (952MB-960MB) Type: | Uncacheable (UC) | |
| Range 2000000000-4000000000 (131072MB-262144MB) Type: | Uncacheable (UC) | |
| Range 1000000000-2000000000 (65536MB-131072MB) Type: | Uncacheable (UC) | |
| Range 800000000-1000000000 (32768MB-65536MB) Type: | Uncacheable (UC) | |
| Range 400000000-800000000 (16384MB-32768MB) Type: | Uncacheable (UC) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | MSI Modern 14 A10M | |
| [Motherboard] | ||
| Motherboard Model: | MSI MS-14B3 | |
| Motherboard Chipset: | Intel Comet Lake-U PCH-LP Premium | |
| Motherboard Slots: | 4xPCI Express x1, 2xPCI Express x4, 1xPCI Express x16 | |
| PCI Express Version Supported: | v3.0 | |
| USB Version Supported: | v3.1 | |
| [BIOS] | ||
| BIOS Manufacturer: | American Megatrends Inc. | |
| BIOS Date: | 08/23/2019 | |
| BIOS Version: | E14B3IMS.509 | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | Unknown | |
| ACPI Devices |
| HID Button over Interrupt Driver |
| Device Name: | HID Button over Interrupt Driver | |
| [Assigned Resources] | ||
| IRQ: | 1024 | |
| [Alternative 1] | ||
| IRQ: | 1024 | |
| ELAN Input Device |
| Device Name: | ELAN Input Device | |
| [Assigned Resources] | ||
| IRQ: | 12 | |
| [Alternative 1] | ||
| IRQ: | 12 | |
| Intel(R) Serial IO GPIO Host Controller - INT34BB |
| Device Name: | Intel(R) Serial IO GPIO Host Controller - INT34BB | |
| [Assigned Resources] | ||
| Memory Location: | FD6E0000 - FD6EFFFF | |
| [Alternative 1] | ||
| Memory Location: | FD6E0000 - FD6EFFFF | |
| Memory Location: | FD6D0000 - FD6DFFFF | |
| Memory Location: | FD6A0000 - FD6AFFFF | |
| IRQ: | 14 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 1854 - 1857 | |
| [Alternative 1] | ||
| I/O Port: | 1854 - 1857 | |
| Trusted Platform Module 2.0 |
| Device Name: | Trusted Platform Module 2.0 | |
| [Assigned Resources] | ||
| Memory Location: | FED40000 - FED44FFF | |
| [Alternative 1] | ||
| Memory Location: | FED40000 - FED44FFF | |
| Standard PS/2 Keyboard |
| Device Name: | Standard PS/2 Keyboard | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0000 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00B0 - 00B1 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| DMA: | 0 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| Memory Location: | FED00000 - FED003FF | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| PCI Express Root Complex |
| Device Name: | PCI Express Root Complex | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - FFFFFFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000E4000 - 000E3FFF | |
| Memory Location: | 000EC000 - 000EFFFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000E0000 - 000E3FFF | |
| Memory Location: | 000E4000 - 000E7FFF | |
| Memory Location: | 000E8000 - 000EBFFF | |
| Memory Location: | 000EC000 - 000EFFFF | |
| Memory Location: | 000F0000 - 000FFFFF | |
| Memory Location: | 40000000 - DFFFFFFF | |
| Memory Location: | FC800000 - FE7FFFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0077 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| [Alternative 1] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED18000 - FED18FFF | |
| Memory Location: | FED19000 - FED19FFF | |
| Memory Location: | E0000000 - EFFFFFFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| Memory Location: | FED90000 - FED93FFF | |
| Memory Location: | FED45000 - FED8FFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 0065 | |
| I/O Port: | 0000 - 006F | |
| I/O Port: | 0092 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | 164E - 164F | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FE038000 - FE038FFF | |
| [Alternative 1] | ||
| Memory Location: | FE038000 - FE038FFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 2000 - 20FE | |
| [Alternative 1] | ||
| I/O Port: | 2000 - 20FE | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FD000000 - FD69FFFF | |
| Memory Location: | FE200000 - FE7FFFFF | |
| [Alternative 1] | ||
| I/O Port: | 1800 - 18FE | |
| Memory Location: | FD000000 - FD69FFFF | |
| Memory Location: | FD6B0000 - FD6CFFFF | |
| Memory Location: | FD6F0000 - FDFFFFFF | |
| Memory Location: | FE000000 - FE01FFFF | |
| Memory Location: | FE200000 - FE7FFFFF | |
| Memory Location: | FF000000 - FFFFFFFF | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0062 | |
| [Alternative 1] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| SMBIOS DMI |
| OEM Strings |
| $BIOSE1110000100000010200 | ||
| BIOS |
| BIOS Vendor: | American Megatrends Inc. | |
| BIOS Version: | E14B3IMS.509 | |
| BIOS Release Date: | 08/23/2019 | |
| BIOS Start Segment: | F000 | |
| BIOS Size: | 16 MBytes | |
| System BIOS Version: | 5.9 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Not Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Not Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Not Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Not Present | |
| BIOS Boot Specification Support: | Present | |
| Function key-initiated Network Service Boot Support: | Not Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | Micro-Star International Co., Ltd. | |
| Product Name: | Modern 14 A10M | |
| Product Version: | REV:1.0 | |
| Product Serial Number: | 9S714B362473ZJA000269 | |
| UUID: | {C1A0B116-51C8-8547-A78B-3909189CAE7F} | |
| SKU Number: | 14B3.5 | |
| Family: | Modern |
| Mainboard |
| Mainboard Manufacturer: | Micro-Star International Co., Ltd. | |
| Mainboard Name: | MS-14B3 | |
| Mainboard Version: | REV:1.0 | |
| Mainboard Serial Number: | BSS-0123456789 | |
| Asset Tag: | Default string | |
| Location in chassis: | Default string |
| System Enclosure |
| Manufacturer: | Micro-Star International Co., Ltd. | |
| Case Type: | Notebook | |
| Version: | N/A | |
| Serial Number: | 19PN074156 | |
| Asset Tag Number: | No Asset Tag |
| On Board Device |
| Device Description: | To Be Filled By O.E.M. | |
| Device Type: | Video Adapter | |
| Device Status: | Enabled | |
| System Configuration Options |
| Default string |
| System Boot Information |
| Boot Status: | No error occured |
| Management Device |
| Device Description: | LM78-1 | |
| Device Type: | National Semiconductor LM78 | |
| Device Address: | I/O: 0 |
| Voltage Probe |
| Description: | LM78A | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Management Device Threshold Data |
| Management Device Component |
| Temperature Probe |
| Description: | LM78A | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Management Device Threshold Data |
| Management Device Component |
| Cooling Device |
| Type: | Power Supply Fan | |
| Description: | Cooling Dev 1 | |
| Status: | OK |
| Management Device Threshold Data |
| Management Device Component |
| Cooling Device |
| Type: | Power Supply Fan | |
| Description: | Unknown | |
| Status: | OK |
| Management Device Threshold Data |
| Management Device Component |
| Electrical Current Probe |
| Description: | ABC | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Management Device Threshold Data |
| Management Device Component |
| Voltage Probe |
| Description: | LM78A | |
| Location: | Power Unit | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Temperature Probe |
| Description: | LM78A | |
| Location: | Power Unit | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Cooling Device |
| Type: | Power Supply Fan | |
| Description: | Cooling Dev 1 | |
| Status: | OK |
| Electrical Current Probe |
| Description: | ABC | |
| Location: | Power Unit | |
| Status: | OK | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| System Power Supply |
| Location: | To Be Filled By O.E.M. | |
| Device Name: | To Be Filled By O.E.M. | |
| Manufacturer: | To Be Filled By O.E.M. | |
| Serial Number: | To Be Filled By O.E.M. | |
| Asset Tag Number: | To Be Filled By O.E.M. | |
| Model Part Number: | To Be Filled By O.E.M. | |
| Revision Level: | To Be Filled By O.E.M. | |
| Power Supply Status: | Present | |
| Power Supply Type: | Switching | |
| Power Status: | OK | |
| Hot replaceable: | No | |
| Unplugged from wall: | No |
| TPM |
| TPM Specification Version: | 2.0 | |
| TPM Vendor: | CTNI | |
| TPM Description: | INTEL |
| Firmware Version Information |
| Reference Code - CPU | 9.0.18.80 | |
| uCode Version | 0.0.0.190 | |
| TXT ACM version | 1.5.0.0 |
| Firmware Version Information |
| Reference Code - ME | 9.0.18.80 | |
| MEBx version | 0.0.0.0 | |
| ME Firmware Version | Consumer SKU |
| Firmware Version Information |
| Reference Code - CML PCH | 9.0.18.80 | |
| PCH-CRID Status | Disabled | |
| PCH-CRID Original Value | 0x0 | |
| PCH-CRID New Value | 0x0 | |
| OPROM - RST - RAID | ||
| ChipsetInit Base Version | 21 | |
| ChipsetInit Oem Version | 0 |
| Firmware Version Information |
| Reference Code - SA - System Agent | 9.0.18.80 | |
| Reference Code - MRC | 0.7.1.101 | |
| SA - PCIe Version | 9.0.18.80 | |
| SA-CRID Status | Disabled | |
| SA-CRID Original Value | 0.0.0.12 | |
| SA-CRID New Value | 0.0.0.12 | |
| OPROM - VBIOS |
| Firmware Version Information |
| FSP Binary Version | 4.0.0.0 |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 256 KBytes | |
| Installed Cache Size: | 256 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 Cache |
| Socket Designation: | L2 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L2 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 1024 KBytes | |
| Installed Cache Size: | 1024 KBytes | |
| Cache Associativity: | 4-way Set-Associative |
| L3 Cache |
| Socket Designation: | L3 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L3 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 6144 KBytes | |
| Installed Cache Size: | 6144 KBytes | |
| Cache Associativity: | 12-way Set-Associative |
| Processor |
| Processor Manufacturer: | Intel(R) Corporation | |
| Processor Version: | Intel(R) Core(TM) i5-10210U CPU @ 1.60GHz | |
| External Clock: | 100 MHz | |
| Maximum Clock Supported: | 8300 MHz | |
| Current Clock: | 1485 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Voltage: | 0.6 V | |
| Processor Upgrade: | Unknown (3C) | |
| Socket Designation: | U3E1 |
| Intel vPro |
| CPU VT-x Support: | Supported | |
| CPU VT-x Status: | Enabled | |
| CPU VT-x2 Support: | Not Supported | |
| CPU VT-x2 Status: | Disabled | |
| CPU TXT Support: | Not Supported | |
| CPU TXT Status: | Disabled | |
| CPU VMX Status: | Enabled | |
| CPU SMX Status: | Disabled | |
| Intel ME Status: | Enabled | |
| Intel OST Firmware Support: | Not Supported | |
| Intel ASF Firmware Support: | Not Supported | |
| Intel AMT Pro Firmware Support: | Not Supported | |
| Intel AMT Basic Firmware Support: | Not Supported | |
| Intel TPM Firmware Support: | Not Supported | |
| Intel Castle Peak Support: | Not Supported | |
| Intel WoX Support: | Not Supported | |
| Intel Virtualization Engine Support: | Not Supported | |
| Intel Anti-Theft Technology Support: | Not Supported | |
| TPM On-board: | Not Supported | |
| Intel Anti-Theft Technology Enrolled: | Not Supported | |
| Intel ME Version: | v14.0, Build 1061, Hotfix 0 | |
| BIOS VT-x Support: | Not Supported | |
| BIOS VT-d Support: | Supported | |
| BIOS TXT Support: | Not Supported | |
| BIOS TPM Support: | Not Supported | |
| BIOS ME Support: | Not Supported | |
| BIOS VA Extensions Support: | Supported | |
| Intel AT PBA For Recovery Support: | Not Supported | |
| Intel AT WWAN Support: | Not Supported |
| BIOS Language |
| en|US|iso8859-1 | ||
| zh|CN|unicode | ||
| zh|TW|unicode |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Video | |
| Device Type: | Video Adapter | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Ethernet | |
| Device Type: | Ethernet Adapter | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Sound | |
| Device Type: | Audio Device | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Other | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| Firmware Version Information |
| Lan Phy Version | ||
| Sensor Firmware Version | ||
| Debug Mode Status | Disabled | |
| Performance Mode Status | Disabled | |
| Debug Use USB(Disabled:Serial) | Disabled | |
| ICC Overclocking Version | 0.0.0.0 | |
| UNDI Version | ||
| EC FW Version | 0.0 | |
| GOP Version | 0.9.0.4242 | |
| Royal Park Version | BP1520_Formal_P01_RP01 | |
| Platform Version | 0.7.0.0 | |
| Client Silicon Version | 0.2.0.15 |
| Group Associations |
| Group Associations |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 32 GBytes | |
| Memory Devices: | 2 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 8192 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | ChannelA-DIMM0 | |
| Bank Locator: | BANK 0 | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2667 MHz | |
| Manufacturer: | Samsung | |
| Serial Number: | 33560B53 | |
| Part Number: | M471A1K43CB1-CTD | |
| Asset Tag: | 9876543210 |
| Memory Device |
| Total Width: | 0 bits | |
| Data Width: | 0 bits | |
| Device Size: | 0 MBytes | |
| Device Form Factor: | Unknown | |
| Device Locator: | ChannelB-DIMM0 | |
| Bank Locator: | BANK 2 | |
| Device Type: | Unknown | |
| Device Type Detail: | ||
| Manufacturer: | Unknown | |
| Serial Number: | Unknown | |
| Part Number: | Unknown | |
| Asset Tag: | Unknown |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Width: | 1 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | Non-interleaved | |
| Interleave Data Depth: | 0 |
| Port Connectors |
| Mouse Port |
| Port Type: | Mouse Port | |
| Internal Reference: | J1A1 | |
| Internal Connector Type: | None | |
| External Reference: | PS2Mouse | |
| External Connector Type: | PS/2 |
| Keyboard Port |
| Port Type: | Keyboard Port | |
| Internal Reference: | J1A1 | |
| Internal Connector Type: | None | |
| External Reference: | Keyboard | |
| External Connector Type: | PS/2 |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J2A1 | |
| Internal Connector Type: | None | |
| External Reference: | TV Out | |
| External Connector Type: | Mini-Centronics Type-14 |
| Serial Port 16550A Compatible |
| Port Type: | Serial Port 16550A Compatible | |
| Internal Reference: | J2A2A | |
| Internal Connector Type: | None | |
| External Reference: | COM A | |
| External Connector Type: | DB-9 pin male |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J2A2B | |
| Internal Connector Type: | None | |
| External Reference: | Video | |
| External Connector Type: | DB-15 pin female |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB1 | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB2 | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J3A1 | |
| Internal Connector Type: | None | |
| External Reference: | USB3 | |
| External Connector Type: | Access Bus (USB) |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9A1 - TPM HDR | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9C1 - PCIE DOCKING CONN | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J2B3 - CPU FAN | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J6C2 - EXT HDMI | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J3C1 - GMCH FAN | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J1D1 - ITP | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9E2 - MDC INTPSR | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9E4 - MDC INTPSR | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9E3 - LPC HOT DOCKING | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9E1 - SCAN MATRIX | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9G1 - LPC SIDE BAND | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J8F1 - UNIFIED | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J6F1 - LVDS | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J2F1 - LAI FAN | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J2G1 - GFX VID | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J1G6 - AC JACK | |
| Internal Connector Type: | Unknown | |
| External Reference: | Unknown | |
| External Connector Type: | None |
| System Slots |
| J6B2 |
| Slot Designation: | J6B2 | |
| Slot Type: | PCI Express | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 16x / x16 | |
| Slot Length: | Long |
| J6B1 |
| Slot Designation: | J6B1 | |
| Slot Type: | PCI Express | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J6D1 |
| Slot Designation: | J6D1 | |
| Slot Type: | PCI Express | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J7B1 |
| Slot Designation: | J7B1 | |
| Slot Type: | PCI Express | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J8B4 |
| Slot Designation: | J8B4 | |
| Slot Type: | PCI Express | |
| Slot Usage: | In use | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| Intel ME |
| [ME Host Status] | ||
| ME Current Working State: | Normal | |
| Manufacturing Mode: | Not Active | |
| ME Current Operation Mode: | Normal | |
| Boot Guard Status: | Enabled | |
| Boot Guard Verified Boot Policy: | Enabled | |
| Boot Guard Measured Boot Policy: | Enabled | |
| [Intel Manageability Engine Features] | ||
| Intel ME Version: | 14.0, Build 1061 | |
| Intel ME Recovery Image Version: | 14.0, Build 1061 | |
| Intel ME FITC Version: | 14.0, Build 1061 | |
| [ME Firmware Capabilities] | ||
| Full Network Manageability: | Not Capable | |
| Standard Network Manageability: | Not Capable | |
| Manageability (AMT): | Not Capable | |
| Small Business Advantage: | Not Capable | |
| Intel Integrated Touch: | Not Capable | |
| Intel Anti-Theft: | Not Capable | |
| Capability Licensing Service: | Capable | |
| Virtualization Engine: | Not Capable | |
| Intel Sensor Hub (ISH): | Not Capable | |
| ICC Over Clocking: | Not Capable | |
| Protected Audio Video Path (PAVP): | Capable | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Capable | |
| IPV6: | Not Capable | |
| KVM Remote Control: | Not Capable | |
| Outbreak Containment Heuristic (OCH): | Not Capable | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Not Capable | |
| Wireless LAN (WLAN): | Not Capable | |
| Platform Trust Technology (PTT): | Capable | |
| Near Field Communication (NFC): | Not Capable | |
| [ME Firmware Feature State] | ||
| Full Network Manageability: | Disabled | |
| Standard Network Manageability: | Disabled | |
| Manageability (AMT): | Disabled | |
| Small Business Advantage: | Not Capable | |
| MEI3: | Not Capable | |
| Intel Anti-Theft: | Disabled | |
| Capability Licensing Service: | Enabled | |
| Virtualization Engine: | Disabled | |
| Intel Sensor Hub (ISH): | Disabled | |
| ICC Over Clocking: | Disabled | |
| Protected Audio Video Path (PAVP): | Enabled | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Enabled | |
| IPV6: | Disabled | |
| KVM Remote Control: | Disabled | |
| Outbreak Containment Heuristic (OCH): | Disabled | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Disabled | |
| Wireless LAN (WLAN): | Disabled | |
| Platform Trust Technology (PTT): | Enabled | |
| Near Field Communication (NFC): | Disabled | |
| [ME Firmware Platform Type] | ||
| Platform Target Usage Type: | Mobile | |
| SKU: | Regular SKU | |
| ME Firmware Image Type: | Consumer SKU Firmware | |
| Platform Brand: | None | |
| Host ME Region Flash Protection Override (HMRFPO) Status: | Locked | |
| Memory |
| [General information] | ||
| Total Memory Size: | 8 GBytes | |
| Total Memory Size [MB]: | 8192 | |
| [Current Performance Settings] | ||
| Maximum Supported Memory Clock: | 1333.3 MHz | |
| Current Memory Clock: | 1330.4 MHz | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 19-19-19-43 | |
| Memory Channels Supported: | 2 | |
| Memory Channels Active: | 1 | |
| Command Rate: | 2T | |
| Read to Read Delay (tRD_RD) Same Rank: | 7T | |
| Read to Read Delay (tRD_RD) Different Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different DIMM: | 7T | |
| Write to Write Delay (tWR_WR) Same Rank: | 7T | |
| Write to Write Delay (tWR_WR) Different Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different DIMM: | 7T | |
| Read to Write Delay (tRD_WR) Same Rank: | 9T | |
| Read to Write Delay (tRD_WR) Different Rank: | 9T | |
| Read to Write Delay (tRD_WR) Different DIMM: | 11T | |
| Write to Read Delay (tWR_RD) Same Rank (tWTR): | 33T | |
| Write to Read Delay (tWR_RD) Different Rank: | 27T | |
| Write to Read Delay (tWR_RD) Different DIMM: | 6T | |
| RAS# to RAS# Delay (tRRD): | 7T | |
| Refresh Cycle Time (tRFC): | 467T | |
| Four Activate Window (tFAW): | 28T | |
| Row: 0 - 8 GB PC4-21300 DDR4 SDRAM Samsung M471A1K43CB1-CTD |
| [General Module Information] | ||
| Module Number: | 0 | |
| Module Size: | 8 GBytes | |
| Memory Type: | DDR4 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 1333.3 MHz (DDR4-2666 / PC4-21300) | |
| Module Manufacturer: | Samsung | |
| Module Part Number: | M471A1K43CB1-CTD | |
| Module Revision: | 0.0 | |
| Module Serial Number: | 1393251891 | |
| Module Manufacturing Date: | Year: 2019, Week: 31 | |
| Module Manufacturing Location: | 2 | |
| SDRAM Manufacturer: | Samsung | |
| DRAM Steppping: | 0.0 | |
| Error Check/Correction: | None | |
| [Module Characteristics] | ||
| Row Address Bits: | 16 | |
| Column Address Bits: | 10 | |
| Module Density: | 8192 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 8 bits | |
| Bus Width: | 64 bits | |
| Die Count: | 1 | |
| Module Nominal Voltage (VDD): | 1.2 V | |
| Minimum SDRAM Cycle Time (tCKAVGmin): | 0.75000 ns | |
| Maximum SDRAM Cycle Time (tCKAVGmax): | 1.60000 ns | |
| CAS# Latencies Supported: | 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20 | |
| Minimum CAS# Latency Time (tAAmin): | 13.750 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.750 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.750 ns | |
| Minimum Active to Precharge Time (tRASmin): | 32.000 ns | |
| Supported Module Timing at 1333.3 MHz: | 19-19-19-43 | |
| Supported Module Timing at 1200.0 MHz: | 17-17-17-39 | |
| Supported Module Timing at 1066.7 MHz: | 15-15-15-35 | |
| Supported Module Timing at 933.3 MHz: | 13-13-13-30 | |
| Supported Module Timing at 800.0 MHz: | 11-11-11-26 | |
| Supported Module Timing at 666.7 MHz: | 10-10-10-22 | |
| Minimum Active to Active/Refresh Time (tRCmin): | 45.750 ns | |
| Minimum Refresh Recovery Time Delay (tRFC1min): | 350.000 ns | |
| Minimum Refresh Recovery Time Delay (tRFC2min): | 260.000 ns | |
| Minimum Refresh Recovery Time Delay (tRFC4min): | 160.000 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 21.000 ns | |
| Minimum Active to Active Delay Time - Different Bank Group (tRRD_Smin): | 3.000 ns | |
| Minimum Active to Active Delay Time - Same Bank Group (tRRD_Lmin): | 4.900 ns | |
| Minimum CAS to CAS Delay Time - Same Bank Group (tCCD_Lmin): | 5.000 ns | |
| [Features] | ||
| Module Temperature Sensor (TSOD): | Not Supported | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | 1 - 2 mm | |
| Address Mapping from Edge Connector to DRAM: | Standard | |
| Bus |
| PCI Bus #0 |
| Intel Comet Lake-U v1 4c - Host Bridge/DRAM Controller |
| [General Information] | ||
| Device Name: | Intel Comet Lake-U v1 4c - Host Bridge/DRAM Controller | |
| Original Device Name: | Intel Comet Lake-U v1 4c - Host Bridge/DRAM Controller | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | C | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9B61&SUBSYS_12791462&REV_0C | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.18362.267 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9B61&SUBSYS_12791462&REV_0C\3&11583659&1&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| Intel UHD Graphics (Comet Lake-U GT2) - Integrated Graphics Controller [V0] |
| [General Information] | ||
| Device Name: | Intel UHD Graphics (Comet Lake-U GT2) - Integrated Graphics Controller [V0] | |
| Original Device Name: | Intel UHD Graphics (Comet Lake-U GT2) - Integrated Graphics Controller [V0] | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | 2 [V0] | |
| PCI Address (Bus:Device:Function) Number: | 0:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9B41&SUBSYS_12791462&REV_02 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Current Link Width: | Not negotiated | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 50000000 | |
| Memory Base Address 2 | 40000000 | |
| I/O Base Address 4 | 4000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) UHD Graphics | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 26.20.100.7372 | |
| Driver Date: | 25-Oct-2019 | |
| DCH/UWD Driver: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9B41&SUBSYS_12791462&REV_02\3&11583659&1&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Intel Comet Lake PCH-LP - Thermal Subsystem [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - Thermal Subsystem [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - Thermal Subsystem [A0] | |
| Device Class: | Other Data Acquisition/Signal Processing Controller | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:18:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02F9&SUBSYS_12791462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 5121D000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) Thermal Subsytem - 02F9 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02F9&SUBSYS_12791462&REV_00\3&11583659&1&90 | |
| Location Paths | PCIROOT(0)#PCI(1200) | |
| Intel Comet Lake PCH-LP - USB 3.1 xHCI Host Controller [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - USB 3.1 xHCI Host Controller [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - USB 3.1 xHCI Host Controller [A0] | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02ED&SUBSYS_12791462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 51200000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 3.1 | |
| [Driver Information] | ||
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI | |
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.18362.207 | |
| Driver Date: | 19-Jun-2019 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02ED&SUBSYS_12791462&REV_00\3&11583659&1&A0 | |
| Location Paths | PCIROOT(0)#PCI(1400) | |
| USB Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : RealTek RTS5129 USB Card Reader |
| [Device Information] | ||
| Device Manufacturer: | RealTek | |
| Product Name: | RealTek RTS5129 USB Card Reader | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Realtek USB 2.0 Card Reader | |
| Hardware ID: | USB\VID_0BDA&PID_0129 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek USB 2.0 Card Reader | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 10.0.18362.31248 | |
| Driver Date: | 25-Apr-2019 | |
| DeviceInstanceId | USB\VID_0BDA&PID_0129\20100201396000000 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(5) | |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port9] : No Device Connected |
| [Port10] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0AAA | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 21.50.0.1 | |
| Driver Date: | 06-Sep-2019 | |
| DeviceInstanceId | USB\VID_8087&PID_0AAA\5&29DCF67C&0&10 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10) | |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| Intel Comet Lake PCH-LP - Shared SRAM [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - Shared SRAM [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - Shared SRAM [A0] | |
| Device Class: | RAM/Memory Controller | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02EF&SUBSYS_72708086&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | 51218000 | |
| Memory Base Address 2 | 5121C000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) Shared SRAM - 02EF | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02EF&SUBSYS_72708086&REV_00\3&11583659&1&A2 | |
| Location Paths | PCIROOT(0)#PCI(1402) | |
| Intel Comet Lake PCH-LP - CNVi: WiFi (sku 0) [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - CNVi: WiFi (sku 0) [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - CNVi: WiFi (sku 0) [A0] | |
| Device Class: | Other Network Adapter | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02F0&SUBSYS_00348086&REV_00 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Current Link Width: | Not negotiated | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE0FC000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless-AC 9560 160MHz | |
| Driver Provider: | Intel | |
| Driver Version: | 21.30.3.2 | |
| Driver Date: | 07-Jul-2019 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02F0&SUBSYS_00348086&REV_00\3&11583659&1&A3 | |
| Location Paths | PCIROOT(0)#PCI(1403) | |
| Intel Comet Lake PCH-LP - HECI #1 [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - HECI #1 [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - HECI #1 [A0] | |
| Device Class: | Other Communication Device | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:22:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02E0&SUBSYS_12791462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE0F7000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Management Engine Interface | |
| Driver Provider: | Intel | |
| Driver Version: | 1919.14.0.1269 | |
| Driver Date: | 07-May-2019 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02E0&SUBSYS_12791462&REV_00\3&11583659&1&B0 | |
| Location Paths | PCIROOT(0)#PCI(1600) | |
| Intel Comet Lake PCH-LP - PCI Express Root Port #9 [A0/D0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - PCI Express Root Port #9 [A0/D0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - PCI Express Root Port #9 [A0/D0] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F0 [A0/D0] | |
| PCI Address (Bus:Device:Function) Number: | 0:29:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02B0&SUBSYS_00000000&REV_F0 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 4x | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Capable | |
| Hot-Plug Surprise: | Capable | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 2 - 4 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) PCI Express Root Port #9 - 02B0 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02B0&SUBSYS_12791462&REV_F0\3&11583659&1&E8 | |
| Location Paths | PCIROOT(0)#PCI(1D00) | |
| PCI Express x4 Bus #1 |
| Intel Comet Lake PCH-LP - PCI Express Root Port #13 [A0/D0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - PCI Express Root Port #13 [A0/D0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - PCI Express Root Port #13 [A0/D0] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F0 [A0/D0] | |
| PCI Address (Bus:Device:Function) Number: | 0:29:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02B4&SUBSYS_00000000&REV_F0 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 4x | |
| Current Link Width: | 2x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 25.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) PCI Express Root Port #13 - 02B4 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02B4&SUBSYS_12791462&REV_F0\3&11583659&1&EC | |
| Location Paths | PCIROOT(0)#PCI(1D04) | |
| PCI Express x4 Bus #2 |
| Kingston Technology, Device ID: 5008 |
| [General Information] | ||
| Device Name: | Kingston Technology, Device ID: 5008 | |
| Original Device Name: | Kingston Technology, Device ID: 5008 | |
| Device Class: | NVMe Controller | |
| Revision ID: | 1 | |
| PCI Address (Bus:Device:Function) Number: | 2:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_2646&DEV_5008&SUBSYS_50082646&REV_01 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 2x | |
| Current Link Width: | 2x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | >4 us | |
| L1 Exit Latency: | >64 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 51100000 | |
| I/O Base Address 2 | 0 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Řadič Standard NVM Express | |
| Driver Description: | Řadič Standard NVM Express | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.18362.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_2646&DEV_5008&SUBSYS_50082646&REV_01\4&BF4B3A5&0&00EC | |
| Location Paths | PCIROOT(0)#PCI(1D04)#PCI(0000) | |
| Intel Comet Lake-U Premium PCH-LP - LPC Controller/eSPI Controller [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake-U Premium PCH-LP - LPC Controller/eSPI Controller [A0] | |
| Original Device Name: | Intel Comet Lake-U Premium PCH-LP - LPC Controller/eSPI Controller [A0] | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_0284&SUBSYS_12791462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | I/O LPC Controller - 0284 for Intel(R) 400 Series Chipset Family On-Package Platform Controller Hub | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_0284&SUBSYS_12791462&REV_00\3&11583659&1&F8 | |
| Location Paths | PCIROOT(0)#PCI(1F00) | |
| Intel Comet Lake PCH-LP - cAVS (Audio, Voice, Speech) [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - cAVS (Audio, Voice, Speech) [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - cAVS (Audio, Voice, Speech) [A0] | |
| Device Class: | High Definition Audio | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:3 | |
| PCI Latency Timer: | 32 | |
| Hardware ID: | PCI\VEN_8086&DEV_02C8&SUBSYS_12801462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE0F8000 | |
| Memory Base Address 4 | FE100000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | Řadič High Definition Audio | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.18362.1 | |
| Driver Date: | 18-Mar-2019 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02C8&SUBSYS_12801462&REV_00\3&11583659&1&FB | |
| Location Paths | PCIROOT(0)#PCI(1F03) | |
| Intel Comet Lake PCH-LP - SMBus Host Controller [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - SMBus Host Controller [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - SMBus Host Controller [A0] | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02A3&SUBSYS_12791462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 5121A000 | |
| I/O Base Address 4 | EFA0 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) SMBus - 02A3 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02A3&SUBSYS_12791462&REV_00\3&11583659&1&FC | |
| Location Paths | PCIROOT(0)#PCI(1F04) | |
| Intel Comet Lake PCH-LP - SPI (flash) Controller [A0] |
| [General Information] | ||
| Device Name: | Intel Comet Lake PCH-LP - SPI (flash) Controller [A0] | |
| Original Device Name: | Intel Comet Lake PCH-LP - SPI (flash) Controller [A0] | |
| Device Class: | Other Serial Bus Controller | |
| Revision ID: | 0 [A0] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:5 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_02A4&SUBSYS_12791462&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | FE010000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) SPI (flash) Controller - 02A4 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.27.2 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02A4&SUBSYS_12791462&REV_00\3&11583659&1&FD | |
| Location Paths | PCIROOT(0)#PCI(1F05) | |
| Video Adapter |
| Intel UHD Graphics |
| [Video chipset] | ||
| Video Chipset: | Intel UHD Graphics | |
| Video Chipset Codename: | Comet Lake-U GT2 | |
| Video Memory: | 1024 MBytes | |
| [Video Card] | ||
| Video Card: | Intel UHD Graphics (Comet Lake-U GT2) - Integrated Graphics Controller [V0] [MSI] | |
| Video Bus: | Integrated | |
| Video RAMDAC: | Internal | |
| Video BIOS Version: | Unknown | |
| [Performance] | ||
| Memory Clock: | 1330.0 MHz | |
| Hardware ID: | PCI\VEN_8086&DEV_9B41&SUBSYS_12791462&REV_02 | |
| PCI Location (Bus:Dev:Fnc): | 0:02:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) UHD Graphics | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 26.20.100.7372 | |
| Driver Date: | 25-Oct-2019 | |
| DCH/UWD Driver: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9B41&SUBSYS_12791462&REV_02\3&11583659&1&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Monitor |
| Chi Mei [Unknown Model: CMN14D5] |
| [General information] | ||
| Monitor Name: | Chi Mei [Unknown Model: CMN14D5] | |
| Monitor Name (Manuf): | N140HCE-EN2 CMN N140HCE-EN2 | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 40, Year: 2016 | |
| Monitor Hardware ID: | Monitor\CMN14D5 | |
| Max. Vertical Size: | 17 cm | |
| Max. Horizontal Size: | 31 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 8 Bits per Primary Color | |
| Digital Video Interface Standard Supported: | DisplayPort | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space (sRGB) Default: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF (Continuous Frequency): | Not Supported | |
| DFP 1.x Compatible: | Yes | |
| [Supported Video Modes] | ||
| 1920 x 1080 | 309 x 173 mm, Pixel Clock 152.84 MHz | |
| Drives |
| (S)ATA/ATAPI Drives |
| KINGSTON RBUSNS8154P3512GJ |
| Host Controller: | Kingston Technology, Device ID: 5008 | |
| Drive Model: | KINGSTON RBUSNS8154P3512GJ | |
| Drive Serial Number: | 50026B7683332769 | |
| Drive Firmware Revision: | E8FK11.C | |
| NVMe Version Supported: | v1.2 | |
| Drive Capacity: | 488,386 MBytes (512 GB) | |
| Drive Capacity [MB]: | 488386 | |
| [Capabilities] | ||
| Volatile Write Cache: | Present | |
| Compare Command: | Not Supported | |
| Write Uncorrectable Command: | Supported | |
| Dataset Management: | Supported | |
| Write Zeroes: | Supported | |
| Save field set to a non-zero value: | Supported | |
| Reservations: | Not Supported | |
| Timestamp: | Not Supported | |
| Autonomous Power State Transitions: | Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| Available Space Below Threshold: | OK | |
| Temperature Exceeded Critical Threshold: | OK | |
| Device Reliablity Degraded: | OK | |
| Media In Read Only Mode: | OK | |
| Volatile Memory Backup Device Failed: | OK | |
| Drive Temperature: | 27 °C | |
| Warning Temperature Threshold: | 84 °C | |
| Critical Temperature Threshold: | 88 °C | |
| Time Above Warning Temperature Threshold: | 0 minutes | |
| Time Above Critical Temperature Threshold: | 0 minutes | |
| Spare Capacity Available: | 100% | |
| Device Health: | 100% | |
| Power Cycles: | 199 | |
| Power On Hours: | 37 hours | |
| Unsafe Shutdowns: | 5 | |
| Media Errors: | 0 | |
| Total Host Reads: | 2004 GBytes | |
| Total Host Writes: | 1148 GBytes | |
| Audio |
| Intel Comet Lake PCH-LP - cAVS (Audio, Voice, Speech) [A0] |
| Audio Adapter: | Intel Comet Lake PCH-LP - cAVS (Audio, Voice, Speech) [A0] | |
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_02C8&SUBSYS_12801462&REV_00 | |
| High Definition Audio Codec: | RealTek ALC298 | |
| Audio Codec Hardware ID: | HDAUDIO\FUNC_01&VEN_10EC&DEV_0298&SUBSYS_00000000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek | |
| Driver Description: | Realtek High Definition Audio | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 6.0.8750.1 | |
| Driver Date: | 09-Jul-2019 | |
| DeviceInstanceId | HDAUDIO\FUNC_01&VEN_10EC&DEV_0298&SUBSYS_14621280&REV_1001\4&3B678F9F&0&0001 | |
| Network |
| Intel Comet Lake PCH-LP - CNVi: WiFi (sku 0) [A0] |
| [General information] | ||
| Network Card: | Intel Comet Lake PCH-LP - CNVi: WiFi (sku 0) [A0] | |
| Vendor Description: | Microsoft | |
| MAC Address: | 7C-B2-7D-DA-38-4C | |
| [Capabilities] | ||
| Maximum Link Speed: | 300 Mbps | |
| Transmit Buffer Size: | 9 Bytes | |
| Receive Buffer Size: | 9 Bytes | |
| Hardware ID: | PCI\VEN_8086&DEV_02F0&SUBSYS_00348086&REV_00 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless-AC 9560 160MHz | |
| Driver Provider: | Intel | |
| Driver Version: | 21.30.3.2 | |
| Driver Date: | 07-Jul-2019 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_02F0&SUBSYS_00348086&REV_00\3&11583659&1&A3 | |
| Location Paths | PCIROOT(0)#PCI(1403) | |
| Ports |
| Serial Ports |
| USB |
| Intel(R) USB 3.1 eXtensible Host Controller - 1.10 (Microsoft) |
| Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : RealTek RTS5129 USB Card Reader |
| [Device Information] | ||
| Device Manufacturer: | RealTek | |
| Product Name: | RealTek RTS5129 USB Card Reader | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Realtek USB 2.0 Card Reader | |
| Hardware ID: | USB\VID_0BDA&PID_0129 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek USB 2.0 Card Reader | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 10.0.18362.31248 | |
| Driver Date: | 25-Apr-2019 | |
| DeviceInstanceId | USB\VID_0BDA&PID_0129\20100201396000000 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(5) | |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port9] : No Device Connected |
| [Port10] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0AAA | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 21.50.0.1 | |
| Driver Date: | 06-Sep-2019 | |
| DeviceInstanceId | USB\VID_8087&PID_0AAA\5&29DCF67C&0&10 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10) | |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | BIF0_9 | |
| Manufacturer Name: | MSI | |
| Serial Number: | ||
| Unique ID: | MSIBIF0_9 | |
| Chemistry: | Lithium Ion | |
| Designed Capacity: | 50008 mWh | |
| Full Charged Capacity: | 50631 mWh | |
| Wear Level: | 0.0 % | |
| [Current Power Status] | ||
| Power Status: | Charging On AC Power | |
| Current Capacity: | 43882 mWh (86.7 %) | |
| Current Voltage: | 16.983 V | |
| Charge Rate: | 11856 mW | |