| HWiNFO64 v5.79-3390 |
| Creation Time | 02.04.2018 11:00 |
| DESKTOP-CAOEDO7 |
| [Current Computer] | ||
| Computer Name: | DESKTOP-CAOEDO7 | |
| Computer Brand Name: | ASUS UX550VE | |
| [Operating System] | ||
| Operating System: | Microsoft Windows 10 Home (x64) Build 16299.309 (1709/RS3) | |
| UEFI Boot: | Present | |
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 4 | |
| Number Of Logical Processors: | 8 | |
| Intel Core i7-7700HQ |
| [General Information] | ||
| Processor Name: | Intel Core i7-7700HQ | |
| Original Processor Frequency: | 2800.0 MHz | |
| Original Processor Frequency [MHz]: | 2800 | |
| CPU ID: | 000906E9 | |
| CPU Brand Name: | Intel(R) Core(TM) i7-7700HQ CPU @ 2.80GHz | |
| CPU Vendor: | GenuineIntel | |
| CPU Stepping: | B0 | |
| CPU Code Name: | Kaby Lake-H | |
| CPU Technology: | 14 nm | |
| CPU S-Spec: | SR32Q | |
| CPU Thermal Design Power (TDP): | 45.0 W | |
| CPU Power Limits (Max): | Power = Unlimited, Time = Unlimited | |
| CPU Power Limit 1 - Long Duration: | (45.00 W) (28.00 sec) [Unlocked] | |
| CPU Power Limit 2 - Short Duration: | (60.00 W) (2.44 ms) [Unlocked] | |
| Configurable TDP Level 1 (Down): | 35.00 W (Unlimited range), 1700 MHz | |
| Current Configurable TDP Level: | Nominal [Unlocked] | |
| CPU Max. Junction Temperature (Tj,max): | 100 °C | |
| CPU Type: | Production Unit | |
| CPU Platform: | BGA1440 | |
| Microcode Update Revision: | 5E | |
| Number of CPU Cores: | 4 | |
| Number of Logical CPUs: | 8 | |
| [Operating Points] | ||
| CPU MFM (LowPower): | 800.0 MHz = 8 x 100.0 MHz | |
| CPU LFM (Minimum): | 800.0 MHz = 8 x 100.0 MHz | |
| CPU HFM (Base): | 2800.0 MHz = 28 x 100.0 MHz | |
| CPU Turbo Max: | 3800.0 MHz = 38 x 100.0 MHz [Unlocked] | |
| Turbo Ratio Limits: | 38x (1c), 36x (2c), 35x (3c), 34x (4c) | |
| CPU Current: | 3492.3 MHz = 35 x 99.8 MHz @ 1.0684 V | |
| LLC/Ring Maximum: | 3500.0 MHz = 35.00 x 100.0 MHz | |
| LLC/Ring Current: | 3193.0 MHz = 32.00 x 99.8 MHz | |
| System Agent Current: | 798.2 MHz = 8.00 x 99.8 MHz | |
| CPU Bus Type: | Intel Direct Media Interface (DMI) v3.0 | |
| Maximum DMI Link Speed: | 8.0 GT/s | |
| Current DMI Link Speed: | 8.0 GT/s | |
| [IA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 38x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | Unlimited | |
| [GT Overclocking (Slice-EUs)] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Supported | |
| Fused Ratio Limit: | 60x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 55.00 A | |
| [CLR (CBo/LLC/Ring) Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | 35x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | Unlimited | |
| [GT Overclocking (Unslice-Fixed Functions)] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Supported | |
| Ratio Overclocking: | Supported | |
| Fused Ratio Limit: | 60x | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 55.00 A | |
| [Uncore/SA Overclocking] | ||
| Voltage Offset: | Supported | |
| Voltage Override: | Not Supported | |
| Ratio Overclocking: | Not Supported | |
| Fused Ratio Limit: | N/A | |
| Voltage Mode: | Interpolative | |
| Voltage Offset: | 0 mV | |
| IccMax: | 11.00 A | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 4 x 32 KBytes, Data: 4 x 32 KBytes | |
| L2 Cache: | Integrated: 4 x 256 KBytes | |
| L3 Cache: | 6 MBytes | |
| Instruction TLB: | 2MB/4MB Pages, Fully associative, 8 entries | |
| Data TLB: | 4 KB Pages, 4-way set associative, 64 entries | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Present | |
| Internal ACPI Support | Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Present | |
| Virtual Machine Extensions (VMX) | Present | |
| Safer Mode Extensions (Intel TXT) | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| AVX Support | Present | |
| Fused Multiply Add (FMA) | Present | |
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Present | |
| CMPXCHG16B Support | Present | |
| MOVBE Instruction | Present | |
| POPCNT Instruction | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present | |
| XGETBV/XSETBV OS Enabled | Present | |
| Float16 Instructions | Present | |
| AES Cryptography Support | Present | |
| Random Number Read Instruction (RDRAND) | Present | |
| Extended xAPIC | Present | |
| MONITOR/MWAIT Support | Present | |
| Thermal Monitor 2 | Present | |
| Enhanced SpeedStep Technology | Present | |
| L1 Context ID | Not Present | |
| Send Task Priority Messages Disabling | Present | |
| Processor Context ID | Present | |
| Direct Cache Access | Not Present | |
| TSC-deadline Timer | Present | |
| Performance/Debug Capability MSR | Present | |
| IA32 Debug Interface Support | Present | |
| 64-Bit Debug Store | Present | |
| CPL Qualified Debug Store | Present | |
| [Extended Feature Flags] | ||
| 64-bit Extensions | Present | |
| RDTSCP and TSC_AUX Support | Present | |
| 1 GB large page support | Present | |
| No Execute | Present | |
| SYSCALL/SYSRET Support | Present | |
| Bit Manipulation Instructions Set 1 | Present | |
| Bit Manipulation Instructions Set 2 | Present | |
| Advanced Vector Extensions 2 (AVX2) | Present | |
| Advanced Vector Extensions 512 (AVX-512) | Not Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Not Present | |
| AVX-512 Doubleword and Quadword Instructions | Not Present | |
| AVX-512 Byte and Word Instructions | Not Present | |
| AVX-512 Vector Length Extensions | Not Present | |
| AVX-512 52-bit Integer FMA Instructions | Not Present | |
| Secure Hash Algorithm (SHA) Extensions | Not Present | |
| Software Guard Extensions (SGX) Support | Present | |
| Supervisor Mode Execution Protection (SMEP) | Present | |
| Supervisor Mode Access Prevention (SMAP) | Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Present | |
| Read/Write FS/GS Base Instructions | Present | |
| Enhanced Performance String Instruction | Present | |
| INVPCID Instruction | Present | |
| RDSEED Instruction | Present | |
| Multi-precision Add Carry Instructions (ADX) | Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Present | |
| CLWB Instructions | Not Present | |
| TSC_THREAD_OFFSET | Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Not Present | |
| FPU Data Pointer updated only on x87 Exceptions | Not Present | |
| Deprecated FPU CS and FPU DS | Present | |
| Intel Processor Trace | Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Not Present | |
| AVX-512 Galois Fields New Instructions | Not Present | |
| AVX-512 Vector AES | Not Present | |
| AVX-512 Vector Neural Network Instructions Word | Not Present | |
| AVX-512 Bit Algorithms | Not Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Not Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Not Present | |
| User-Mode Instruction Prevention | Not Present | |
| Protection Keys for User-mode Pages | Not Present | |
| OS Enabled Protection Keys | Not Present | |
| Total Memory Encryption | Not Present | |
| Read Processor ID | Not Present | |
| SGX Launch Configuration | Not Present | |
| AVX-512 4 x Vector Neural Network Instructions Word Variable Precision | Not Present | |
| AVX-512 4 x Fused Multiply Accumulation Packed Single Precision | Not Present | |
| [Enhanced Features] | ||
| Thermal Monitor 1: | Supported, Enabled | |
| Thermal Monitor 2: | Supported, Enabled | |
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled | |
| Bi-directional PROCHOT#: | Enabled | |
| Extended Auto-HALT State C1E: | Enabled | |
| MLC Streamer Prefetcher | Supported, Enabled | |
| MLC Spatial Prefetcher | Supported, Enabled | |
| DCU Streamer Prefetcher | Supported, Enabled | |
| DCU IP Prefetcher | Supported, Enabled | |
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported | |
| Intel Dynamic FSB Switching: | Not Supported | |
| Intel Turbo Boost Technology: | Supported, Enabled | |
| Programmable Ratio Limits: | Supported, Disabled | |
| Programmable TDC/TDP Limits: | Supported, Disabled | |
| Hardware Duty Cycling: | Supported, Enabled | |
| [CPU SKU Features] | ||
| Display HD Audio: | Supported | |
| DMI x4: | Supported | |
| DRAM ECC: | Not Supported | |
| DMI in Gen2 Mode: | Supported | |
| PEG in Gen2 Mode: | Supported | |
| 1N Mode DDR Timings: | Supported | |
| 2 DIMMs per Channel: | Supported | |
| X2APIC: | Supported | |
| Dual Memory Channel: | Supported | |
| Integrated GPU: | Enabled | |
| DDR Overclocking: | Enabled | |
| Overclocking by DSKU: | Disabled | |
| DDR3L: | Supported | |
| Maximum Memory Size per Channel: | 32 GB (unlimited) | |
| DDR Frequency Support (100 MHz RefClk): | 1300 MHz | |
| Overclocking: | Disabled | |
| SMT: | Supported | |
| Additive Graphics: | Supported | |
| Additive Graphics: | Enabled | |
| PCIe Gen 3: | Supported | |
| DMI Gen 3: | Supported | |
| HDCPD: | Supported | |
| DDR4: | Supported | |
| LPDDR3: | Supported | |
| BCLK OC Limit: | 100 MHz | |
| Maximum Supported LPDDR3 Frequency: | 1067 MHz | |
| Maximum Supported DDR4 Frequency: | 1200 MHz | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 39-bit (512 GBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 80000000-100000000 (2048MB-4096MB) Type: | Uncacheable (UC) | |
| Range 40000000-80000000 (1024MB-2048MB) Type: | Uncacheable (UC) | |
| Range 3C000000-40000000 (960MB-1024MB) Type: | Uncacheable (UC) | |
| Range 3B800000-3C000000 (952MB-960MB) Type: | Uncacheable (UC) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | ASUS UX550VE | |
| [Motherboard] | ||
| Motherboard Model: | ASUS UX550VE | |
| Motherboard Chipset: | Intel HM175 (Skylake PCH-H) | |
| Motherboard Slots: | 2xPCI Express x1, 1xPCI Express x4, 1xPCI Express x8 | |
| PCI Express Version Supported: | v3.0 | |
| USB Version Supported: | v3.0 | |
| [BIOS] | ||
| BIOS Manufacturer: | American Megatrends Inc. | |
| BIOS Date: | 09/12/2017 | |
| BIOS Version: | UX550VE.303 | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | Unknown | |
| ACPI Devices |
| PC/AT Enhanced PS/2 Keyboard (101/102-Key) |
| Device Name: | PC/AT Enhanced PS/2 Keyboard (101/102-Key) | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0000 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 95 | |
| Legacy device |
| Device Name: | Legacy device | |
| [Assigned Resources] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| [Alternative 1] | ||
| Memory Location: | FF000000 - FFFFFFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 1854 - 1857 | |
| [Alternative 1] | ||
| I/O Port: | 1854 - 1857 | |
| Trusted Platform Module 2.0 |
| Device Name: | Trusted Platform Module 2.0 | |
| [Assigned Resources] | ||
| Memory Location: | FED40000 - FED4087F | |
| [Alternative 1] | ||
| Memory Location: | FED40000 - FED4087F | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00B0 - 00B1 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| DMA: | 0 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| Memory Location: | FED00000 - FED003FF | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| Pci Bus |
| Device Name: | Pci Bus | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - FFFFFFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000C4000 - 000C3FFF | |
| Memory Location: | 000CC000 - 000CFFFF | |
| Memory Location: | 000D4000 - 000D3FFF | |
| Memory Location: | 000DC000 - 000DFFFF | |
| Memory Location: | 000E4000 - 000E3FFF | |
| Memory Location: | 000EC000 - 000EFFFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000C0000 - 000C3FFF | |
| Memory Location: | 000C4000 - 000C7FFF | |
| Memory Location: | 000C8000 - 000CBFFF | |
| Memory Location: | 000CC000 - 000CFFFF | |
| Memory Location: | 000D0000 - 000D3FFF | |
| Memory Location: | 000D4000 - 000D7FFF | |
| Memory Location: | 000D8000 - 000DBFFF | |
| Memory Location: | 000DC000 - 000DFFFF | |
| Memory Location: | 000E0000 - 000E3FFF | |
| Memory Location: | 000E4000 - 000E7FFF | |
| Memory Location: | 000E8000 - 000EBFFF | |
| Memory Location: | 000EC000 - 000EFFFF | |
| Memory Location: | 000F0000 - 000FFFFF | |
| Memory Location: | 40000000 - EFFFFFFF | |
| Memory Location: | FD000000 - FE7FFFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0077 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| [Alternative 1] | ||
| Memory Location: | FED10000 - FED17FFF | |
| Memory Location: | FED18000 - FED18FFF | |
| Memory Location: | FED19000 - FED19FFF | |
| Memory Location: | F0000000 - F7FFFFFF | |
| Memory Location: | FED20000 - FED3FFFF | |
| Memory Location: | FED90000 - FED93FFF | |
| Memory Location: | FED45000 - FED8FFFF | |
| Memory Location: | FF000000 - FFFFFFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Memory Location: | EFFE0000 - EFFFFFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 0065 | |
| I/O Port: | 0000 - 006F | |
| I/O Port: | 0092 | |
| I/O Port: | FFFF | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | FFFF | |
| I/O Port: | FFFF | |
| I/O Port: | FFFF | |
| I/O Port: | 1800 - 18FE | |
| I/O Port: | 164E - 164F | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FDAF0000 - FDAFFFFF | |
| [Alternative 1] | ||
| Memory Location: | FDAF0000 - FDAFFFFF | |
| Memory Location: | FDAE0000 - FDAEFFFF | |
| Memory Location: | FDAC0000 - FDACFFFF | |
| IRQ: | 14 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | FF00 - FFFE | |
| [Alternative 1] | ||
| I/O Port: | FF00 - FFFE | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 0800 - 087F | |
| [Alternative 1] | ||
| I/O Port: | 0800 - 087F | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FD000000 - FDABFFFF | |
| Memory Location: | FE036000 - FE03BFFF | |
| [Alternative 1] | ||
| Memory Location: | FD000000 - FDABFFFF | |
| Memory Location: | FDAD0000 - FDADFFFF | |
| Memory Location: | FDB00000 - FDFFFFFF | |
| Memory Location: | FE000000 - FE01FFFF | |
| Memory Location: | FE036000 - FE03BFFF | |
| Memory Location: | FE03D000 - FE3FFFFF | |
| Memory Location: | FE410000 - FE7FFFFF | |
| Numeric data processor |
| Device Name: | Numeric data processor | |
| [Assigned Resources] | ||
| I/O Port: | 00F0 | |
| [Alternative 1] | ||
| I/O Port: | 00F0 | |
| IRQ: | 13 | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0062 | |
| [Alternative 1] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| SMBIOS DMI |
| BIOS |
| BIOS Vendor: | American Megatrends Inc. | |
| BIOS Version: | UX550VE.303 | |
| BIOS Release Date: | 09/12/2017 | |
| BIOS Start Segment: | F000 | |
| BIOS Size: | 8192 KBytes | |
| System BIOS Version: | 5.12 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Not Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Not Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Present | |
| BIOS Boot Specification Support: | Present | |
| Function key-initiated Network Service Boot Support: | Not Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | ASUSTeK COMPUTER INC. | |
| Product Name: | UX550VE | |
| Product Version: | 1.0 | |
| Product Serial Number: | HAN0CX106905419 | |
| UUID: | {304E4148-5843-3031-3639-303534313941} | |
| SKU Number: | ||
| Family: | UX |
| Mainboard |
| Mainboard Manufacturer: | ASUSTeK COMPUTER INC. | |
| Mainboard Name: | UX550VE | |
| Mainboard Version: | 1.0 | |
| Mainboard Serial Number: | QCCBKH0KC74100004 | |
| Asset Tag: | ATN12345678901234567 | |
| Location in chassis: | MIDDLE |
| System Enclosure |
| Manufacturer: | ASUSTeK COMPUTER INC. | |
| Case Type: | Notebook | |
| Version: | 1.0 | |
| Serial Number: | HAN0CX106905419 | |
| Asset Tag Number: | No Asset Tag |
| System Boot Information |
| Boot Status: | No error occured |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 256 KBytes | |
| Installed Cache Size: | 256 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 Cache |
| Socket Designation: | L2 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 1024 KBytes | |
| Installed Cache Size: | 1024 KBytes | |
| Cache Associativity: | 4-way Set-Associative |
| L3 Cache |
| Socket Designation: | L3 Cache | |
| Cache State: | Enabled | |
| Cache Type: | Internal, Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 6144 KBytes | |
| Installed Cache Size: | 6144 KBytes | |
| Cache Associativity: | 12-way Set-Associative |
| Processor |
| Processor Manufacturer: | Intel(R) Corporation | |
| Processor Version: | Intel(R) Core(TM) i7-7700HQ CPU @ 2.80GHz | |
| External Clock: | 100 MHz | |
| Maximum Clock Supported: | 8300 MHz | |
| Current Clock: | 2700 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Voltage: | 0.9 V | |
| Processor Upgrade: | Unknown (1) | |
| Socket Designation: | U3E1 |
| On Board Device |
| Device Description: | VGA | |
| Device Type: | Video Adapter | |
| Device Status: | Enabled | |
| Device Description: | GLAN | |
| Device Type: | Ethernet Adapter | |
| Device Status: | Enabled | |
| Device Description: | WLAN | |
| Device Type: | Ethernet Adapter | |
| Device Status: | Enabled | |
| Device Description: | Audio CODEC | |
| Device Type: | Audio Device | |
| Device Status: | Enabled | |
| Device Description: | SATA Controller | |
| Device Type: | SATA Controller | |
| Device Status: | Enabled | |
| Device Description: | USB 2.0 Controller | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| Device Description: | USB 3.0 Controller | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| Device Description: | SMBus Controller | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| Device Description: | Card Reader | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| Device Description: | Cmos Camera | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| Device Description: | Bluetooth | |
| Device Type: | Unknown | |
| Device Status: | Enabled | |
| OEM Strings |
| kPJ-+7X7+EfTa | ||
| jTyRUBSNi7Ydf | ||
| fCrOzJ6x1i-eh | ||
| 90NB0ES2-M01690 |
| System Configuration Options |
| SMI:00B26C | ||
| DSN: | ||
| DSN: | ||
| DSN: |
| Intel AMT |
| Intel AMT Support: | Not Supported |
| Intel vPro |
| CPU VT-x Support: | Supported | |
| CPU VT-x Status: | Enabled | |
| CPU VT-x2 Support: | Not Supported | |
| CPU VT-x2 Status: | Disabled | |
| CPU TXT Support: | Not Supported | |
| CPU TXT Status: | Disabled | |
| CPU VMX Status: | Enabled | |
| CPU SMX Status: | Disabled | |
| Intel ME Status: | Enabled | |
| Intel OST Firmware Support: | Not Supported | |
| Intel ASF Firmware Support: | Not Supported | |
| Intel AMT Pro Firmware Support: | Not Supported | |
| Intel AMT Basic Firmware Support: | Not Supported | |
| Intel TPM Firmware Support: | Not Supported | |
| Intel Castle Peak Support: | Not Supported | |
| Intel WoX Support: | Not Supported | |
| Intel Virtualization Engine Support: | Not Supported | |
| Intel Anti-Theft Technology Support: | Not Supported | |
| TPM On-board: | Not Supported | |
| Intel Anti-Theft Technology Enrolled: | Not Supported | |
| Intel ME Version: | v11.6, Build 1136, Hotfix 0 | |
| BIOS VT-x Support: | Not Supported | |
| BIOS VT-d Support: | Supported | |
| BIOS TXT Support: | Not Supported | |
| BIOS TPM Support: | Not Supported | |
| BIOS ME Support: | Not Supported | |
| BIOS VA Extensions Support: | Supported | |
| Intel AT PBA For Recovery Support: | Not Supported | |
| Intel AT WWAN Support: | Not Supported |
| Firmware Version Information |
| Reference Code - CPU | 1.6.0.0 | |
| uCode Version | 0.0.0.94 | |
| TXT ACM version | 0.5.0.0 |
| Firmware Version Information |
| Reference Code - ME 11.0 | 1.6.0.0 | |
| MEBx version | 0.0.0.0 | |
| ME Firmware Version | Consumer SKU |
| Firmware Version Information |
| Reference Code - SKL PCH | 1.6.0.0 | |
| PCH-CRID Status | Disabled | |
| PCH-CRID Original Value | 0x31 | |
| PCH-CRID New Value | 0x31 | |
| OPROM - RST - RAID | ||
| SKL PCH H Bx Hsio Version | 62.0.0.0 | |
| SKL PCH H Dx Hsio Version | 52.0.0.0 | |
| KBL PCH H Ax Hsio Version | 11.0.0.0 | |
| SKL PCH LP Bx Hsio Version | 62.0.0.0 | |
| SKL PCH LP Cx Hsio Version | 52.0.0.0 |
| Firmware Version Information |
| Reference Code - SA - System Agent | 1.6.0.0 | |
| Reference Code - MRC | 1.6.0.2 | |
| SA - PCIe Version | 1.6.0.0 | |
| SA-CRID Status | Disabled | |
| SA-CRID Original Value | 0x5 | |
| SA-CRID New Value | 0x5 | |
| OPROM - VBIOS |
| Firmware Version Information |
| Lan Phy Version | 0.0.0.0 | |
| Sensor Firmware Version | ||
| Debug Mode Status | Disabled | |
| Performance Mode Status | Disabled | |
| Debug Use USB(Disabled:Serial) | Disabled | |
| ICC Overclocking Version | 0.0.0.0 | |
| UNDI Version | ||
| EC FW Version | 0.0 | |
| GOP Version | 0.9.0.4195 | |
| BIOS Guard Version | 2.0.0.0 | |
| Base EC FW Version | ||
| EC-EC Protocol Version | ||
| Royal Park Version | BP1.3.4.0_RP01 | |
| Platform Version | 0.7.3.0 |
| Group Associations |
| BIOS Language |
| en|US|iso8859-1 <Active> |
| Group Associations |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 64 GBytes | |
| Memory Devices: | 4 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | ChannelA-DIMM0 | |
| Bank Locator: | BANK 0 | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2400 MHz | |
| Manufacturer: | Micron | |
| Serial Number: | 00000000 | |
| Part Number: | 4ATF51264HZ-2G3B1 | |
| Asset Tag: | 9876543210 |
| Memory Device |
| Total Width: | 0 bits | |
| Data Width: | 0 bits | |
| Device Size: | 0 MBytes | |
| Device Form Factor: | Unknown | |
| Device Locator: | ChannelA-DIMM1 | |
| Bank Locator: | BANK 1 | |
| Device Type: | Unknown | |
| Device Type Detail: | ||
| Manufacturer: | Unknown | |
| Serial Number: | Unknown | |
| Part Number: | Unknown | |
| Asset Tag: | Unknown |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | ChannelB-DIMM0 | |
| Bank Locator: | BANK 2 | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2400 MHz | |
| Manufacturer: | Micron | |
| Serial Number: | 00000000 | |
| Part Number: | 4ATF51264HZ-2G3B1 | |
| Asset Tag: | 9876543210 |
| Memory Device |
| Total Width: | 0 bits | |
| Data Width: | 0 bits | |
| Device Size: | 0 MBytes | |
| Device Form Factor: | Unknown | |
| Device Locator: | ChannelB-DIMM1 | |
| Bank Locator: | BANK 3 | |
| Device Type: | Unknown | |
| Device Type Detail: | ||
| Manufacturer: | Unknown | |
| Serial Number: | Unknown | |
| Part Number: | Unknown | |
| Asset Tag: | Unknown |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Width: | 2 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 003FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | 1 | |
| Interleave Data Depth: | 2 |
| Memory Device Mapped Address |
| Starting Address: | 00400000 | |
| Ending Address: | 007FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | 2 | |
| Interleave Data Depth: | 2 |
| Intel ME |
| [ME Host Status] | ||
| ME Current Working State: | Normal | |
| Manufacturing Mode: | Not Active | |
| ME Current Operation Mode: | Normal | |
| Boot Guard Status: | Enabled | |
| Boot Guard Verified Boot Policy: | Disabled | |
| Boot Guard Measured Boot Policy: | Disabled | |
| [Intel Manageability Engine Features] | ||
| Intel ME Version: | 11.6, Build 1136 | |
| Intel ME Recovery Image Version: | 11.6, Build 1136 | |
| Intel ME FITC Version: | 11.6, Build 1136 | |
| [ME Firmware Capabilities] | ||
| Full Network Manageability: | Not Capable | |
| Standard Network Manageability: | Not Capable | |
| Manageability (AMT): | Not Capable | |
| Small Business Advantage: | Not Capable | |
| Intel Integrated Touch: | Not Capable | |
| Intel Anti-Theft: | Not Capable | |
| Capability Licensing Service: | Capable | |
| Virtualization Engine: | Not Capable | |
| Intel Sensor Hub (ISH): | Not Capable | |
| ICC Over Clocking: | Not Capable | |
| Protected Audio Video Path (PAVP): | Capable | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Not Capable | |
| IPV6: | Not Capable | |
| KVM Remote Control: | Not Capable | |
| Outbreak Containment Heuristic (OCH): | Not Capable | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Not Capable | |
| Wireless LAN (WLAN): | Not Capable | |
| Platform Trust Technology (PTT): | Capable | |
| Near Field Communication (NFC): | Not Capable | |
| [ME Firmware Feature State] | ||
| Full Network Manageability: | Disabled | |
| Standard Network Manageability: | Disabled | |
| Manageability (AMT): | Disabled | |
| Small Business Advantage: | Not Capable | |
| MEI3: | Not Capable | |
| Intel Anti-Theft: | Disabled | |
| Capability Licensing Service: | Enabled | |
| Virtualization Engine: | Disabled | |
| Intel Sensor Hub (ISH): | Disabled | |
| ICC Over Clocking: | Disabled | |
| Protected Audio Video Path (PAVP): | Enabled | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Disabled | |
| IPV6: | Disabled | |
| KVM Remote Control: | Disabled | |
| Outbreak Containment Heuristic (OCH): | Disabled | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Disabled | |
| Wireless LAN (WLAN): | Disabled | |
| Platform Trust Technology (PTT): | Enabled | |
| Near Field Communication (NFC): | Disabled | |
| [ME Firmware Platform Type] | ||
| Platform Target Usage Type: | Mobile | |
| SKU: | Regular SKU | |
| ME Firmware Image Type: | Consumer SKU Firmware | |
| Platform Brand: | None | |
| Host ME Region Flash Protection Override (HMRFPO) Status: | Locked | |
| Memory |
| [General information] | ||
| Total Memory Size: | 8073 MBytes | |
| Total Memory Size [MB]: | 8073 | |
| [Current Performance Settings] | ||
| Maximum Supported Memory Clock: | 1300.0 MHz | |
| Current Memory Clock: | 1197.4 MHz | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 17-17-17-39 | |
| Memory Runs At: | Dual-Channel | |
| Command Rate: | 2T | |
| Read to Read Delay (tRD_RD) Same Rank: | 6T | |
| Read to Read Delay (tRD_RD) Different Rank: | 4T | |
| Read to Read Delay (tRD_RD) Different DIMM: | 7T | |
| Write to Write Delay (tWR_WR) Same Rank: | 6T | |
| Write to Write Delay (tWR_WR) Different Rank: | 4T | |
| Write to Write Delay (tWR_WR) Different DIMM: | 7T | |
| Read to Write Delay (tRD_WR) Same Rank: | 9T | |
| Read to Write Delay (tRD_WR) Different Rank: | 9T | |
| Read to Write Delay (tRD_WR) Different DIMM: | 11T | |
| Write to Read Delay (tWR_RD) Same Rank (tWTR): | 30T | |
| Write to Read Delay (tWR_RD) Different Rank: | 24T | |
| Write to Read Delay (tWR_RD) Different DIMM: | 6T | |
| RAS# to RAS# Delay (tRRD): | 8T | |
| Refresh Cycle Time (tRFC): | 420T | |
| Four Activate Window (tFAW): | 36T | |
| Bus |
| PCI Bus #0 |
| Intel Kaby Lake-H - Host Bridge/DRAM Controller [B0] |
| [General Information] | ||
| Device Name: | Intel Kaby Lake-H - Host Bridge/DRAM Controller [B0] | |
| Original Device Name: | Intel Kaby Lake-H - Host Bridge/DRAM Controller [B0] | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 5 [B0] | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_5910&SUBSYS_19701043&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) Xeon(R) E3 - 1200 v6/7th Gen Intel(R) Core(TM) Host Bridge/DRAM Registers - 5910 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_5910&SUBSYS_19701043&REV_05\3&11583659&1&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| Intel Skylake/Kaby Lake/Coffee Lake - PCI Express x16 Controller |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake/Coffee Lake - PCI Express x16 Controller | |
| Original Device Name: | Intel Skylake/Kaby Lake/Coffee Lake - PCI Express x16 Controller | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 5 | |
| PCI Address (Bus:Device:Function) Number: | 0:1:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_1901&SUBSYS_00000000&REV_05 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 8x | |
| Current Link Width: | 8x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 75.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 128 - 256 ns | |
| L1 Exit Latency: | 4 - 8 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 256 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) Xeon(R) E3 - 1200/1500 v5/6th Gen Intel(R) Core(TM) PCIe Controller (x16) - 1901 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_1901&SUBSYS_19701043&REV_05\3&11583659&1&08 | |
| Location Paths | PCIROOT(0)#PCI(0100) | |
| PCI Express x8 Bus #1 |
| NVIDIA GeForce GTX 1050 Ti (GP107M) |
| [General Information] | ||
| Device Name: | NVIDIA GeForce GTX 1050 Ti (GP107M) | |
| Original Device Name: | NVIDIA GeForce GTX 1050 Ti (GP107M) | |
| Device Class: | 3D Adapter | |
| Revision ID: | A1 | |
| PCI Address (Bus:Device:Function) Number: | 1:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_10DE&DEV_1C8C&SUBSYS_19701043&REV_A1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 8x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | 256 - 512 ns | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 256 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | EC000000 | |
| Memory Base Address 1 | A0000000 | |
| Memory Base Address 3 | B0000000 | |
| I/O Base Address 5 | 0 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | NVIDIA | |
| Driver Description: | NVIDIA GeForce GTX 1050 Ti | |
| Driver Provider: | NVIDIA | |
| Driver Version: | 21.21.13.7620 (GeForce 376.20) | |
| Driver Date: | 02-Dec-2016 | |
| DeviceInstanceId | PCI\VEN_10DE&DEV_1C8C&SUBSYS_19701043&REV_A1\4&33957B1D&0&0008 | |
| Location Paths | PCIROOT(0)#PCI(0100)#PCI(0000) | |
| Intel HD Graphics 630 (Kaby Lake-H GT2) - Integrated Graphics Controller |
| [General Information] | ||
| Device Name: | Intel HD Graphics 630 (Kaby Lake-H GT2) - Integrated Graphics Controller | |
| Original Device Name: | Intel HD Graphics 630 (Kaby Lake-H GT2) - Integrated Graphics Controller | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | 4 | |
| PCI Address (Bus:Device:Function) Number: | 0:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_591B&SUBSYS_19701043&REV_04 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Current Link Width: | Not negotiated | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | EB000000 | |
| Memory Base Address 2 | 40000000 | |
| I/O Base Address 4 | F000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) HD Graphics 630 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 22.20.16.4749 | |
| Driver Date: | 24-Jul-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_591B&SUBSYS_19701043&REV_04\3&11583659&1&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Intel Skylake/Kaby Lake/Coffee Lake/Whiskey Lake - Dynamic Platform & Thermal Framework Processor Participant |
| [General Information] | ||
| Device Name: | Intel Skylake/Kaby Lake/Coffee Lake/Whiskey Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| Original Device Name: | Intel Skylake/Kaby Lake/Coffee Lake/Whiskey Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 5 | |
| PCI Address (Bus:Device:Function) Number: | 0:4:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_1903&SUBSYS_19701043&REV_05 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE028000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Dynamic Platform and Thermal Framework Processor Participant | |
| Driver Provider: | Intel | |
| Driver Version: | 8.2.11000.2996 | |
| Driver Date: | 10-Aug-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_1903&SUBSYS_19701043&REV_05\3&11583659&1&20 | |
| Location Paths | PCIROOT(0)#PCI(0400) | |
| Intel Skylake PCH-H - USB 3.0 xHCI Controller [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - USB 3.0 xHCI Controller [D1] | |
| Original Device Name: | Intel Skylake PCH-H - USB 3.0 xHCI Controller [D1] | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A12F&SUBSYS_201F1043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | ED310000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 3.0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI | |
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.251 | |
| Driver Date: | 21-Feb-2018 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A12F&SUBSYS_201F1043&REV_31\3&11583659&1&A0 | |
| Location Paths | PCIROOT(0)#PCI(1400) | |
| USB Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : Složené zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | TwinHan Technology | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Složené zařízení USB | |
| Hardware ID: | USB\VID_13D3&PID_5755 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní hostitelský řadič USB) | |
| Driver Description: | Složené zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_13D3&PID_5755\0001 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(4) | |
| [Port5] : No Device Connected |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port9] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0A2B | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 19.11.1639.649 | |
| Driver Date: | 29-Sep-2016 | |
| DeviceInstanceId | USB\VID_8087&PID_0A2B\5&350590A7&0&9 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(9) | |
| [Port10] : ELAN WBF Fingerprint Sensor |
| [Device Information] | ||
| Device Manufacturer: | Elan Microelectronics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | ELAN WBF Fingerprint Sensor | |
| Hardware ID: | USB\VID_04F3&PID_0903 | |
| [Driver Information] | ||
| Driver Manufacturer: | ELAN | |
| Driver Description: | ELAN WBF Fingerprint Sensor | |
| Driver Provider: | ELAN Finger Print | |
| Driver Version: | 1.5.12.1101 | |
| Driver Date: | 21-Apr-2017 | |
| DeviceInstanceId | USB\VID_04F3&PID_0903\5&350590A7&0&10 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10) | |
| [Port11] : Vstupní zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | Elan Microelectronics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Vstupní zařízení USB | |
| Hardware ID: | USB\VID_04F3&PID_2544 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Vstupní zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.251 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_04F3&PID_2544\5&350590A7&0&11 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(11) | |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| [Port19] : No Device Connected |
| [Port20] : No Device Connected |
| [Port21] : No Device Connected |
| [Port22] : No Device Connected |
| [Port23] : No Device Connected |
| [Port24] : No Device Connected |
| Intel Skylake PCH-H - Thermal Subsystem [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - Thermal Subsystem [D1] | |
| Original Device Name: | Intel Skylake PCH-H - Thermal Subsystem [D1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:20:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A131&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTC# | |
| Memory Base Address 0 | ED338000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family Thermal subsystem - A131 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 01-Jan-1970 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A131&SUBSYS_19701043&REV_31\3&11583659&1&A2 | |
| Location Paths | PCIROOT(0)#PCI(1402) | |
| Intel Skylake PCH-H - LPSS: I2C Controller #0 [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - LPSS: I2C Controller #0 [D1] | |
| Original Device Name: | Intel Skylake PCH-H - LPSS: I2C Controller #0 [D1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:21:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A160&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE03C000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Hostitelský řadič Intel(R) Serial IO I2C – A160 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.1724.1 | |
| Driver Date: | 14-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A160&SUBSYS_19701043&REV_31\3&11583659&1&A8 | |
| Location Paths | PCIROOT(0)#PCI(1500) | |
| Intel Skylake PCH-H - LPSS: I2C Controller #1 [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - LPSS: I2C Controller #1 [D1] | |
| Original Device Name: | Intel Skylake PCH-H - LPSS: I2C Controller #1 [D1] | |
| Device Class: | Unknown Data Acquisition/Signal Processing Controller | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:21:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A161&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | IRQ17 | |
| Interrupt Pin: | INTB# | |
| Memory Base Address 0 | FE035000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Hostitelský řadič Intel(R) Serial IO I2C – A161 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.1724.1 | |
| Driver Date: | 14-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A161&SUBSYS_19701043&REV_31\3&11583659&1&A9 | |
| Location Paths | PCIROOT(0)#PCI(1501) | |
| Intel Skylake PCH-H - CSME: HECI #1 [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - CSME: HECI #1 [D1] | |
| Original Device Name: | Intel Skylake PCH-H - CSME: HECI #1 [D1] | |
| Device Class: | Unknown Communication Device | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:22:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A13A&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE034000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Management Engine Interface | |
| Driver Provider: | Intel | |
| Driver Version: | 11.6.0.1032 | |
| Driver Date: | 15-Sep-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A13A&SUBSYS_19701043&REV_31\3&11583659&1&B0 | |
| Location Paths | PCIROOT(0)#PCI(1600) | |
| Intel Skylake PCH-H MB - SATA AHCI Controller [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H MB - SATA AHCI Controller [D1] | |
| Original Device Name: | Intel Skylake PCH-H MB - SATA AHCI Controller [D1] | |
| Device Class: | SATA AHCI Controller | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:23:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A103&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | ED330000 | |
| Memory Base Address 1 | ED334000 | |
| I/O Base Address 2 | F090 | |
| I/O Base Address 3 | F080 | |
| I/O Base Address 4 | F060 | |
| Memory Base Address 5 | ED333000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [SATA Host Controller] | ||
| Interface Speed Supported: | Gen3 6.0 Gbps | |
| Number Of Ports: | 1 | |
| External SATA Support: | Not Capable | |
| Aggressive Link Power Management: | Capable | |
| Staggered Spin-up: | Not Capable | |
| Mechanical Presence Switch: | Not Capable | |
| Command Queue Acceleration: | Capable | |
| 64-bit Addressing: | Capable | |
| AHCI Status: | Enabled | |
| AHCI Version: | 1.31 | |
| Ports Implemented: | 0 | |
| [SATA Port#0] | ||
| Port Status: | Device Present, Phy communication not established | |
| Current Interface Speed: | Gen3 6.0 Gbps | |
| External SATA Port: | Not Capable | |
| Hot Plug: | Not Capable | |
| Device Type: | SATA | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) 100 Series/C230 Chipset Family SATA AHCI Controller | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 15.2.5.1035 | |
| Driver Date: | 17-Nov-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A103&SUBSYS_19701043&REV_31\3&11583659&1&B8 | |
| Location Paths | PCIROOT(0)#PCI(1700) | |
| Intel Skylake PCH-H - PCI Express Root Port #1 [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - PCI Express Root Port #1 [D1] | |
| Original Device Name: | Intel Skylake PCH-H - PCI Express Root Port #1 [D1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A110&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family PCI Express Root Port #1 - A110 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A110&SUBSYS_19701043&REV_F1\3&11583659&1&E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00) | |
| PCI Express x1 Bus #2 |
| Alcor Micro PCI-E Card Reader |
| [General Information] | ||
| Device Name: | Alcor Micro PCI-E Card Reader | |
| Original Device Name: | Alcor Micro PCI-E Card Reader | |
| Device Class: | Unknown | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 2:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1AEA&DEV_6621&SUBSYS_66211AEA&REV_00 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 2 - 4 us | |
| L1 Exit Latency: | >64 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | ED2FFF00 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Alcor Micro, Corp. | |
| Driver Description: | Alcor Micro PCIE Card Reader | |
| Driver Provider: | Generic | |
| Driver Version: | 1.14.7.1110 | |
| Driver Date: | 13-May-2016 | |
| DeviceInstanceId | PCI\VEN_1AEA&DEV_6621&SUBSYS_66211AEA&REV_00\4&2C3B47C6&0&00E0 | |
| Location Paths | PCIROOT(0)#PCI(1C00)#PCI(0000) | |
| Intel Skylake PCH-H - PCI Express Root Port #3 [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - PCI Express Root Port #3 [D1] | |
| Original Device Name: | Intel Skylake PCH-H - PCI Express Root Port #3 [D1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A112&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTC# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family PCI Express Root Port #3 - A112 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A112&SUBSYS_19701043&REV_F1\3&11583659&1&E2 | |
| Location Paths | PCIROOT(0)#PCI(1C02) | |
| PCI Express x1 Bus #3 |
| Intel 8265 Tri-Band WiFi (Oak Peak) Network Adapter |
| [General Information] | ||
| Device Name: | Intel 8265 Tri-Band WiFi (Oak Peak) Network Adapter | |
| Original Device Name: | Intel 8265 Tri-Band WiFi (Oak Peak) Network Adapter | |
| Device Class: | Unknown Network Adapter | |
| Revision ID: | 78 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_24FD&SUBSYS_00108086&REV_78 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 2 - 4 us | |
| L1 Exit Latency: | 4 - 8 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | ED1FE000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Dual Band Wireless-AC 8265 | |
| Driver Provider: | Microsoft | |
| Driver Version: | 19.50.1.6 | |
| Driver Date: | 01-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_24FD&SUBSYS_00108086&REV_78\4&3A3E1327&0&00E2 | |
| Location Paths | PCIROOT(0)#PCI(1C02)#PCI(0000) | |
| Intel Skylake PCH-H - PCI Express Root Port #5 [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - PCI Express Root Port #5 [D1] | |
| Original Device Name: | Intel Skylake PCH-H - PCI Express Root Port #5 [D1] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | F1 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:28:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A114&SUBSYS_00000000&REV_F1 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 4x | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Capable | |
| Hot-Plug Surprise: | Capable | |
| Slot Power Limit: | 25.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | >4 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family PCI Express Root Port #5 - A114 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A114&SUBSYS_19701043&REV_F1\3&11583659&1&E4 | |
| Location Paths | PCIROOT(0)#PCI(1C04) | |
| PCI Express x4 Bus #4 |
| Intel HM175 PCH - LPC/eSPI Controller [D1] |
| [General Information] | ||
| Device Name: | Intel HM175 PCH - LPC/eSPI Controller [D1] | |
| Original Device Name: | Intel HM175 PCH - LPC/eSPI Controller [D1] | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A152&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family LPC Controller (HM175) - A152 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A152&SUBSYS_19701043&REV_31\3&11583659&1&F8 | |
| Location Paths | PCIROOT(0)#PCI(1F00) | |
| Intel Skylake PCH-H - Power Management Controller [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - Power Management Controller [D1] | |
| Original Device Name: | Intel Skylake PCH-H - Power Management Controller [D1] | |
| Device Class: | Unknown Memory | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A121&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | ED32C000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family PMC - A121 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A121&SUBSYS_19701043&REV_31\3&11583659&1&FA | |
| Location Paths | PCIROOT(0)#PCI(1F02) | |
| Intel Skylake PCH-H - High Definition Audio Controller |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - High Definition Audio Controller | |
| Original Device Name: | Intel Skylake PCH-H - High Definition Audio Controller | |
| Device Class: | Mixed mode device | |
| Revision ID: | 31 | |
| PCI Address (Bus:Device:Function) Number: | 0:31:3 | |
| PCI Latency Timer: | 32 | |
| Hardware ID: | PCI\VEN_8086&DEV_A171&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | FE030000 | |
| Memory Base Address 4 | FE400000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | Řadič High Definition Audio | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 28-Sep-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A171&SUBSYS_19701043&REV_31\3&11583659&1&FB | |
| Location Paths | PCIROOT(0)#PCI(1F03) | |
| Intel Skylake PCH-H - SMBus Host Controller [D1] |
| [General Information] | ||
| Device Name: | Intel Skylake PCH-H - SMBus Host Controller [D1] | |
| Original Device Name: | Intel Skylake PCH-H - SMBus Host Controller [D1] | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 31 [D1] | |
| PCI Address (Bus:Device:Function) Number: | 0:31:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A123&SUBSYS_19701043&REV_31 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | ED332000 | |
| I/O Base Address 4 | F040 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) 100 Series/C230 Series Chipset Family SMBus - A123 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.1.38 | |
| Driver Date: | 03-Oct-2016 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A123&SUBSYS_19701043&REV_31\3&11583659&1&FC | |
| Location Paths | PCIROOT(0)#PCI(1F04) | |
| Video Adapter |
| Intel HD Graphics 630 |
| [Video chipset] | ||
| Video Chipset: | Intel HD Graphics 630 | |
| Video Chipset Codename: | Kaby Lake-H GT2 | |
| Video Memory: | 1024 MBytes | |
| [Video Card] | ||
| Video Card: | Intel HD Graphics 630 (Kaby Lake-H GT2) - Integrated Graphics Controller [AsusTek] | |
| Video Bus: | Integrated | |
| Video RAMDAC: | Internal | |
| Video BIOS Version: | Unknown | |
| [Performance] | ||
| Memory Clock: | 1197.0 MHz | |
| Hardware ID: | PCI\VEN_8086&DEV_591B&SUBSYS_19701043&REV_04 | |
| PCI Location (Bus:Dev:Fnc): | 0:02:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) HD Graphics 630 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 22.20.16.4749 | |
| Driver Date: | 24-Jul-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_591B&SUBSYS_19701043&REV_04\3&11583659&1&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| NVIDIA GeForce GTX 1050 Ti |
| [Video chipset] | ||
| Video Chipset: | NVIDIA GeForce GTX 1050 Ti | |
| Video Chipset Codename: | GP107M | |
| Video Memory: | 4096 MBytes of GDDR5 SDRAM [Micron] | |
| [Video Card] | ||
| Video Card: | NVIDIA GeForce GTX 1050 Ti (GP107M) [AsusTek] | |
| Video Bus: | PCIe v3.0 x16 (8.0 GT/s) @ x8 (2.5 GT/s) | |
| Video BIOS Version: | 86.07.3c.00.65 | |
| Video Chipset Revision: | A1 | |
| [Performance] | ||
| Processor Clock: | 607.5 MHz | |
| Video Unit Clock: | 556.5 MHz | |
| Memory Clock: | 202.5 MHz (Effective 810.0 MHz) | |
| Memory Bus Width: | 128-bit | |
| Number Of ROPs: | 32 | |
| Number Of Unified Shaders: | 768 | |
| Number Of TMUs (Texture Mapping Units): | 48 | |
| NVIDIA SLI Capability: | Capable | |
| Hardware ID: | PCI\VEN_10DE&DEV_1C8C&SUBSYS_19701043&REV_A1 | |
| PCI Location (Bus:Dev:Fnc): | 1:00:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | NVIDIA | |
| Driver Description: | NVIDIA GeForce GTX 1050 Ti | |
| Driver Provider: | NVIDIA | |
| Driver Version: | 21.21.13.7620 (GeForce 376.20) | |
| Driver Date: | 02-Dec-2016 | |
| DeviceInstanceId | PCI\VEN_10DE&DEV_1C8C&SUBSYS_19701043&REV_A1\4&33957B1D&0&0008 | |
| Location Paths | PCIROOT(0)#PCI(0100)#PCI(0000) | |
| Monitor |
| Chi Mei [Unknown Model: CMN15E8] |
| [General information] | ||
| Monitor Name: | Chi Mei [Unknown Model: CMN15E8] | |
| Monitor Name (Manuf): | N156HCE-EN1 CMN N156HCE-EN1 | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 33, Year: 2016 | |
| Monitor Hardware ID: | Monitor\CMN15E8 | |
| Max. Vertical Size: | 19 cm | |
| Max. Horizontal Size: | 34 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 8 Bits per Primary Color | |
| Digital Video Interface Standard Supported: | DisplayPort | |
| Display Type: | Monochrome/grey scale | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF Supported: | Not Supported | |
| DFP 1.x Compatible: | Yes | |
| [Supported Video Modes] | ||
| 1920 x 1080 | 344 x 193 mm, Pixel Clock 152.84 MHz | |
| Drives |
| Floppy Drives |
| Unknown |
| Unknown |
| (S)ATA/ATAPI Drives |
| Micron_1100_MTFDDAV512TBN |
| [General Information] | ||
| Drive Controller: | Serial ATA 6Gb/s @ 6Gb/s | |
| Drive Model: | Micron_1100_MTFDDAV512TBN | |
| Drive Revision: | M0MA020 | |
| Drive Serial Number: | 170715D16FEE | |
| World Wide Name: | 500A75115D16FEE | |
| Drive Capacity: | 488,386 MBytes (512 GB) | |
| Drive Capacity [MB]: | 488386 | |
| Media Rotation Rate: | SSD Drive (Non-rotating) | |
| Nominal Form Factor: | <1.8" | |
| ATA Major Version Supported: | ATA/ATAPI-5, ATA/ATAPI-6, ATA/ATAPI-7, ATA8-ACS, ACS-2, ACS-3 | |
| ATA Minor Version Supported: | ACS-3 Revision 5 | |
| ATA Transport Version Supported: | SATA 3.2 | |
| [Drive Geometry] | ||
| Number of Cylinders: | 16383 | |
| Number of Heads: | 16 | |
| Sectors Per Track: | 63 | |
| Number of Sectors: | 16514064 | |
| Total 32-bit LBA Sectors: | 268435455 | |
| Total 48-bit LBA Sectors: | 1000215216 | |
| Logical Sector Size: | 512 Bytes | |
| Cache Buffer Size: | N/A | |
| [Transfer Modes] | ||
| Sectors Per Interrupt: | Total: 16, Active: 16 | |
| Max. PIO Transfer Mode: | 4 | |
| Multiword DMA Mode: | Total: 2, Active: - | |
| Singleword DMA Mode: | Total: -, Active: - | |
| Ultra-DMA Mode: | Total: 6 (ATA-133), Active: 6 (ATA-133) | |
| Max. Multiword DMA Transfer Rate: | 16.7 MBytes/s | |
| Max. PIO with IORDY Transfer Rate: | 16.7 MBytes/s | |
| Max. PIO w/o IORDY Transfer Rate: | 16.7 MBytes/s | |
| Native Command Queuing: | Supported, Max. Depth: 32 | |
| TRIM Command: | Supported (Deterministic Read After TRIM, Words = 0) | |
| [Device flags] | ||
| Fixed Drive: | Present | |
| Removable Drive: | Not Present | |
| Magnetic Storage: | Present | |
| LBA Mode: | Supported | |
| DMA Mode: | Supported | |
| IORDY: | Supported | |
| IORDY Disableable: | Supported | |
| [Features] | ||
| Write Cache: | Present, Active | |
| S.M.A.R.T. Feature: | Present, Active | |
| Security Feature: | Present, Inactive | |
| Removable Media Feature: | Not Present, Disabled | |
| Power Management: | Present, Active | |
| Advanced Power Management: | Present, Active | |
| Packet Interface: | Not Present, Disabled | |
| Look-Ahead Buffer: | Present, Active | |
| Host Protected Area: | Not Present, Disabled | |
| Power-Up In Standby: | Not Suppported, Inactive | |
| Automatic Acoustic Management: | Not Suppported, Inactive | |
| 48-bit LBA: | Supported, Active | |
| Host-Initiated Link Power Management: | Not Supported | |
| Device-Initiated Link Power Management: | Supported, Enabled | |
| In-Order Data Delivery: | Not Supported | |
| Hardware Feature Control: | Not Supported | |
| Software Settings Preservation: | Supported, Enabled | |
| NCQ Autosense: | Not Supported | |
| Link Power State Device Sleep: | Supported, Enabled | |
| Hybrid Information Feature: | Not Supported | |
| Rebuild Assist: | Not Supported | |
| Power Disable: | Not Supported | |
| All Write Cache Non-Volatile: | Not Supported | |
| Extended Number of User Addressable Sectors: | Supported | |
| CFast Specification: | Not Supported | |
| NCQ Priority Information: | Supported | |
| Host Automatic Partial to Slumber Transitions: | Not Supported | |
| Device Automatic Partial to Slumber Transitions: | Not Supported | |
| NCQ Streaming: | Not Supported | |
| NCQ Queue Management Command: | Not Supported | |
| DevSleep to Reduced Power State: | Supported | |
| Extended Power Conditions Feature: | Not Supported | |
| Sense Data Reporting Feature: | Not Supported | |
| Free-Fall Control Feature: | Not Supported | |
| Write-Read-Verify Feature: | Supported, Disabled | |
| [Security] | ||
| Security Feature: | Supported | |
| Security Status: | Disabled | |
| Security Locked: | Disabled | |
| Security Frozen: | Enabled | |
| Enhanced Security Erase: | Supported | |
| Sanitize Feature: | Supported | |
| Sanitize Device - Crypto Scramble: | Not Supported | |
| Sanitize Device - Overwrite: | Not Supported | |
| Sanitize Device - Block Erase: | Supported | |
| Sanitize Device - Antifreeze Lock: | Not Supported | |
| Device Encrypts All User Data: | Not Supported | |
| Trusted Computing: | Not Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| [01] Raw Read Error Rate: | 100/Always OK, Worst: 100 | |
| [05] Reallocated Sector Count: | 100/10, Worst: 100 | |
| [09] Power-On Hours/Cycle Count: | 100/Always OK, Worst: 100 (24 hours / 1.0 days) | |
| [0C] Power Cycle Count: | 100/Always OK, Worst: 100 (Data = 314,0) | |
| [AB] Program Fail Count (Total): | 100/Always OK, Worst: 100 | |
| [AC] Erase Fail Count (Total): | 100/Always OK, Worst: 100 | |
| [AD] Wear Leveling Count/Erase Count: | 100/Always OK, Worst: 100 (Data = 6,0) | |
| [AE] Unexpected Power Loss Count: | 100/Always OK, Worst: 100 (Data = 8,0) | |
| [B7] SATA Interface Downshift / Runtime Bad Block: | 100/Always OK, Worst: 100 | |
| [B8] Reported I/O Error Detection Code Errors: | 100/Always OK, Worst: 100 | |
| [BB] Uncorrectable Error Count: | 100/Always OK, Worst: 100 | |
| [C2] Temperature | 67/Always OK, Worst: 38 (33.0 °C) | |
| [C4] Reallocation Event Count: | 100/Always OK, Worst: 100 | |
| [C5] Current Pending Sector Count: | 100/Always OK, Worst: 100 | |
| [C6] Off-Line Uncorrectable Sector Count: | 100/Always OK, Worst: 100 | |
| [C7] SATA R-Errors (CRC) Error Count: | 100/Always OK, Worst: 100 | |
| [CA] Percentage Of The Rated Lifetime Used: | 100/1, Worst: 100 | |
| [CE] Flying Height: | 100/Always OK, Worst: 100 | |
| [F6] Total Host Sector Writes: | 100/Always OK, Worst: 100 (Data = 3561525469,0) | |
| [F7] Host Program Page Count: | 100/Always OK, Worst: 100 (Data = 111594436,0) | |
| [F8] Background/FTL Program Page Count: | 100/Always OK, Worst: 100 (Data = 27677266,0) | |
| [B4] Unused Reserved Block Count (Total): | 0/Always OK, Worst: 0 (Data = 2461,0) | |
| [D2] SATA CRC Error Count: | 100/Always OK, Worst: 100 | |
| Drive Remaining Life | 100% | |
| [Device Statistics] | ||
| Lifetime Power-On Resets: | 314 | |
| Power-on Hours: | 24 | |
| Logical Sectors Written: | 3561525469 | |
| Logical Sectors Read: | 3989074164 | |
| Number of Write Commands: | 41467222 | |
| Number of Read Commands: | 43991333 | |
| Number of Reported Uncorrectable Errors: | 0 | |
| Resets Between Command Acceptance and Completion: | 314 | |
| Current Temperature: | 33 °C | |
| Operating Temperature Range: | 0 - 70 °C | |
| Lifetime Temperature: | 12 - 62 °C | |
| Time in Under-Temperature: | 0 minutes | |
| Time in Over-Temperature: | 0 minutes | |
| Number of Hardware Resets: | 859 | |
| Number of ASR Events: | 26 | |
| Number of Interface CRC Errors: | 0 | |
| Used Endurance Indicator: | 0% | |
| Audio |
| Intel Skylake PCH-H - High Definition Audio Controller |
| Audio Adapter: | Intel Skylake PCH-H - High Definition Audio Controller | |
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_A171&SUBSYS_19701043&REV_31 | |
| High Definition Audio Codec: | RealTek | |
| Audio Codec Hardware ID: | HDAUDIO\FUNC_01&VEN_10EC&DEV_0295&SUBSYS_00000000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek | |
| Driver Description: | Realtek High Definition Audio | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 6.0.1.8176 | |
| Driver Date: | 06-Jun-2017 | |
| DeviceInstanceId | HDAUDIO\FUNC_01&VEN_10EC&DEV_0295&SUBSYS_10431970&REV_1000\4&6347CD6&0&0001 | |
| Network |
| Intel 8265 Tri-Band WiFi (Oak Peak) Network Adapter |
| [General information] | ||
| Network Card: | Intel 8265 Tri-Band WiFi (Oak Peak) Network Adapter | |
| Vendor Description: | Microsoft | |
| MAC Address: | F8-94-C2-E5-D2-88 | |
| [Capabilities] | ||
| Maximum Link Speed: | 585 Mbps | |
| Transmit Buffer Size: | 9 Bytes | |
| Receive Buffer Size: | 9 Bytes | |
| Hardware ID: | PCI\VEN_8086&DEV_24FD&SUBSYS_00108086&REV_78 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Dual Band Wireless-AC 8265 | |
| Driver Provider: | Microsoft | |
| Driver Version: | 19.50.1.6 | |
| Driver Date: | 01-Jun-2017 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_24FD&SUBSYS_00108086&REV_78\4&3A3E1327&0&00E2 | |
| Location Paths | PCIROOT(0)#PCI(1C02)#PCI(0000) | |
| Ports |
| Serial Ports |
| Parallel Ports |
| USB |
| Hostitelský řadič USB kompatibilní s rozhraním xHCI |
| Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : Složené zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | TwinHan Technology | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Složené zařízení USB | |
| Hardware ID: | USB\VID_13D3&PID_5755 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní hostitelský řadič USB) | |
| Driver Description: | Složené zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.15 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_13D3&PID_5755\0001 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(4) | |
| [Port5] : No Device Connected |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port9] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0A2B | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Wireless Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 19.11.1639.649 | |
| Driver Date: | 29-Sep-2016 | |
| DeviceInstanceId | USB\VID_8087&PID_0A2B\5&350590A7&0&9 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(9) | |
| [Port10] : ELAN WBF Fingerprint Sensor |
| [Device Information] | ||
| Device Manufacturer: | Elan Microelectronics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | ELAN WBF Fingerprint Sensor | |
| Hardware ID: | USB\VID_04F3&PID_0903 | |
| [Driver Information] | ||
| Driver Manufacturer: | ELAN | |
| Driver Description: | ELAN WBF Fingerprint Sensor | |
| Driver Provider: | ELAN Finger Print | |
| Driver Version: | 1.5.12.1101 | |
| Driver Date: | 21-Apr-2017 | |
| DeviceInstanceId | USB\VID_04F3&PID_0903\5&350590A7&0&10 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10) | |
| [Port11] : Vstupní zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | Elan Microelectronics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Vstupní zařízení USB | |
| Hardware ID: | USB\VID_04F3&PID_2544 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Vstupní zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.16299.251 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_04F3&PID_2544\5&350590A7&0&11 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(11) | |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| [Port17] : No Device Connected |
| [Port18] : No Device Connected |
| [Port19] : No Device Connected |
| [Port20] : No Device Connected |
| [Port21] : No Device Connected |
| [Port22] : No Device Connected |
| [Port23] : No Device Connected |
| [Port24] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | ASUS Battery | |
| Manufacturer Name: | ASUSTeK | |
| Serial Number: | ||
| Unique ID: | ASUSTeKASUS Battery | |
| Chemistry: | ||
| Designed Capacity: | 73766 mWh | |
| Full Charged Capacity: | 72672 mWh | |
| Wear Level: | 1.5 % | |
| Cycle Count: | 16 | |
| [Current Power Status] | ||
| Power Status: | Discharging | |
| Current Capacity: | 17248 mWh (23.7 %) | |
| Current Voltage: | 15.400 V | |
| Discharge Rate: | -20528 mW | |