| HWiNFO64 v5.88-3510 |
| Creation Time | 09.09.2018 19:27 |
| DESKTOP-OA1UTR3 |
| [Current Computer] | ||
| Computer Name: | DESKTOP-OA1UTR3 | |
| Computer Brand Name: | LENOVO 81H9 | |
| [Operating System] | ||
| Operating System: | Microsoft Windows 10 Home (x64) Build 17134.228 (1803/RS4) | |
| UEFI Boot: | Present | |
| Secure Boot: | Present | |
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 4 | |
| Number Of Logical Processors: | 8 | |
| AMD Ryzen 5 2500U |
| [General Information] | ||
| Processor Name: | AMD Ryzen 5 2500U | |
| Original Processor Frequency: | 2000.0 MHz | |
| Original Processor Frequency [MHz]: | 2000 | |
| CPU ID: | 00810F10 | |
| Extended CPU ID: | 00810F10 | |
| CPU Brand Name: | AMD Ryzen 5 2500U with Radeon Vega Mobile Gfx | |
| CPU Vendor: | AuthenticAMD | |
| CPU Stepping: | RV-B0 | |
| CPU Code Name: | Raven Ridge | |
| CPU Technology: | 14 nm | |
| CPU OPN: | YM2500C4T4MFB | |
| CPU Type: | Production Unit | |
| CPU Platform: | FP5 (BGA) | |
| Microcode Update Revision: | 8101007 | |
| SMU Firmware Revision: | 30.63.0 | |
| Number of CPU Cores: | 4 | |
| Number of Logical CPUs: | 8 | |
| [Operating Points] | ||
| CPU HFM (Base): | 2000.0 MHz = 20.00 x 100.0 MHz | |
| CPU Boost Max: | 3600.0 MHz = 36.00 x 100.0 MHz | |
| CPU Current: | 1598.8 MHz = 16.00 x 99.9 MHz @ 1.1938 V | |
| CPU Bus Type: | UMI | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 4 x 64 KBytes, Data: 4 x 32 KBytes | |
| L2 Cache: | Integrated: 4 x 512 KBytes | |
| L3 Cache: | 2 x 2 MBytes | |
| Instruction TLB: | Fully associative, 64 entries | |
| Data TLB: | Fully associative, 64 entries | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Not Present | |
| Internal ACPI Support | Not Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Not Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Not Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| PCLMULQDQ Instruction Support | Present | |
| MONITOR/MWAIT Support | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| FMA Extension | Present | |
| CMPXCHG16B Support | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| x2APIC | Not Present | |
| POPCNT Instruction | Present | |
| AES Cryptography Support | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present | |
| XGETBV/XSETBV OS Enabled | Present | |
| AVX Support | Present | |
| Half-Precision Convert (CVT16) | Present | |
| [Extended Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| AMD-style Model Specific Registers | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip | Present | |
| SYSCALL and SYSRET Instructions | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Multi-Processing / Brand feature | Not Present | |
| No Execute | Present | |
| MMX Technology | Present | |
| MMX+ Extensions | Present | |
| Fast FP Save/Restore | Present | |
| Fast FP Save/Restore Optimizations | Present | |
| 1 GB large page support | Present | |
| RDTSCP Instruction | Present | |
| x86-64 Long Mode | Present | |
| 3DNow! Technology Extensions | Not Present | |
| 3DNow! Technology | Not Present | |
| Bit Manipulation Instructions Set 1 | Present | |
| Bit Manipulation Instructions Set 2 | Present | |
| Advanced Vector Extensions 2 (AVX2) | Present | |
| Advanced Vector Extensions 512 (AVX-512) | Not Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Not Present | |
| AVX-512 Doubleword and Quadword Instructions | Not Present | |
| AVX-512 Byte and Word Instructions | Not Present | |
| AVX-512 Vector Length Extensions | Not Present | |
| AVX-512 52-bit Integer FMA Instructions | Not Present | |
| Secure Hash Algorithm (SHA) Extensions | Present | |
| Software Guard Extensions (SGX) Support | Not Present | |
| Supervisor Mode Execution Protection (SMEP) | Present | |
| Supervisor Mode Access Prevention (SMAP) | Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Not Present | |
| Read/Write FS/GS Base Instructions | Present | |
| Enhanced Performance String Instruction | Not Present | |
| INVPCID Instruction | Not Present | |
| RDSEED Instruction | Present | |
| Multi-precision Add Carry Instructions (ADX) | Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Present | |
| CLWB Instructions | Not Present | |
| TSC_THREAD_OFFSET | Not Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Not Present | |
| FPU Data Pointer updated only on x87 Exceptions | Not Present | |
| Deprecated FPU CS and FPU DS | Not Present | |
| Intel Processor Trace | Not Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Not Present | |
| AVX-512 Galois Fields New Instructions | Not Present | |
| AVX-512 Vector AES | Not Present | |
| AVX-512 Vector Neural Network Instructions | Not Present | |
| AVX-512 Bit Algorithms | Not Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Not Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Not Present | |
| User-Mode Instruction Prevention | Not Present | |
| Protection Keys for User-mode Pages | Not Present | |
| OS Enabled Protection Keys | Not Present | |
| Wait and Pause Enhancements (WAITPKG) | Not Present | |
| Total Memory Encryption | Not Present | |
| Read Processor ID | Not Present | |
| Cache Line Demote | Not Present | |
| MOVDIRI: Direct Stores | Not Present | |
| MOVDIR64B: Direct Stores | Not Present | |
| SGX Launch Configuration | Not Present | |
| AVX-512 4 x Vector Neural Network Instructions Word Variable Precision | Not Present | |
| AVX-512 4 x Fused Multiply Accumulation Packed Single Precision | Not Present | |
| Fast Short REP MOV | Not Present | |
| Platform Configuration (PCONFIG) | Not Present | |
| LAHF/SAHF Long Mode Support | Present | |
| Core Multi-Processing Legacy Mode | Present | |
| Secure Virtual Machine | Present | |
| Extended APIC Register Space | Present | |
| LOCK MOV CR0 Support | Present | |
| Advanced Bit Manipulation | Present | |
| SSE4A Support | Present | |
| Misaligned SSE Mode | Present | |
| PREFETCH(W) Support | Present | |
| OS Visible Work-around Support | Present | |
| Instruction Based Sampling | Not Present | |
| XOP Instruction Support | Not Present | |
| SKINIT, STGI, and DEV Support | Present | |
| Watchdog Timer Support | Present | |
| TBM0 Instruction Support | Not Present | |
| Lightweight Profiling Support | Not Present | |
| FMA4 Instruction Support | Not Present | |
| Translation Cache Extension | Present | |
| NodeId Support | Not Present | |
| Trailing Bit Manipulation | Not Present | |
| Topology Extensions | Present | |
| Core Performance Counter Extensions | Present | |
| NB Performance Counter Extensions | Present | |
| Streaming Performance Monitor Architecture | Not Present | |
| Data Breakpoint Extension | Present | |
| Performance Time-Stamp Counter | Not Present | |
| L2I Performance Counter Extensions | Present | |
| MWAITX/MONITORX Support | Present | |
| Secure Memory Encryption | Present | |
| Secure Encrypted Virtualization | Present | |
| [Enhanced Features] | ||
| Core Performance Boost | Supported, Enabled | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 48-bit (256 TBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 0-80000000 (0MB-2048MB) Type: | Write Back (WB) | |
| Range 80000000-C0000000 (2048MB-3072MB) Type: | Write Back (WB) | |
| Range C0000000-D0000000 (3072MB-3328MB) Type: | Write Back (WB) | |
| Range FF800000-100000000 (4088MB-4096MB) Type: | Write Protected (WP) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | LENOVO 81H9 | |
| [Motherboard] | ||
| Motherboard Model: | LENOVO LNVNB161216 | |
| Motherboard Chipset: | AMD CZ FCH | |
| Motherboard Slots: | 3xPCI Express x1, 1xPCI Express x8 | |
| PCI Express Version Supported: | v3.0 | |
| USB Version Supported: | v3.1 | |
| [BIOS] | ||
| BIOS Manufacturer: | LENOVO | |
| BIOS Date: | 08/02/2018 | |
| BIOS Version: | 8MCN25WW | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | Unknown | |
| ACPI Devices |
| AMD I2C Controller |
| Device Name: | AMD I2C Controller | |
| [Assigned Resources] | ||
| IRQ: | 6 | |
| [Alternative 1] | ||
| Memory Location: | FEDC5000 - FEDC5FFF | |
| IRQ: | 6 | |
| AMD SFH I2C Controller |
| Device Name: | AMD SFH I2C Controller | |
| [Assigned Resources] | ||
| IRQ: | 10 | |
| [Alternative 1] | ||
| Memory Location: | FEDC2000 - FEDC2FFF | |
| IRQ: | 10 | |
| AMD SFH I2C Controller |
| Device Name: | AMD SFH I2C Controller | |
| [Assigned Resources] | ||
| IRQ: | 11 | |
| [Alternative 1] | ||
| Memory Location: | FEDC3000 - FEDC3FFF | |
| IRQ: | 11 | |
| AMD GPIO Controller |
| Device Name: | AMD GPIO Controller | |
| [Assigned Resources] | ||
| IRQ: | 7 | |
| [Alternative 1] | ||
| Memory Location: | FED81500 - FED818FF | |
| IRQ: | 7 | |
| Standard PS/2 Keyboard |
| Device Name: | Standard PS/2 Keyboard | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0000 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 1024 | |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 1026 | |
| Trusted Platform Module 2.0 |
| Device Name: | Trusted Platform Module 2.0 | |
| [Assigned Resources] | ||
| Memory Location: | BF7A2000 - BF7A5FFF | |
| [Alternative 1] | ||
| Memory Location: | BF7A2000 - BF7A5FFF | |
| Memory Location: | BF7A6000 - BF7A9FFF | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| IRQ: | 65792 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 00A0 - 00A1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| IRQ: | 0 | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| IRQ: | 0 | |
| IRQ: | 8 | |
| Direct memory access controller |
| Device Name: | Direct memory access controller | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - 000F | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 000F | |
| I/O Port: | 0081 - 008F | |
| I/O Port: | 00C0 - 00DF | |
| DMA: | 4 | |
| System speaker |
| Device Name: | System speaker | |
| [Assigned Resources] | ||
| I/O Port: | 0061 | |
| [Alternative 1] | ||
| I/O Port: | 0061 | |
| PCI Express Root Complex |
| Device Name: | PCI Express Root Complex | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - FFFFFFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000C4000 - 000C3FFF | |
| Memory Location: | 000CC000 - 000CFFFF | |
| Memory Location: | 000D4000 - 000D3FFF | |
| Memory Location: | 000DC000 - 000DFFFF | |
| Memory Location: | 000E4000 - 000E3FFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 000C0000 - 000C3FFF | |
| Memory Location: | 000C4000 - 000C7FFF | |
| Memory Location: | 000C8000 - 000CBFFF | |
| Memory Location: | 000CC000 - 000CFFFF | |
| Memory Location: | 000D0000 - 000D3FFF | |
| Memory Location: | 000D4000 - 000D7FFF | |
| Memory Location: | 000D8000 - 000DBFFF | |
| Memory Location: | 000DC000 - 000DFFFF | |
| Memory Location: | 000E0000 - 000E3FFF | |
| Memory Location: | 000E4000 - 000E7FFF | |
| Memory Location: | 000E8000 - 000EBFFF | |
| Memory Location: | 000EC000 - 000EFFFF | |
| Memory Location: | D0000000 - F7FFFFFF | |
| Memory Location: | FC000000 - FED3FFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0071 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0071 | |
| System board |
| Device Name: | System board | |
| [Assigned Resources] | ||
| Memory Location: | 000E0000 - 000FFFFF | |
| [Alternative 1] | ||
| Memory Location: | 000E0000 - 000FFFFF | |
| Memory Location: | FF800000 - FFFFFFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 0010 - 001F | |
| I/O Port: | 0092 | |
| I/O Port: | 0C00 - 0C01 | |
| I/O Port: | 0000 - 0C4F | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 0010 - 001F | |
| I/O Port: | 0072 - 0073 | |
| I/O Port: | 0080 | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 0092 | |
| I/O Port: | 0400 - 04CF | |
| I/O Port: | 04D0 - 04D1 | |
| I/O Port: | 04D6 | |
| I/O Port: | 0C00 - 0C01 | |
| I/O Port: | 0C14 | |
| I/O Port: | 0C50 - 0C52 | |
| I/O Port: | 0C6C | |
| I/O Port: | 0C6F | |
| I/O Port: | 0CD0 - 0CDB | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FEC00000 - FEC01FFF | |
| [Alternative 1] | ||
| Memory Location: | FEC00000 - FEC01FFF | |
| Memory Location: | FEE00000 - FEE00FFF | |
| Memory Location: | FDA00000 - FDAFFFFF | |
| Numeric data processor |
| Device Name: | Numeric data processor | |
| [Assigned Resources] | ||
| I/O Port: | 00F0 - 00FE | |
| [Alternative 1] | ||
| I/O Port: | 00F0 - 00FE | |
| IRQ: | 13 | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0062 | |
| [Alternative 1] | ||
| I/O Port: | 0062 | |
| I/O Port: | 0066 | |
| Wacom Device |
| Device Name: | Wacom Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 1025 | |
| SMBIOS DMI |
| BIOS |
| BIOS Vendor: | LENOVO | |
| BIOS Version: | 8MCN25WW | |
| BIOS Release Date: | 08/02/2018 | |
| BIOS Start Segment: | E000 | |
| BIOS Size: | 0 MBytes | |
| System BIOS Version: | 1.25 | |
| Embedded Controller Firmware Version: | 1.25 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Not Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Not Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Not Present | |
| BIOS Boot Specification Support: | Not Present | |
| Function key-initiated Network Service Boot Support: | Not Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | LENOVO | |
| Product Name: | 81H9 | |
| Product Version: | Lenovo YOGA 530-14ARR | |
| Product Serial Number: | PF17964T | |
| UUID: | {B02D4495-7C2A-11E8-AD0E-8C1645B8A61C} | |
| SKU Number: | LENOVO_MT_81H9_BU_idea_FM_YOGA 530-14ARR | |
| Family: | YOGA 530-14ARR |
| Mainboard |
| Mainboard Manufacturer: | LENOVO | |
| Mainboard Name: | LNVNB161216 | |
| Mainboard Version: | SDK0J40709 WIN | |
| Mainboard Serial Number: | PF17964T | |
| Asset Tag: | NO Asset Tag | |
| Location in chassis: | Base Board Chassis Location |
| System Enclosure |
| Manufacturer: | LENOVO | |
| Case Type: | Convertible | |
| Version: | Lenovo YOGA 530-14ARR | |
| Serial Number: | PF17964T | |
| Asset Tag Number: | NO Asset Tag |
| Processor |
| Processor Manufacturer: | Advanced Micro Devices, Inc. | |
| Processor Version: | AMD Ryzen 5 2500U with Radeon Vega Mobile Gfx | |
| External Clock: | 100 MHz | |
| Maximum Clock Supported: | 3600 MHz | |
| Current Clock: | 2000 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Voltage: | 1.2 V | |
| Processor Upgrade: | None | |
| Socket Designation: | FP5 |
| L1 - Cache |
| Socket Designation: | L1 - Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Pipeline Burst | |
| Current SRAM Type: | Pipeline Burst | |
| Cache Speed: | 1 ns | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 384 KBytes | |
| Installed Cache Size: | 384 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 - Cache |
| Socket Designation: | L2 - Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L2 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Pipeline Burst | |
| Current SRAM Type: | Pipeline Burst | |
| Cache Speed: | 1 ns | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 2048 KBytes | |
| Installed Cache Size: | 2048 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L3 - Cache |
| Socket Designation: | L3 - Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L3 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Pipeline Burst | |
| Current SRAM Type: | Pipeline Burst | |
| Cache Speed: | 1 ns | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 4096 KBytes | |
| Installed Cache Size: | 4096 KBytes | |
| Cache Associativity: | 16-way Set-Associative |
| OEM Strings |
| String1 for Original Equipment Manufacturer | ||
| String2 for Original Equipment Manufacturer | ||
| String3 for Original Equipment Manufacturer | ||
| String4 for Original Equipment Manufacturer | ||
| String5 for Original Equipment Manufacturer |
| System Configuration Options |
| String1 for Type12 Equipment Manufacturer | ||
| String2 for Type12 Equipment Manufacturer | ||
| String3 for Type12 Equipment Manufacturer | ||
| String4 for Type12 Equipment Manufacturer |
| BIOS Language |
| en|US|iso8859-1 <Active> | ||
| fr|FR|iso8859-1 | ||
| ja|JP|unicode | ||
| zh|TW|unicode |
| Built-in Pointing Device |
| Device Type: | Touch Pad | |
| Interface Type: | PS/2 | |
| Number of Buttons: | 4 |
| Hardware Security |
| Power-on Password: | Disabled | |
| Keyboard Password: | Disabled | |
| Administrator Password: | Disabled | |
| Front Panel Reset: | Disabled |
| Voltage Probe |
| Description: | Voltage Probe Description | |
| Location: | Unknown | |
| Status: | Unknown | |
| Maximum Value: | Unknown | |
| Minimum Value: | Unknown | |
| Resolution: | Unknown | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| System Boot Information |
| Boot Status: | No error occured |
| Additional Information |
| On Board Device |
| Device Description: | Broadcom 5762 | |
| Device Type: | Ethernet Adapter | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Realtek ALC701 | |
| Device Type: | Audio Device | |
| Device Status: | Enabled | |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 16 GBytes | |
| Memory Devices: | 2 |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | DIMM 0 | |
| Bank Locator: | P0 CHANNEL A | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2400 MHz | |
| Manufacturer: | Hynix | |
| Serial Number: | 2C8DCC66 | |
| Part Number: | HMA851S6CJR6N-VK | |
| Asset Tag: | Unknown |
| Memory Device |
| Total Width: | 64 bits | |
| Data Width: | 64 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | SODIMM | |
| Device Locator: | DIMM 0 | |
| Bank Locator: | P0 CHANNEL B | |
| Device Type: | DDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 2400 MHz | |
| Manufacturer: | Hynix | |
| Serial Number: | 2C8DCC65 | |
| Part Number: | HMA851S6CJR6N-VK | |
| Asset Tag: | Unknown |
| 32-bit Memory Error Information |
| 32-bit Memory Error Information |
| 32-bit Memory Error Information |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Width: | 2 |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | Unknown | |
| Interleave Data Depth: | Unknown |
| Memory Device Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 007FFFFF | |
| Partition Row Position: | Unknown | |
| Interleave Position: | Unknown | |
| Interleave Data Depth: | Unknown |
| Port Connectors |
| Keyboard Port |
| Port Type: | Keyboard Port | |
| Internal Reference: | J2604/J2606 | |
| Internal Connector Type: | None | |
| External Reference: | Keyboard | |
| External Connector Type: | PS/2 |
| Mouse Port |
| Port Type: | Mouse Port | |
| Internal Reference: | J2605 | |
| Internal Connector Type: | None | |
| External Reference: | Touch pad | |
| External Connector Type: | PS/2 |
| USB |
| Port Type: | USB | |
| Internal Reference: | J1500 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J1501 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J1502 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | J1301 | |
| Internal Connector Type: | None | |
| External Reference: | USB | |
| External Connector Type: | Access Bus (USB) |
| Network Port |
| Port Type: | Network Port | |
| Internal Reference: | J1300 | |
| Internal Connector Type: | None | |
| External Reference: | Network | |
| External Connector Type: | RJ-45 |
| SATA |
| Port Type: | SATA | |
| Internal Reference: | J1707 | |
| Internal Connector Type: | SAS/SATA Plug Receptacle | |
| External Reference: | Sata HDD | |
| External Connector Type: | None |
| SATA |
| Port Type: | SATA | |
| Internal Reference: | J1705 | |
| Internal Connector Type: | SAS/SATA Plug Receptacle | |
| External Reference: | Sata ODD | |
| External Connector Type: | None |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J1100 | |
| Internal Connector Type: | None | |
| External Reference: | DP0 | |
| External Connector Type: | None |
| Video Port |
| Port Type: | Video Port | |
| Internal Reference: | J1102 | |
| Internal Connector Type: | None | |
| External Reference: | DP2 | |
| External Connector Type: | None |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J2106 | |
| Internal Connector Type: | None | |
| External Reference: | Microphone In | |
| External Connector Type: | Mini-jack (headphones) |
| Audio Port |
| Port Type: | Audio Port | |
| Internal Reference: | J2105 | |
| Internal Connector Type: | None | |
| External Reference: | Head Phone | |
| External Connector Type: | Mini-jack (headphones) |
| System Slots |
| J3600 |
| Slot Designation: | J3600 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J3700 |
| Slot Designation: | J3700 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J3605 |
| Slot Designation: | J3605 | |
| Slot Type: | PCI Express x8 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 8x / x8 | |
| Slot Length: | Short |
| J3702 |
| Slot Designation: | J3702 | |
| Slot Type: | Unknown | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J3703 |
| Slot Designation: | J3703 | |
| Slot Type: | Unknown | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| J4000 |
| Slot Designation: | J4000 | |
| Slot Type: | PCI Express x1 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Short |
| Memory |
| [General information] | ||
| Total Memory Size: | 8 GBytes | |
| Total Memory Size [MB]: | 8192 | |
| [Current Performance Settings] | ||
| Current Memory Clock: | 1199.1 MHz | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 17-17-17-39 | |
| Memory Runs At: | Dual-Channel | |
| Command Rate: | 1T | |
| Read to Read Delay (tRD_RD) Same Rank: | 3T | |
| Read to Read Delay (tRD_RD) Different DIMM: | 3T | |
| Write to Write Delay (tWR_WR) Same Rank: | 3T | |
| Write to Write Delay (tWR_WR) Different DIMM: | 5T | |
| Read to Precharge Delay (tRTP): | 9T | |
| Write to Precharge Delay (tWTP): | 29T | |
| Write Recovery Time (tWR): | 18T | |
| Row Cycle Time (tRC): | 56T | |
| Refresh Cycle Time (tRFC): | 421T | |
| Four Activate Window (tFAW): | 36T | |
| Row: 0 - 4 GB PC4-21300 DDR4 SDRAM SK Hynix HMA851S6CJR6N-VK |
| [General Module Information] | ||
| Module Number: | 0 | |
| Module Size: | 4 GBytes | |
| Memory Type: | DDR4 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 1333.3 MHz (DDR4-2666 / PC4-21300) | |
| Module Manufacturer: | SK Hynix | |
| Module Part Number: | HMA851S6CJR6N-VK | |
| Module Revision: | 0.0 | |
| Module Serial Number: | 1724681516 | |
| Module Manufacturing Date: | Year: 2018, Week: 24 | |
| Module Manufacturing Location: | 1 | |
| SDRAM Manufacturer: | SK Hynix | |
| Error Check/Correction: | None | |
| [Module Characteristics] | ||
| Row Address Bits: | 16 | |
| Column Address Bits: | 10 | |
| Module Density: | 8192 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 16 bits | |
| Bus Width: | 64 bits | |
| Die Count: | 1 | |
| Module Nominal Voltage (VDD): | 1.2 V | |
| Minimum SDRAM Cycle Time (tCKAVGmin): | 0.75000 ns | |
| Maximum SDRAM Cycle Time (tCKAVGmax): | 1.60000 ns | |
| CAS# Latencies Supported: | 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20 | |
| Minimum CAS# Latency Time (tAAmin): | 13.750 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.750 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.750 ns | |
| Minimum Active to Precharge Time (tRASmin): | 32.000 ns | |
| Supported Module Timing at 1333.3 MHz: | 19-19-19-43 | |
| Supported Module Timing at 1200.0 MHz: | 17-17-17-39 | |
| Supported Module Timing at 1066.1 MHz: | 15-15-15-35 | |
| Supported Module Timing at 1000.0 MHz: | 14-14-14-32 | |
| Supported Module Timing at 933.3 MHz: | 13-13-13-30 | |
| Supported Module Timing at 866.7 MHz: | 12-12-12-28 | |
| Supported Module Timing at 800.0 MHz: | 11-11-11-26 | |
| Supported Module Timing at 733.3 MHz: | 11-11-11-24 | |
| Supported Module Timing at 666.7 MHz: | 10-10-10-22 | |
| Minimum Active to Active/Refresh Time (tRCmin): | 45.750 ns | |
| Minimum Refresh Recovery Time Delay (tRFC1min): | 350.000 ns | |
| Minimum Refresh Recovery Time Delay (tRFC2min): | 260.000 ns | |
| Minimum Refresh Recovery Time Delay (tRFC4min): | 160.000 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 30.000 ns | |
| Minimum Active to Active Delay Time - Different Bank Group (tRRD_Smin): | 5.300 ns | |
| Minimum Active to Active Delay Time - Same Bank Group (tRRD_Lmin): | 6.400 ns | |
| Minimum CAS to CAS Delay Time - Same Bank Group (tCCD_Lmin): | 5.000 ns | |
| [Features] | ||
| Module Temperature Sensor (TSOD): | Not Supported | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | <= 1 mm | |
| Address Mapping from Edge Connector to DRAM: | Standard | |
| Row: 2 - 4 GB PC4-21300 DDR4 SDRAM SK Hynix HMA851S6CJR6N-VK |
| [General Module Information] | ||
| Module Number: | 2 | |
| Module Size: | 4 GBytes | |
| Memory Type: | DDR4 SDRAM | |
| Module Type: | SO-DIMM | |
| Memory Speed: | 1333.3 MHz (DDR4-2666 / PC4-21300) | |
| Module Manufacturer: | SK Hynix | |
| Module Part Number: | HMA851S6CJR6N-VK | |
| Module Revision: | 0.0 | |
| Module Serial Number: | 1707904300 | |
| Module Manufacturing Date: | Year: 2018, Week: 24 | |
| Module Manufacturing Location: | 1 | |
| SDRAM Manufacturer: | SK Hynix | |
| Error Check/Correction: | None | |
| [Module Characteristics] | ||
| Row Address Bits: | 16 | |
| Column Address Bits: | 10 | |
| Module Density: | 8192 Mb | |
| Number Of Ranks: | 1 | |
| Device Width: | 16 bits | |
| Bus Width: | 64 bits | |
| Die Count: | 1 | |
| Module Nominal Voltage (VDD): | 1.2 V | |
| Minimum SDRAM Cycle Time (tCKAVGmin): | 0.75000 ns | |
| Maximum SDRAM Cycle Time (tCKAVGmax): | 1.60000 ns | |
| CAS# Latencies Supported: | 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20 | |
| Minimum CAS# Latency Time (tAAmin): | 13.750 ns | |
| Minimum RAS# to CAS# Delay (tRCDmin): | 13.750 ns | |
| Minimum Row Precharge Time (tRPmin): | 13.750 ns | |
| Minimum Active to Precharge Time (tRASmin): | 32.000 ns | |
| Supported Module Timing at 1333.3 MHz: | 19-19-19-43 | |
| Supported Module Timing at 1200.0 MHz: | 17-17-17-39 | |
| Supported Module Timing at 1066.1 MHz: | 15-15-15-35 | |
| Supported Module Timing at 1000.0 MHz: | 14-14-14-32 | |
| Supported Module Timing at 933.3 MHz: | 13-13-13-30 | |
| Supported Module Timing at 866.7 MHz: | 12-12-12-28 | |
| Supported Module Timing at 800.0 MHz: | 11-11-11-26 | |
| Supported Module Timing at 733.3 MHz: | 11-11-11-24 | |
| Supported Module Timing at 666.7 MHz: | 10-10-10-22 | |
| Minimum Active to Active/Refresh Time (tRCmin): | 45.750 ns | |
| Minimum Refresh Recovery Time Delay (tRFC1min): | 350.000 ns | |
| Minimum Refresh Recovery Time Delay (tRFC2min): | 260.000 ns | |
| Minimum Refresh Recovery Time Delay (tRFC4min): | 160.000 ns | |
| Minimum Four Activate Window Delay Time (tFAWmin): | 30.000 ns | |
| Minimum Active to Active Delay Time - Different Bank Group (tRRD_Smin): | 5.300 ns | |
| Minimum Active to Active Delay Time - Same Bank Group (tRRD_Lmin): | 6.400 ns | |
| Minimum CAS to CAS Delay Time - Same Bank Group (tCCD_Lmin): | 5.000 ns | |
| [Features] | ||
| Module Temperature Sensor (TSOD): | Not Supported | |
| Module Nominal Height: | 29 - 30 mm | |
| Module Maximum Thickness (Front): | 1 - 2 mm | |
| Module Maximum Thickness (Back): | <= 1 mm | |
| Address Mapping from Edge Connector to DRAM: | Standard | |
| Bus |
| PCI Bus #0 |
| AMD Raven - Root Complex |
| [General Information] | ||
| Device Name: | AMD Raven - Root Complex | |
| Original Device Name: | AMD Raven - Root Complex | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15D0&SUBSYS_380A17AA&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15D0&SUBSYS_380A17AA&REV_00\3&2411E6FE&1&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| AMD Raven - IOMMU |
| [General Information] | ||
| Device Name: | AMD Raven - IOMMU | |
| Original Device Name: | AMD Raven - IOMMU | |
| Device Class: | IOMMU | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:0:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15D1&SUBSYS_380917AA&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| AMD Zen - PCIe Dummy Host Bridge |
| [General Information] | ||
| Device Name: | AMD Zen - PCIe Dummy Host Bridge | |
| Original Device Name: | AMD Zen - PCIe Dummy Host Bridge | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:1:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_1452&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_1452&SUBSYS_00000000&REV_00\3&2411E6FE&1&08 | |
| Location Paths | PCIROOT(0)#PCI(0100) | |
| AMD Raven - PCIe GPP Bridge [6:0] |
| [General Information] | ||
| Device Name: | AMD Raven - PCIe GPP Bridge [6:0] | |
| Original Device Name: | AMD Raven - PCIe GPP Bridge [6:0] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:1:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15D3&SUBSYS_00000000&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 256 - 512 ns | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 512 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Kořenový port sběrnice PCI Express | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.191 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15D3&SUBSYS_14531022&REV_00\3&2411E6FE&1&0A | |
| Location Paths | PCIROOT(0)#PCI(0102) | |
| PCI Express x1 Bus #1 |
| RealTek Semiconductor, Device ID: C821 |
| [General Information] | ||
| Device Name: | RealTek Semiconductor, Device ID: C821 | |
| Original Device Name: | RealTek Semiconductor, Device ID: C821 | |
| Device Class: | Unknown Network Adapter | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 1:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_10EC&DEV_C821&SUBSYS_C02417AA&REV_00 | |
| [PCI Express] | ||
| Version: | 1.1 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 2.5 GT/s | |
| Current Link Speed: | 2.5 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 1 - 2 us | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| I/O Base Address 0 | 2000 | |
| Memory Base Address 2 | E0800000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek 8821CE Wireless LAN 802.11ac PCI-E NIC | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 2023.70.306.2018 | |
| Driver Date: | 13-Mar-2018 | |
| DeviceInstanceId | PCI\VEN_10EC&DEV_C821&SUBSYS_C02417AA&REV_00\00E04CFFFEC8210100 | |
| Location Paths | PCIROOT(0)#PCI(0102)#PCI(0000) | |
| AMD Raven - PCIe GPP Bridge [6:0] |
| [General Information] | ||
| Device Name: | AMD Raven - PCIe GPP Bridge [6:0] | |
| Original Device Name: | AMD Raven - PCIe GPP Bridge [6:0] | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:1:7 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15D3&SUBSYS_00000000&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 8x | |
| Current Link Width: | 2x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 256 - 512 ns | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 512 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Kořenový port sběrnice PCI Express | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.191 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15D3&SUBSYS_14531022&REV_00\3&2411E6FE&1&0F | |
| Location Paths | PCIROOT(0)#PCI(0107) | |
| PCI Express x8 Bus #2 |
| Hynix Semiconductor, Device ID: 1327 |
| [General Information] | ||
| Device Name: | Hynix Semiconductor, Device ID: 1327 | |
| Original Device Name: | Hynix Semiconductor, Device ID: 1327 | |
| Device Class: | NVMe Controller | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 2:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1C5C&DEV_1327&SUBSYS_00001C5C&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 2x | |
| Current Link Width: | 2x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 2 - 4 us | |
| L1 Exit Latency: | 32 - 64 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | E0700000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Řadič Standard NVM Express | |
| Driver Description: | Řadič Standard NVM Express | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.81 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1C5C&DEV_1327&SUBSYS_00001C5C&REV_00\4&1CBC3B03&0&000F | |
| Location Paths | PCIROOT(0)#PCI(0107)#PCI(0000) | |
| AMD Zen - PCIe Dummy Host Bridge |
| [General Information] | ||
| Device Name: | AMD Zen - PCIe Dummy Host Bridge | |
| Original Device Name: | AMD Zen - PCIe Dummy Host Bridge | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:8:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_1452&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_1452&SUBSYS_00000000&REV_00\3&2411E6FE&1&40 | |
| Location Paths | PCIROOT(0)#PCI(0800) | |
| AMD Raven - Internal PCIe GPP Bridge 0 to Bus A |
| [General Information] | ||
| Device Name: | AMD Raven - Internal PCIe GPP Bridge 0 to Bus A | |
| Original Device Name: | AMD Raven - Internal PCIe GPP Bridge 0 to Bus A | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:8:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15DB&SUBSYS_00000000&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 512 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Kořenový port sběrnice PCI Express | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.191 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15DB&SUBSYS_00001022&REV_00\3&2411E6FE&1&41 | |
| Location Paths | PCIROOT(0)#PCI(0801) | |
| PCI Express x16 Bus #3 |
| ATI/AMD Radeon Vega 8 (Raven) |
| [General Information] | ||
| Device Name: | ATI/AMD Radeon Vega 8 (Raven) | |
| Original Device Name: | ATI/AMD Radeon Vega 8 (Raven) | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | C4 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1002&DEV_15DD&SUBSYS_39FF17AA&REV_C4 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Legacy PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | D0000000 | |
| Memory Base Address 2 | E0000000 | |
| I/O Base Address 4 | 1000 | |
| Memory Base Address 5 | E0600000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Advanced Micro Devices, Inc. | |
| Driver Description: | AMD Radeon(TM) Vega 8 Graphics | |
| Driver Provider: | Advanced Micro Devices, Inc. | |
| Driver Version: | 23.20.822.2816 | |
| AMD Driver Package Version: | 17.40.3601.1011-180510a-328642C-Lenovo | |
| AMD Catalyst Driver Version: | 15.8 | |
| AMD Crimson Driver Version: | NDA | |
| Driver Date: | 10-May-2018 | |
| DeviceInstanceId | PCI\VEN_1002&DEV_15DD&SUBSYS_39FF17AA&REV_C4\4&26C23DB9&0&0041 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0000) | |
| ATI/AMD Display HD Audio Controller |
| [General Information] | ||
| Device Name: | ATI/AMD Display HD Audio Controller | |
| Original Device Name: | ATI/AMD Display HD Audio Controller | |
| Device Class: | Mixed mode device | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1002&DEV_15DE&SUBSYS_380317AA&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Legacy PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | IRQ53 | |
| Interrupt Pin: | INTB# | |
| Memory Base Address 0 | E0688000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | Řadič High Definition Audio | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 11-Apr-2018 | |
| DeviceInstanceId | PCI\VEN_1002&DEV_15DE&SUBSYS_380317AA&REV_00\4&26C23DB9&0&0141 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0001) | |
| AMD Raven - Cryptographic Coprocessor |
| [General Information] | ||
| Device Name: | AMD Raven - Cryptographic Coprocessor | |
| Original Device Name: | AMD Raven - Cryptographic Coprocessor | |
| Device Class: | Unknown En/Decryption | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15DF&SUBSYS_380417AA&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTC# | |
| Memory Base Address 2 | E0500000 | |
| Memory Base Address 5 | E068E000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Advanced Micro Devices Inc. | |
| Driver Description: | AMD PSP 10.0 Device | |
| Driver Provider: | Advanced Micro Devices Inc. | |
| Driver Version: | 4.5.0.0 | |
| Driver Date: | 27-Oct-2017 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15DF&SUBSYS_380417AA&REV_00\4&26C23DB9&0&0241 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0002) | |
| AMD Raven - USB 3.1 Controller |
| [General Information] | ||
| Device Name: | AMD Raven - USB 3.1 Controller | |
| Original Device Name: | AMD Raven - USB 3.1 Controller | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15E0&SUBSYS_380517AA&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTD# | |
| Memory Base Address 0 | E0400000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| USB Version Supported: | 3.1 | |
| [Driver Information] | ||
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI | |
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 10-Apr-2018 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15E0&SUBSYS_380517AA&REV_00\4&26C23DB9&0&0341 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0003) | |
| USB Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : Realtek Bluetooth Adapter |
| [Device Information] | ||
| Device Manufacturer: | RealTek | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 1.10 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Realtek Bluetooth Adapter | |
| Hardware ID: | USB\VID_0BDA&PID_C024 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek Bluetooth Adapter | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 1.5.1006.3 | |
| Driver Date: | 24-Nov-2017 | |
| DeviceInstanceId | USB\VID_0BDA&PID_C024\00E04C000001 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0003)#USBROOT(0)#USB(4) | |
| [Port5] : No Device Connected |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| AMD Raven - USB 3.1 Controller |
| [General Information] | ||
| Device Name: | AMD Raven - USB 3.1 Controller | |
| Original Device Name: | AMD Raven - USB 3.1 Controller | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15E1&SUBSYS_380617AA&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | E0300000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| USB Version Supported: | 3.1 | |
| [Driver Information] | ||
| Driver Manufacturer: | Obecný hostitelský řadič USB xHCI | |
| Driver Description: | Hostitelský řadič USB kompatibilní s rozhraním xHCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 10-Apr-2018 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15E1&SUBSYS_380617AA&REV_00\4&26C23DB9&0&0441 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004) | |
| USB Root Hub |
| [Port1] : No Device Connected |
| [Port2] : Obecný rozbočovač USB |
| [Device Information] | ||
| Device Manufacturer: | Genesys Logic | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Obecný rozbočovač USB | |
| Hardware ID: | USB\VID_05E3&PID_0608 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní rozbočovače USB) | |
| Driver Description: | Obecný rozbočovač USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.228 | |
| Driver Date: | 02-Aug-2018 | |
| DeviceInstanceId | USB\VID_05E3&PID_0608\6&369C7F4&0&2 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004)#USBROOT(0)#USB(2) | |
| [Port1] : Složené zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | TwinHan Technology | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Složené zařízení USB | |
| Hardware ID: | USB\VID_13D3&PID_56B2 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní hostitelský řadič USB) | |
| Driver Description: | Složené zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_13D3&PID_56B2\7&442888D&0&1 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004)#USBROOT(0)#USB(2)#USB(1) | |
| [Port2] : Synaptics WBDI |
| [Device Information] | ||
| Device Manufacturer: | Synaptics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Synaptics WBDI | |
| Hardware ID: | USB\VID_06CB&PID_0081 | |
| [Driver Information] | ||
| Driver Manufacturer: | Synaptics Incorporated | |
| Driver Description: | Synaptics WBDI | |
| Driver Provider: | Synaptics Incorporated | |
| Driver Version: | 5.5.2725.1050 | |
| Driver Date: | 25-Dec-2017 | |
| DeviceInstanceId | USB\VID_06CB&PID_0081\30B09886773F | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004)#USBROOT(0)#USB(2)#USB(2) | |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port3] : No Device Connected |
| AMD Raven - Audio Processor - HD Audio Controller |
| [General Information] | ||
| Device Name: | AMD Raven - Audio Processor - HD Audio Controller | |
| Original Device Name: | AMD Raven - Audio Processor - HD Audio Controller | |
| Device Class: | Mixed mode device | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:6 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15E3&SUBSYS_380C17AA&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | IRQ54 | |
| Interrupt Pin: | INTC# | |
| Memory Base Address 0 | E0680000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Microsoft | |
| Driver Description: | Řadič High Definition Audio | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 11-Apr-2018 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15E3&SUBSYS_380C17AA&REV_00\4&26C23DB9&0&0641 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0006) | |
| AMD Raven - Non-Sensor Fusion Hub device |
| [General Information] | ||
| Device Name: | AMD Raven - Non-Sensor Fusion Hub device | |
| Original Device Name: | AMD Raven - Non-Sensor Fusion Hub device | |
| Device Class: | Reserved | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 3:0:7 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15E6&SUBSYS_15E41022&REV_00 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 16x | |
| Current Link Width: | 16x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L0s and L1 Entry | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 128 bytes | |
| [System Resources] | ||
| Interrupt Line: | IRQ55 | |
| Interrupt Pin: | INTD# | |
| Memory Base Address 2 | E0200000 | |
| Memory Base Address 5 | E068C000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Advanced Micro Devices Inc. | |
| Driver Description: | AMD SFH KMDF I2C | |
| Driver Provider: | Advanced Micro Devices Inc. | |
| Driver Version: | 1.0.0.73 | |
| Driver Date: | 25-Apr-2018 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15E6&SUBSYS_15E41022&REV_00\4&26C23DB9&0&0741 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0007) | |
| AMD Carrizo FCH - SMBus and ACPI Controller |
| [General Information] | ||
| Device Name: | AMD Carrizo FCH - SMBus and ACPI Controller | |
| Original Device Name: | AMD Carrizo FCH - SMBus and ACPI Controller | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 61 | |
| PCI Address (Bus:Device:Function) Number: | 0:20:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_790B&SUBSYS_381817AA&REV_61 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Advanced Micro Devices, Inc | |
| Driver Description: | AMD SMBus | |
| Driver Provider: | Advanced Micro Devices, Inc | |
| Driver Version: | 5.12.0.38 | |
| Driver Date: | 10-Oct-2017 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_790B&SUBSYS_381817AA&REV_61\3&2411E6FE&1&A0 | |
| Location Paths | PCIROOT(0)#PCI(1400) | |
| AMD Carrizo FCH - LPC Bridge |
| [General Information] | ||
| Device Name: | AMD Carrizo FCH - LPC Bridge | |
| Original Device Name: | AMD Carrizo FCH - LPC Bridge | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 51 | |
| PCI Address (Bus:Device:Function) Number: | 0:20:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_790E&SUBSYS_381917AA&REV_51 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most pro ISA ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_790E&SUBSYS_381917AA&REV_51\3&2411E6FE&1&A3 | |
| Location Paths | PCIROOT(0)#PCI(1403) | |
| AMD Raven - Data Fabric: Function 0 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 0 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 0 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15E8&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15E8&SUBSYS_00000000&REV_00\3&2411E6FE&1&C0 | |
| Location Paths | PCIROOT(0)#PCI(1800) | |
| AMD Raven - Data Fabric: Function 1 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 1 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 1 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15E9&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15E9&SUBSYS_00000000&REV_00\3&2411E6FE&1&C1 | |
| Location Paths | PCIROOT(0)#PCI(1801) | |
| AMD Raven - Data Fabric: Function 2 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 2 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 2 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15EA&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15EA&SUBSYS_00000000&REV_00\3&2411E6FE&1&C2 | |
| Location Paths | PCIROOT(0)#PCI(1802) | |
| AMD Raven - Data Fabric: Function 3 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 3 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 3 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15EB&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15EB&SUBSYS_00000000&REV_00\3&2411E6FE&1&C3 | |
| Location Paths | PCIROOT(0)#PCI(1803) | |
| AMD Raven - Data Fabric: Function 4 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 4 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 4 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15EC&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15EC&SUBSYS_00000000&REV_00\3&2411E6FE&1&C4 | |
| Location Paths | PCIROOT(0)#PCI(1804) | |
| AMD Raven - Data Fabric: Function 5 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 5 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 5 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:5 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15ED&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15ED&SUBSYS_00000000&REV_00\3&2411E6FE&1&C5 | |
| Location Paths | PCIROOT(0)#PCI(1805) | |
| AMD Raven - Data Fabric: Function 6 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 6 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 6 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:6 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15EE&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15EE&SUBSYS_00000000&REV_00\3&2411E6FE&1&C6 | |
| Location Paths | PCIROOT(0)#PCI(1806) | |
| AMD Raven - Data Fabric: Function 7 |
| [General Information] | ||
| Device Name: | AMD Raven - Data Fabric: Function 7 | |
| Original Device Name: | AMD Raven - Data Fabric: Function 7 | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:24:7 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_1022&DEV_15EF&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní systémová zařízení) | |
| Driver Description: | Most hostitelského procesoru ve standardu PCI | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_1022&DEV_15EF&SUBSYS_00000000&REV_00\3&2411E6FE&1&C7 | |
| Location Paths | PCIROOT(0)#PCI(1807) | |
| Video Adapter |
| AMD Radeon Vega 8 |
| [Video chipset] | ||
| Video Chipset: | AMD Radeon Vega 8 | |
| Video Chipset Codename: | Raven | |
| Video Memory: | 256 MBytes of DDR4 SDRAM | |
| [Video Card] | ||
| Video Card: | AMD Radeon Vega 8 (Raven) [Lenovo] | |
| Video Bus: | PCIe v3.0 x16 (8.0 GT/s) @ x16 (8.0 GT/s) | |
| Video RAMDAC: | Internal DAC(400MHz) | |
| Video BIOS Version: | 016.002.000.004 | |
| [Performance] | ||
| Processor Clock: | 400.0 MHz | |
| Memory Clock: | 933.0 MHz (Effective 1866.0 MHz) | |
| Memory Bus Width: | 128-bit | |
| Number Of ROPs: | 8 | |
| Number Of Unified Shaders: | 512 | |
| Number Of TMUs (Texture Mapping Units): | 32 | |
| Hardware ID: | PCI\VEN_1002&DEV_15DD&SUBSYS_39FF17AA&REV_C4 | |
| PCI Location (Bus:Dev:Fnc): | 3:00:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Advanced Micro Devices, Inc. | |
| Driver Description: | AMD Radeon(TM) Vega 8 Graphics | |
| Driver Provider: | Advanced Micro Devices, Inc. | |
| Driver Version: | 23.20.822.2816 | |
| AMD Driver Package Version: | 17.40.3601.1011-180510a-328642C-Lenovo | |
| AMD Catalyst Driver Version: | 15.8 | |
| AMD Crimson Driver Version: | NDA | |
| Driver Date: | 10-May-2018 | |
| DeviceInstanceId | PCI\VEN_1002&DEV_15DD&SUBSYS_39FF17AA&REV_C4\4&26C23DB9&0&0041 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0000) | |
| Monitor |
| AU Optronics [Unknown Model: AUO403D] |
| [General information] | ||
| Monitor Name: | AU Optronics [Unknown Model: AUO403D] | |
| Monitor Name (Manuf): | AUO B140HAN04.0 | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 0, Year: 2016 | |
| Monitor Hardware ID: | Monitor\AUO403D | |
| Max. Vertical Size: | 17 cm | |
| Max. Horizontal Size: | 31 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 8 Bits per Primary Color | |
| Digital Video Interface Standard Supported: | DisplayPort | |
| Display Type: | Monochrome/grey scale | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF Supported: | Not Supported | |
| DFP 1.x Compatible: | Yes | |
| [Supported Video Modes] | ||
| 1920 x 1080 | 309 x 173 mm, Pixel Clock 141.00 MHz | |
| Drives |
| (S)ATA/ATAPI Drives |
| HFM256GDHTNG-8310A |
| Drive Model: | HFM256GDHTNG-8310A | |
| Drive Serial Number: | FI85N104210306Q3L | |
| Drive Firmware Revision: | 80060C00 | |
| NVMe Version Supported: | v1.2 | |
| Drive Capacity: | 244,198 MBytes (256 GB) | |
| Drive Capacity [MB]: | 244198 | |
| [Capabilities] | ||
| Volatile Write Cache: | Present | |
| Compare Command: | Not Supported | |
| Write Uncorrectable Command: | Supported | |
| Dataset Management: | Supported | |
| Write Zeroes: | Not Supported | |
| Save field set to a non-zero value: | Supported | |
| Reservations: | Not Supported | |
| Timestamp: | Not Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| Available Space Below Threshold: | OK | |
| Temperature Exceeded Critical Threshold: | OK | |
| Device Reliablity Degraded: | OK | |
| Media In Read Only Mode: | OK | |
| Volatile Memory Backup Device Failed: | OK | |
| Drive Temperature: | 43 °C | |
| Warning Temperature Threshold: | 81 °C | |
| Critical Temperature Threshold: | 82 °C | |
| Time Above Warning Temperature Threshold: | 0 minutes | |
| Time Above Critical Temperature Threshold: | 0 minutes | |
| Spare Capacity Available: | 100% | |
| Device Health: | 100% | |
| Power Cycles: | 105 | |
| Power On Hours: | 19 hours | |
| Unsafe Shutdowns: | 3 | |
| Media Errors: | 0 | |
| Total Host Reads: | 1014 GBytes | |
| Total Host Writes: | 1167 GBytes | |
| Audio |
| ATI/AMD Display HD Audio Controller |
| Audio Adapter: | ATI/AMD Display HD Audio Controller | |
| Audio Controller Hardware ID: | PCI\VEN_1002&DEV_15DE&SUBSYS_380317AA&REV_00 | |
| High Definition Audio Codec: | ATi RADEON HDMI | |
| Audio Codec Hardware ID: | HDAUDIO\FUNC_01&VEN_1002&DEV_AA01&SUBSYS_00000000 | |
| [Driver Information] | ||
| Driver Manufacturer: | Advanced Micro Devices | |
| Driver Description: | AMD High Definition Audio Device | |
| Driver Provider: | Advanced Micro Devices | |
| Driver Version: | 10.0.1.6 | |
| Driver Date: | 16-Nov-2017 | |
| DeviceInstanceId | HDAUDIO\FUNC_01&VEN_1002&DEV_AA01&SUBSYS_00AA0100&REV_1007\5&2C825D63&0&0001 | |
| AMD Raven - Audio Processor - HD Audio Controller |
| Audio Adapter: | AMD Raven - Audio Processor - HD Audio Controller | |
| Audio Controller Hardware ID: | PCI\VEN_1022&DEV_15E3&SUBSYS_380C17AA&REV_00 |
| Network |
| RealTek Semiconductor, Device ID: C821 |
| [General information] | ||
| Network Card: | RealTek Semiconductor, Device ID: C821 | |
| Vendor Description: | Microsoft | |
| MAC Address: | B0-FC-36-AB-A0-4F | |
| [Capabilities] | ||
| Maximum Link Speed: | 433 Mbps | |
| Transmit Buffer Size: | 9 Bytes | |
| Receive Buffer Size: | 9 Bytes | |
| Hardware ID: | PCI\VEN_10EC&DEV_C821&SUBSYS_C02417AA&REV_00 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek 8821CE Wireless LAN 802.11ac PCI-E NIC | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 2023.70.306.2018 | |
| Driver Date: | 13-Mar-2018 | |
| DeviceInstanceId | PCI\VEN_10EC&DEV_C821&SUBSYS_C02417AA&REV_00\00E04CFFFEC8210100 | |
| Location Paths | PCIROOT(0)#PCI(0102)#PCI(0000) | |
| Ports |
| Serial Ports |
| Parallel Ports |
| USB |
| Hostitelský řadič USB kompatibilní s rozhraním xHCI |
| Root Hub |
| [Port1] : No Device Connected |
| [Port2] : Obecný rozbočovač USB |
| [Device Information] | ||
| Device Manufacturer: | Genesys Logic | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Obecný rozbočovač USB | |
| Hardware ID: | USB\VID_05E3&PID_0608 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní rozbočovače USB) | |
| Driver Description: | Obecný rozbočovač USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.228 | |
| Driver Date: | 02-Aug-2018 | |
| DeviceInstanceId | USB\VID_05E3&PID_0608\6&369C7F4&0&2 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004)#USBROOT(0)#USB(2) | |
| [Port1] : Složené zařízení USB |
| [Device Information] | ||
| Device Manufacturer: | TwinHan Technology | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | Složené zařízení USB | |
| Hardware ID: | USB\VID_13D3&PID_56B2 | |
| [Driver Information] | ||
| Driver Manufacturer: | (Standardní hostitelský řadič USB) | |
| Driver Description: | Složené zařízení USB | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.17134.1 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_13D3&PID_56B2\7&442888D&0&1 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004)#USBROOT(0)#USB(2)#USB(1) | |
| [Port2] : Synaptics WBDI |
| [Device Information] | ||
| Device Manufacturer: | Synaptics | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Synaptics WBDI | |
| Hardware ID: | USB\VID_06CB&PID_0081 | |
| [Driver Information] | ||
| Driver Manufacturer: | Synaptics Incorporated | |
| Driver Description: | Synaptics WBDI | |
| Driver Provider: | Synaptics Incorporated | |
| Driver Version: | 5.5.2725.1050 | |
| Driver Date: | 25-Dec-2017 | |
| DeviceInstanceId | USB\VID_06CB&PID_0081\30B09886773F | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0004)#USBROOT(0)#USB(2)#USB(2) | |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port3] : No Device Connected |
| Hostitelský řadič USB kompatibilní s rozhraním xHCI |
| Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : Realtek Bluetooth Adapter |
| [Device Information] | ||
| Device Manufacturer: | RealTek | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 1.10 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Realtek Bluetooth Adapter | |
| Hardware ID: | USB\VID_0BDA&PID_C024 | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek Bluetooth Adapter | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 1.5.1006.3 | |
| Driver Date: | 24-Nov-2017 | |
| DeviceInstanceId | USB\VID_0BDA&PID_C024\00E04C000001 | |
| Location Paths | PCIROOT(0)#PCI(0801)#PCI(0003)#USBROOT(0)#USB(4) | |
| [Port5] : No Device Connected |
| [Port6] : No Device Connected |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | L17C4PB0 | |
| Manufacturer Name: | CPT-COS | |
| Serial Number: | 5610 | |
| Unique ID: | 5610CPT-COSL17C4PB0 | |
| Chemistry: | ||
| Designed Capacity: | 45520 mWh | |
| Full Charged Capacity: | 44550 mWh | |
| Wear Level: | 2.1 % | |
| [Current Power Status] | ||
| Power Status: | On AC Power | |
| Current Capacity: | 42780 mWh (96.0 %) | |
| Current Voltage: | 8.595 V | |